Acepromazine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0352 | 
| Substance Name | Sedative | 
| Substance Chinese Name | 镇静剂 | 
| Molecular Name | Acepromazine | 
| Molecular Chinese Name | 乙酰丙嗪 | 
| 2D Structure | |
| CAS Number | None | 
| PubChem CID | 6077 | 
| Formula | C19H22N2OS | 
| IUPAC Name | 1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanone | 
| InChI Key | NOSIYYJFMPDDSA-UHFFFAOYSA-N | 
| InChI | InChI=1S/C19H22N2OS/c1-14(22)15-9-10-19-17(13-15)21(12-6-11-20(2)3)16-7-4-5-8-18(16)23-19/h4-5,7-10,13H,6,11-12H2,1-3H3 | 
| Canonical SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C  | 
| Isomeric SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Planting/breeding, Transportation | 
| Addition Purposes | Calm, hypnosis, reduce energy consumption | 
| Molecular Synonyms | 
        
            ACEPROMAZINE
        
            Acetylpromazine
        
            Acetopromazine
        
            Plegicil
        
            Vetranquil
        
            Acetazine
        
            Azepromazine
        
            Atsetozin
        
            Notensil
        
            Acepromazina
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:17 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 326.5 | 
| Hydrogen Bond Donor Count | 0 | 
| Hydrogen Bond Acceptor Count | 4 | 
| Rotatable Bond Count | 5 | 
| Complexity | 414 | 
| Monoisotopic Mass | 326.14528451 | 
| Exact Mass | 326.14528451 | 
| XLogP | 4.2 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 23 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9844 | 
| Human Intestinal Absorption | HIA+ | 0.9852 | 
| Caco-2 Permeability | Caco2+ | 0.8203 | 
| P-glycoprotein Substrate | Substrate | 0.8092 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.8563 | 
| Inhibitor | 0.8570 | |
| Renal Organic Cation Transporter | Inhibitor | 0.7087 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4659 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7438 | 
| CYP450 2D6 Substrate | Substrate | 0.8618 | 
| CYP450 3A4 Substrate | Substrate | 0.6468 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.9106 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9319 | 
| CYP450 2D6 Inhibitor | Inhibitor | 0.9115 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9105 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7333 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9537 | 
| Inhibitor | 0.7813 | |
| AMES Toxicity | Non AMES toxic | 0.8490 | 
| Carcinogens | Non-carcinogens | 0.9292 | 
| Fish Toxicity | High FHMT | 0.6477 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6541 | 
| Honey Bee Toxicity | Low HBT | 0.7401 | 
| Biodegradation | Not ready biodegradable | 0.9829 | 
| Acute Oral Toxicity | III | 0.7696 | 
| Carcinogenicity (Three-class) | Non-required | 0.7124 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -4.1744 | LogS | 
| Caco-2 Permeability | 1.6575 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.7963 | LD50, mol/kg | 
| Fish Toxicity | 1.5114 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.7452 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0077 | 
| Food Image | ![]()  | 
        
| Food Name | Pork | 
| Food Chinese Name | 猪肉 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Propionylpromazine  | 
            
            
            
            
            FRCD  | 
            Link  | 
        
