Cloxacillin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0343 |
| Substance Name | Beta lactamides |
| Substance Chinese Name | Β-内酰胺类药物 |
| Molecular Name | Cloxacillin |
| Molecular Chinese Name | 邻氯青霉素 |
| 2D Structure | |
| CAS Number | 61-72-3 |
| PubChem CID | 6098 |
| Formula | C19H18ClN3O5S |
| IUPAC Name | (2S,5R,6R)-6-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI Key | LQOLIRLGBULYKD-JKIFEVAISA-N |
| InChI | InChI=1S/C19H18ClN3O5S/c1-8-11(12(22-28-8)9-6-4-5-7-10(9)20)15(24)21-13-16(25)23-14(18(26)27)19(2,3)29-17(13)23/h4-7,13-14,17H,1-3H3,(H,21,24)(H,26,27)/t13-,14+,17-/m1/s1 |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NC3C4N(C3=O)C(C(S4)(C)C)C(=O)O |
| Isomeric SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
Cloxacillin
Cloxacillinum
Cloxacilina
Cloxacilline
61-72-3
Syntarpen
Cloxacillin sodium
Methocillin S
Tegopen
Clossacillina
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:47 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 435.9 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Complexity | 722 |
| Monoisotopic Mass | 435.0655696 |
| Exact Mass | 435.0655696 |
| XLogP | 2.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9903 |
| Human Intestinal Absorption | HIA+ | 0.8368 |
| Caco-2 Permeability | Caco2- | 0.8957 |
| P-glycoprotein Substrate | Non-substrate | 0.6204 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8951 |
| Non-inhibitor | 0.9204 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9629 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4793 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8262 |
| CYP450 2D6 Substrate | Non-substrate | 0.9050 |
| CYP450 3A4 Substrate | Substrate | 0.5977 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.8592 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8910 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9180 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8832 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8190 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9186 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9996 |
| Non-inhibitor | 0.8486 | |
| AMES Toxicity | Non AMES toxic | 0.6979 |
| Carcinogens | Carcinogens | 0.5672 |
| Fish Toxicity | High FHMT | 0.9935 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9330 |
| Honey Bee Toxicity | Low HBT | 0.7854 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.4590 |
| Carcinogenicity (Three-class) | Non-required | 0.5685 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.6522 | LogS |
| Caco-2 Permeability | 0.5434 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.9946 | LD50, mol/kg |
| Fish Toxicity | 1.2659 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7233 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0088 |
| Food Image | ![]() |
| Food Name | Raw aquatic products |
| Food Chinese Name | 生食水产品 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Cloxacillin sodium |
ToxCast & Tox21 Chemicals |
Link |
||
Dicloxacillin |
FRCD |
Link |
||
Flucloxacillin |
DrugBank, ToxinDB, |
Link |
||
Oxacillin |
FRCD |
Link |
||
Oxacillin sodium salt |
ToxCast & Tox21 Chemicals |
Link |
||
Dicloxacillin sodium salt monohydrate |
ToxCast & Tox21 Chemicals |
Link |
