Benzacillin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0345 |
| Substance Name | Beta lactamides |
| Substance Chinese Name | Β-内酰胺类药物 |
| Molecular Name | Benzacillin |
| Molecular Chinese Name | 苯唑青霉素 |
| 2D Structure | |
| CAS Number | 1538-09-6 |
| PubChem CID | 15232 |
| Formula | C48H56N6O8S2 |
| IUPAC Name | N,N'-dibenzylethane-1,2-diamine;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChI Key | BVGLIYRKPOITBQ-ANPZCEIESA-N |
| InChI | InChI=1S/2C16H18N2O4S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12+,14-;/m11./s1 |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2 |
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2 |
| CFM-ID 3.0 | URL Link |
| Related links | Dining |
| Addition Purposes | Sterilization, Antiseptic |
| Molecular Synonyms |
1538-09-6
Debecillin
Pendepon
Penduran
BENZATHINE PENICILLIN G
Benzacillin
Diaminocillina
Dibencillin
Lentocillin
Extenicilline
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:47 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 909.1 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 15 |
| Complexity | 701 |
| Monoisotopic Mass | 908.36010514 |
| Exact Mass | 908.36010514 |
| Formal Charge | 0 |
| Heavy Atom Count | 64 |
| Defined Atom Stereocenter Count | 6 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 3 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9974 |
| Human Intestinal Absorption | HIA- | 0.9458 |
| Caco-2 Permeability | Caco2- | 0.8067 |
| P-glycoprotein Substrate | Substrate | 0.9061 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7317 |
| Non-inhibitor | 0.9828 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8909 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.6224 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7079 |
| CYP450 2D6 Substrate | Non-substrate | 0.7631 |
| CYP450 3A4 Substrate | Substrate | 0.6163 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8831 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8341 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8831 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7228 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.5000 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9107 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9943 |
| Inhibitor | 0.5841 | |
| AMES Toxicity | Non AMES toxic | 0.8456 |
| Carcinogens | Non-carcinogens | 0.7912 |
| Fish Toxicity | High FHMT | 0.9899 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9288 |
| Honey Bee Toxicity | Low HBT | 0.7499 |
| Biodegradation | Not ready biodegradable | 0.9898 |
| Acute Oral Toxicity | III | 0.5686 |
| Carcinogenicity (Three-class) | Non-required | 0.6451 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8653 | LogS |
| Caco-2 Permeability | -0.0272 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.2251 | LD50, mol/kg |
| Fish Toxicity | 1.4666 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3978 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0088 |
| Food Image | ![]() |
| Food Name | Raw aquatic products |
| Food Chinese Name | 生食水产品 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
