Benzacillin
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0345 | 
| Substance Name | Beta lactamides | 
| Substance Chinese Name | Β-内酰胺类药物 | 
| Molecular Name | Benzacillin | 
| Molecular Chinese Name | 苯唑青霉素 | 
| 2D Structure | |
| CAS Number | 1538-09-6 | 
| PubChem CID | 15232 | 
| Formula | C48H56N6O8S2 | 
| IUPAC Name | N,N'-dibenzylethane-1,2-diamine;(2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid | 
| InChI Key | BVGLIYRKPOITBQ-ANPZCEIESA-N | 
| InChI | InChI=1S/2C16H18N2O4S.C16H20N2/c2*1-16(2)12(15(21)22)18-13(20)11(14(18)23-16)17-10(19)8-9-6-4-3-5-7-9;1-3-7-15(8-4-1)13-17-11-12-18-14-16-9-5-2-6-10-16/h2*3-7,11-12,14H,8H2,1-2H3,(H,17,19)(H,21,22);1-10,17-18H,11-14H2/t2*11-,12+,14-;/m11./s1 | 
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.CC1(C(N2C(S1)C(C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2  | 
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Dining | 
| Addition Purposes | Sterilization, Antiseptic | 
| Molecular Synonyms | 
        
            1538-09-6
        
            Debecillin
        
            Pendepon
        
            Penduran
        
            BENZATHINE PENICILLIN G
        
            Benzacillin
        
            Diaminocillina
        
            Dibencillin
        
            Lentocillin
        
            Extenicilline
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:47 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 909.1 | 
| Hydrogen Bond Donor Count | 6 | 
| Hydrogen Bond Acceptor Count | 12 | 
| Rotatable Bond Count | 15 | 
| Complexity | 701 | 
| Monoisotopic Mass | 908.36010514 | 
| Exact Mass | 908.36010514 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 64 | 
| Defined Atom Stereocenter Count | 6 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 3 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.9974 | 
| Human Intestinal Absorption | HIA- | 0.9458 | 
| Caco-2 Permeability | Caco2- | 0.8067 | 
| P-glycoprotein Substrate | Substrate | 0.9061 | 
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7317 | 
| Non-inhibitor | 0.9828 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8909 | 
| Distribution | ||
| Subcellular localization | Lysosome | 0.6224 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7079 | 
| CYP450 2D6 Substrate | Non-substrate | 0.7631 | 
| CYP450 3A4 Substrate | Substrate | 0.6163 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8831 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8341 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8831 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7228 | 
| CYP450 3A4 Inhibitor | Inhibitor | 0.5000 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9107 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9943 | 
| Inhibitor | 0.5841 | |
| AMES Toxicity | Non AMES toxic | 0.8456 | 
| Carcinogens | Non-carcinogens | 0.7912 | 
| Fish Toxicity | High FHMT | 0.9899 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9288 | 
| Honey Bee Toxicity | Low HBT | 0.7499 | 
| Biodegradation | Not ready biodegradable | 0.9898 | 
| Acute Oral Toxicity | III | 0.5686 | 
| Carcinogenicity (Three-class) | Non-required | 0.6451 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -2.8653 | LogS | 
| Caco-2 Permeability | -0.0272 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.2251 | LD50, mol/kg | 
| Fish Toxicity | 1.4666 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.3978 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0088 | 
| Food Image | ![]()  | 
        
| Food Name | Raw aquatic products | 
| Food Chinese Name | 生食水产品 | 
| Food Type | Non-processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
