Cloxacillin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0343 | 
| Substance Name | Beta lactamides | 
| Substance Chinese Name | Β-内酰胺类药物 | 
| Molecular Name | Cloxacillin | 
| Molecular Chinese Name | 邻氯青霉素 | 
| 2D Structure | |
| CAS Number | 61-72-3 | 
| PubChem CID | 6098 | 
| Formula | C19H18ClN3O5S | 
| IUPAC Name | (2S,5R,6R)-6-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 
| InChI Key | LQOLIRLGBULYKD-JKIFEVAISA-N | 
| InChI | InChI=1S/C19H18ClN3O5S/c1-8-11(12(22-28-8)9-6-4-5-7-10(9)20)15(24)21-13-16(25)23-14(18(26)27)19(2,3)29-17(13)23/h4-7,13-14,17H,1-3H3,(H,21,24)(H,26,27)/t13-,14+,17-/m1/s1 | 
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NC3C4N(C3=O)C(C(S4)(C)C)C(=O)O  | 
| Isomeric SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)O  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            Cloxacillin
        
            Cloxacillinum
        
            Cloxacilina
        
            Cloxacilline
        
            61-72-3
        
            Syntarpen
        
            Cloxacillin sodium
        
            Methocillin S
        
            Tegopen
        
            Clossacillina
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:47 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 435.9 | 
| Hydrogen Bond Donor Count | 2 | 
| Hydrogen Bond Acceptor Count | 7 | 
| Rotatable Bond Count | 4 | 
| Complexity | 722 | 
| Monoisotopic Mass | 435.0655696 | 
| Exact Mass | 435.0655696 | 
| XLogP | 2.4 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 29 | 
| Defined Atom Stereocenter Count | 3 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9903 | 
| Human Intestinal Absorption | HIA+ | 0.8368 | 
| Caco-2 Permeability | Caco2- | 0.8957 | 
| P-glycoprotein Substrate | Non-substrate | 0.6204 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8951 | 
| Non-inhibitor | 0.9204 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9629 | 
| Distribution | ||
| Subcellular localization | Lysosome | 0.4793 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8262 | 
| CYP450 2D6 Substrate | Non-substrate | 0.9050 | 
| CYP450 3A4 Substrate | Substrate | 0.5977 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.8592 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8910 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9180 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8832 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8190 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9186 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9996 | 
| Non-inhibitor | 0.8486 | |
| AMES Toxicity | Non AMES toxic | 0.6979 | 
| Carcinogens | Carcinogens | 0.5672 | 
| Fish Toxicity | High FHMT | 0.9935 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9330 | 
| Honey Bee Toxicity | Low HBT | 0.7854 | 
| Biodegradation | Not ready biodegradable | 1.0000 | 
| Acute Oral Toxicity | III | 0.4590 | 
| Carcinogenicity (Three-class) | Non-required | 0.5685 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.6522 | LogS | 
| Caco-2 Permeability | 0.5434 | LogPapp, cm/s | 
| Rat Acute Toxicity | 1.9946 | LD50, mol/kg | 
| Fish Toxicity | 1.2659 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.7233 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Cloxacillin sodium  | 
            
            
            
            
            ToxCast & Tox21 Chemicals  | 
            Link  | 
        ||
Dicloxacillin  | 
            
            
            
            
            FRCD  | 
            Link  | 
        ||
Flucloxacillin  | 
            
            
            
            
            DrugBank, ToxinDB,  | 
            Link  | 
        ||
Oxacillin  | 
            
            
            
            
            FRCD  | 
            Link  | 
        ||
Oxacillin sodium salt  | 
            
            
            
            
            ToxCast & Tox21 Chemicals  | 
            Link  | 
        ||
Dicloxacillin sodium salt monohydrate  | 
            
            
            
            
            ToxCast & Tox21 Chemicals  | 
            Link  | 
        
