Acepromazine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0352 |
| Substance Name | Sedative |
| Substance Chinese Name | 镇静剂 |
| Molecular Name | Acepromazine |
| Molecular Chinese Name | 乙酰丙嗪 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 6077 |
| Formula | C19H22N2OS |
| IUPAC Name | 1-[10-[3-(dimethylamino)propyl]phenothiazin-2-yl]ethanone |
| InChI Key | NOSIYYJFMPDDSA-UHFFFAOYSA-N |
| InChI | InChI=1S/C19H22N2OS/c1-14(22)15-9-10-19-17(13-15)21(12-6-11-20(2)3)16-7-4-5-8-18(16)23-19/h4-5,7-10,13H,6,11-12H2,1-3H3 |
| Canonical SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C |
| Isomeric SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C |
| CFM-ID 3.0 | URL Link |
| Related links | Planting/breeding, Transportation |
| Addition Purposes | Calm, hypnosis, reduce energy consumption |
| Molecular Synonyms |
ACEPROMAZINE
Acetylpromazine
Acetopromazine
Plegicil
Vetranquil
Acetazine
Azepromazine
Atsetozin
Notensil
Acepromazina
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 12, 2019 10:17 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 326.5 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Complexity | 414 |
| Monoisotopic Mass | 326.14528451 |
| Exact Mass | 326.14528451 |
| XLogP | 4.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9844 |
| Human Intestinal Absorption | HIA+ | 0.9852 |
| Caco-2 Permeability | Caco2+ | 0.8203 |
| P-glycoprotein Substrate | Substrate | 0.8092 |
| P-glycoprotein Inhibitor | Inhibitor | 0.8563 |
| Inhibitor | 0.8570 | |
| Renal Organic Cation Transporter | Inhibitor | 0.7087 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4659 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7438 |
| CYP450 2D6 Substrate | Substrate | 0.8618 |
| CYP450 3A4 Substrate | Substrate | 0.6468 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9106 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9319 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.9115 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9105 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7333 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9537 |
| Inhibitor | 0.7813 | |
| AMES Toxicity | Non AMES toxic | 0.8490 |
| Carcinogens | Non-carcinogens | 0.9292 |
| Fish Toxicity | High FHMT | 0.6477 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6541 |
| Honey Bee Toxicity | Low HBT | 0.7401 |
| Biodegradation | Not ready biodegradable | 0.9829 |
| Acute Oral Toxicity | III | 0.7696 |
| Carcinogenicity (Three-class) | Non-required | 0.7124 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.1744 | LogS |
| Caco-2 Permeability | 1.6575 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7963 | LD50, mol/kg |
| Fish Toxicity | 1.5114 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7452 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0077 |
| Food Image | ![]() |
| Food Name | Pork |
| Food Chinese Name | 猪肉 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (fourth batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Propionylpromazine |
FRCD |
Link |
