Zearalenone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0351 |
| Substance Name | Zeranol |
| Substance Chinese Name | 玉米赤霉醇 |
| Molecular Name | Zearalenone |
| Molecular Chinese Name | 玉米赤霉烯酮 |
| 2D Structure | |
| CAS Number | 17924-92-4 |
| PubChem CID | 5281576 |
| Formula | C18H22O5 |
| IUPAC Name | (4S,12E)-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),12,15,17-tetraene-2,8-dione |
| InChI Key | MBMQEIFVQACCCH-QBODLPLBSA-N |
| InChI | InChI=1S/C18H22O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,20-21H,2,4-6,8-9H2,1H3/b7-3+/t12-/m0/s1 |
| Canonical SMILES | CC1CCCC(=O)CCCC=CC2=C(C(=CC(=C2)O)O)C(=O)O1 |
| Isomeric SMILES | C[C@H]1CCCC(=O)CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1 |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding |
| Addition Purposes | Growth-promoting |
| Molecular Synonyms |
ZEARALENONE
17924-92-4
Trans-Zearalenone
(-)-Zearalenone
F-2 toxin
Mycotoxin F2
Zenone
(S)-Zearalenone
Toxin F2
(S)-(-)-Zearalenone
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:14 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 318.4 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 0 |
| Complexity | 445 |
| Monoisotopic Mass | 318.14672381 |
| Exact Mass | 318.14672381 |
| XLogP | 3.6 |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.6088 |
| Human Intestinal Absorption | HIA+ | 0.9535 |
| Caco-2 Permeability | Caco2+ | 0.6456 |
| P-glycoprotein Substrate | Substrate | 0.6906 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9807 |
| Non-inhibitor | 0.9352 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9043 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5368 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7236 |
| CYP450 2D6 Substrate | Non-substrate | 0.8290 |
| CYP450 3A4 Substrate | Non-substrate | 0.5498 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.6895 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8490 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9160 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7595 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.7960 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9208 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8399 |
| Non-inhibitor | 0.8640 | |
| AMES Toxicity | Non AMES toxic | 0.9133 |
| Carcinogens | Non-carcinogens | 0.9531 |
| Fish Toxicity | High FHMT | 0.9772 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9849 |
| Honey Bee Toxicity | High HBT | 0.6726 |
| Biodegradation | Not ready biodegradable | 0.5304 |
| Acute Oral Toxicity | IV | 0.6128 |
| Carcinogenicity (Three-class) | Non-required | 0.7238 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3527 | LogS |
| Caco-2 Permeability | 0.5403 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.3302 | LD50, mol/kg |
| Fish Toxicity | 0.5423 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.2102 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0080 |
| Food Image | ![]() |
| Food Name | Milk |
| Food Chinese Name | 牛奶 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
| FADB-China ID | F0070 |
| Food Image | ![]() |
| Food Name | Pork, red meat and liver |
| Food Chinese Name | 猪肉、牛羊肉及肝脏 |
| Food Type | Non-processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Alpha-Zearalenol |
ToxinDB, T3DB, OpenFoodTox |
Link |
||
Beta-Zearalenol |
ToxinDB, T3DB, OpenFoodTox |
Link |
||
Cis-alpha-Zearalenol |
ToxinDB, T3DB, OpenFoodTox |
Link |
||
Alpha-Zearalenol |
ToxinDB, T3DB, OpenFoodTox |
Link |
||
Beta-Zearalenol |
ToxinDB, T3DB, OpenFoodTox |
Link |

