Zearalenol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0347 |
| Substance Name | Zeranol |
| Substance Chinese Name | 玉米赤霉醇 |
| Molecular Name | Zearalenol |
| Molecular Chinese Name | Α-玉米赤霉烯醇 |
| 2D Structure | |
| CAS Number | 5916-52-9 |
| PubChem CID | 5933650 |
| Formula | C18H24O5 |
| IUPAC Name | (12E)-8,16,18-trihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraen-2-one |
| InChI Key | FPQFYIAXQDXNOR-XVNBXDOJSA-N |
| InChI | InChI=1S/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+ |
| Canonical SMILES | CC1CCCC(CCCC=CC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Isomeric SMILES | CC1CCCC(CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Growth-promoting |
| Molecular Synonyms |
Zearalenol
.beta.-Zearalenol
5916-52-9
AC1NZHUL
SCHEMBL588698
SCHEMBL588699
FPQFYIAXQDXNOR-XVNBXDOJSA-N
1H-2-Benzoxacyclotetradecin-1-one, 3,4,5,6,7,8,9,10-octahydro-7,14,16-trihydroxy-3-methyl-, (3S,7S,11E)-
36455-72-8
BCP11524
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:13 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 320.4 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Complexity | 408 |
| Monoisotopic Mass | 320.16237387 |
| Exact Mass | 320.16237387 |
| XLogP | 4 |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.6232 |
| Human Intestinal Absorption | HIA+ | 0.9774 |
| Caco-2 Permeability | Caco2+ | 0.6384 |
| P-glycoprotein Substrate | Substrate | 0.7665 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9861 |
| Non-inhibitor | 0.9729 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9107 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6120 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7044 |
| CYP450 2D6 Substrate | Non-substrate | 0.8247 |
| CYP450 3A4 Substrate | Substrate | 0.5154 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.7660 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8937 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9007 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7246 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.7682 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8975 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9040 |
| Non-inhibitor | 0.8444 | |
| AMES Toxicity | Non AMES toxic | 0.8792 |
| Carcinogens | Non-carcinogens | 0.9616 |
| Fish Toxicity | High FHMT | 0.9724 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9973 |
| Honey Bee Toxicity | High HBT | 0.7104 |
| Biodegradation | Ready biodegradable | 0.5709 |
| Acute Oral Toxicity | III | 0.3986 |
| Carcinogenicity (Three-class) | Non-required | 0.6604 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.1683 | LogS |
| Caco-2 Permeability | 0.7022 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.1384 | LD50, mol/kg |
| Fish Toxicity | 1.0197 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.0235 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0080 |
| Food Image | ![]() |
| Food Name | Milk |
| Food Chinese Name | 牛奶 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Zearalenone |
OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
Link |
||
Cis-Zearalenone |
OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
Link |
||
(S,E)-Zearalenone |
OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
Link |

