-
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0380 |
| Substance Name | Marigold |
| Substance Chinese Name | 金盏花 |
| Molecular Name | - |
| Molecular Chinese Name | - |
| 2D Structure | |
| CAS Number | 127-40-2 |
| PubChem CID | 5281243 |
| Formula | C40H56O2 |
| IUPAC Name | (1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol |
| InChI Key | KBPHJBAIARWVSC-RGZFRNHPSA-N |
| InChI | InChI=1S/C40H56O2/c1-29(17-13-19-31(3)21-23-37-33(5)25-35(41)27-39(37,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-38-34(6)26-36(42)28-40(38,9)10/h11-25,35-37,41-42H,26-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t35-,36+,37-/m0/s1 |
| Canonical SMILES | CC1=C(C(CC(C1)O)(C)C)C=CC(=CC=CC(=CC=CC=C(C)C=CC=C(C)C=CC2C(=CC(CC2(C)C)O)C)C)C |
| Isomeric SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)/C)/C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost |
| Molecular Synonyms |
Lutein
XANTHOPHYLL
127-40-2
Bo-Xan
Vegetable lutein
UNII-X72A60C9MT
Lutein ester
Trans-Lutein
Luteine
(3R,3'R,6'R)-Lutein
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 568.9 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 10 |
| Complexity | 1270 |
| Monoisotopic Mass | 568.42803104 |
| Exact Mass | 568.42803104 |
| XLogP | 11 |
| Formal Charge | 0 |
| Heavy Atom Count | 42 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 9 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.6588 |
| Human Intestinal Absorption | HIA+ | 0.9972 |
| Caco-2 Permeability | Caco2+ | 0.7904 |
| P-glycoprotein Substrate | Substrate | 0.5199 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5819 |
| Non-inhibitor | 0.8202 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8760 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6198 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8299 |
| CYP450 2D6 Substrate | Non-substrate | 0.8408 |
| CYP450 3A4 Substrate | Substrate | 0.6607 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9079 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7723 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9368 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.5225 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8808 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6267 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9273 |
| Non-inhibitor | 0.8259 | |
| AMES Toxicity | Non AMES toxic | 0.8391 |
| Carcinogens | Non-carcinogens | 0.7489 |
| Fish Toxicity | High FHMT | 0.7396 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9471 |
| Honey Bee Toxicity | High HBT | 0.8389 |
| Biodegradation | Not ready biodegradable | 0.9655 |
| Acute Oral Toxicity | III | 0.7696 |
| Carcinogenicity (Three-class) | Non-required | 0.5753 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.2123 | LogS |
| Caco-2 Permeability | 1.5930 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5006 | LD50, mol/kg |
| Fish Toxicity | 1.5740 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.8805 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0135 |
| Food Image | ![]() |
| Food Name | Saffron |
| Food Chinese Name | 藏红花 |
| Food Type | Non-processed food |
| References | A novel onsite and visual molecular technique to authenticate saffron (Crocus sativus) and its adulterants based on recombinase polymerase amplification |
