Azaperol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0357 | 
| Substance Name | Sedative | 
| Substance Chinese Name | 镇静剂 | 
| Molecular Name | Azaperol | 
| Molecular Chinese Name | 阿扎哌醇 | 
| 2D Structure | |
| CAS Number | 2804-05-9 | 
| PubChem CID | 3080589 | 
| Formula | C19H24FN3O | 
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-ol | 
| InChI Key | LVXYAFNPMXCRJI-UHFFFAOYSA-N | 
| InChI | InChI=1S/C19H24FN3O/c20-17-8-6-16(7-9-17)18(24)4-3-11-22-12-14-23(15-13-22)19-5-1-2-10-21-19/h1-2,5-10,18,24H,3-4,11-15H2 | 
| Canonical SMILES | C1CN(CCN1CCCC(C2=CC=C(C=C2)F)O)C3=CC=CC=N3  | 
| Isomeric SMILES | C1CN(CCN1CCCC(C2=CC=C(C=C2)F)O)C3=CC=CC=N3  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Planting/breeding, Transportation | 
| Addition Purposes | Calm, hypnosis, reduce energy consumption | 
| Molecular Synonyms | 
        
            Azaperol
        
            2804-05-9
        
            AC1MIVB0
        
            SCHEMBL13532634
        
            LVXYAFNPMXCRJI-UHFFFAOYSA-N
        
            Azaperol 100 microg/mL in Methanol
        
            Azaperol, VETRANAL(TM), analytical standard
        
            Alpha-(4-Fluorophenyl)-4-(2-pyridinyl)-1-piperazinebutanol
        
            1-Piperazinebutanol, alpha-(4-fluorophenyl)-4-(2-pyridinyl)-
        
            1-(4-fluorophenyl)-4-(4-pyridin-2-ylpiperazin-1-yl)butan-1-ol
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Aug 12, 2019 10:19 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 329.4 | 
| Hydrogen Bond Donor Count | 1 | 
| Hydrogen Bond Acceptor Count | 5 | 
| Rotatable Bond Count | 6 | 
| Complexity | 355 | 
| Monoisotopic Mass | 329.19034057 | 
| Exact Mass | 329.19034057 | 
| XLogP | 3.2 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 24 | 
| Defined Atom Stereocenter Count | 0 | 
| Undefined Atom Stereocenter Count | 1 | 
| Defined Bond Stereocenter Count | 0 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9244 | 
| Human Intestinal Absorption | HIA+ | 0.9717 | 
| Caco-2 Permeability | Caco2- | 0.5370 | 
| P-glycoprotein Substrate | Substrate | 0.6960 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.5449 | 
| Inhibitor | 0.5135 | |
| Renal Organic Cation Transporter | Inhibitor | 0.5780 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7166 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8617 | 
| CYP450 2D6 Substrate | Non-substrate | 0.5058 | 
| CYP450 3A4 Substrate | Non-substrate | 0.6134 | 
| CYP450 1A2 Inhibitor | Inhibitor | 0.8255 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7216 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7089 | 
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9406 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8344 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5294 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.5177 | 
| Inhibitor | 0.8410 | |
| AMES Toxicity | Non AMES toxic | 0.8508 | 
| Carcinogens | Non-carcinogens | 0.9020 | 
| Fish Toxicity | Low FHMT | 0.5980 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9560 | 
| Honey Bee Toxicity | Low HBT | 0.8949 | 
| Biodegradation | Not ready biodegradable | 1.0000 | 
| Acute Oral Toxicity | II | 0.5325 | 
| Carcinogenicity (Three-class) | Non-required | 0.5825 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.3719 | LogS | 
| Caco-2 Permeability | 1.0053 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.9000 | LD50, mol/kg | 
| Fish Toxicity | 1.6461 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.6015 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0077 | 
| Food Image | ![]()  | 
        
| Food Name | Pork | 
| Food Chinese Name | 猪肉 | 
| Food Type | Processed food | 
| References | List of non-edible substances that may be illegally added in food (fourth batch) | 
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link | 
|---|---|---|---|---|
Azaperone  | 
            
            
            
            
            CAC Veterinary Drug, ToxCast & Tox21 Chemicals  | 
            Link  | 
        
