-
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0380 | 
| Substance Name | Marigold | 
| Substance Chinese Name | 金盏花 | 
| Molecular Name | - | 
| Molecular Chinese Name | - | 
| 2D Structure | |
| CAS Number | 127-40-2 | 
| PubChem CID | 5281243 | 
| Formula | C40H56O2 | 
| IUPAC Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol | 
| InChI Key | KBPHJBAIARWVSC-RGZFRNHPSA-N | 
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1 | 
| Canonical SMILES | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CC(CC2(C)C)O)C)C)C  | 
| Isomeric SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)/C)/C  | 
| CFM-ID 3.0 | URL Link | 
| Related links | Processing | 
| Addition Purposes | Reduce cost | 
| Molecular Synonyms | 
        
            Lutein
        
            XANTHOPHYLL
        
            127-40-2
        
            Bo-Xan
        
            Vegetable lutein
        
            UNII-X72A60C9MT
        
            Lutein ester
        
            Trans-Lutein
        
            Luteine
        
            (3R,3'R,6'R)-Lutein
         | 
| Data Uploader | Shuyu Ouyang | 
| Update Date | Jul 25, 2019 20:46 | 
Properties
| Property Name | Property Value | 
|---|---|
| Molecular Weight | 568.9 | 
| Hydrogen Bond Donor Count | 2 | 
| Hydrogen Bond Acceptor Count | 2 | 
| Rotatable Bond Count | 10 | 
| Complexity | 1270 | 
| Monoisotopic Mass | 568.42803104 | 
| Exact Mass | 568.42803104 | 
| XLogP | 11 | 
| Formal Charge | 0 | 
| Heavy Atom Count | 42 | 
| Defined Atom Stereocenter Count | 3 | 
| Undefined Atom Stereocenter Count | 0 | 
| Defined Bond Stereocenter Count | 9 | 
| Undefined Bond Stereocenter Count | 0 | 
| Isotope Atom Count | 0 | 
| Covalently-Bonded Unit Count | 1 | 
ADMET
| Model | Result | Probability | 
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.6588 | 
| Human Intestinal Absorption | HIA+ | 0.9972 | 
| Caco-2 Permeability | Caco2+ | 0.7904 | 
| P-glycoprotein Substrate | Substrate | 0.5199 | 
| P-glycoprotein Inhibitor | Inhibitor | 0.5819 | 
| Non-inhibitor | 0.8202 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8760 | 
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6198 | 
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8299 | 
| CYP450 2D6 Substrate | Non-substrate | 0.8408 | 
| CYP450 3A4 Substrate | Substrate | 0.6607 | 
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9079 | 
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7723 | 
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9368 | 
| CYP450 2C19 Inhibitor | Inhibitor | 0.5225 | 
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8808 | 
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6267 | 
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9273 | 
| Non-inhibitor | 0.8259 | |
| AMES Toxicity | Non AMES toxic | 0.8391 | 
| Carcinogens | Non-carcinogens | 0.7489 | 
| Fish Toxicity | High FHMT | 0.7396 | 
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9471 | 
| Honey Bee Toxicity | High HBT | 0.8389 | 
| Biodegradation | Not ready biodegradable | 0.9655 | 
| Acute Oral Toxicity | III | 0.7696 | 
| Carcinogenicity (Three-class) | Non-required | 0.5753 | 
ADMET -- Regression
| Model | Value | Unit | 
|---|---|---|
| Aqueous solubility | -3.2123 | LogS | 
| Caco-2 Permeability | 1.5930 | LogPapp, cm/s | 
| Rat Acute Toxicity | 2.5006 | LD50, mol/kg | 
| Fish Toxicity | 1.5740 | pLC50, mg/L | 
| Tetrahymena Pyriformis Toxicity | 0.8805 | pIGC50, ug/L | 
Related Foods
| FADB-China ID | F0135 | 
| Food Image | ![]()  | 
        
| Food Name | Saffron | 
| Food Chinese Name | 藏红花 | 
| Food Type | Non-processed food | 
| References | A novel onsite and visual molecular technique to authenticate saffron (Crocus sativus) and its adulterants based on recombinase polymerase amplification | 
