Codeine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0039 |
| Substance Name | Pericarpium Papaveris |
| Substance Chinese Name | 罂粟壳 |
| Molecular Name | Codeine |
| Molecular Chinese Name | 可待因 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 5284371 |
| Formula | C18H21NO3 |
| IUPAC Name | (4R,4aR,7S,7aR,12bS)-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-ol |
| InChI Key | OROGSEYTTFOCAN-DNJOTXNNSA-N |
| InChI | InChI=1S/C18H21NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3-6,11-13,17,20H,7-9H2,1-2H3/t11-,12+,13-,17-,18-/m0/s1 |
| Canonical SMILES | CN1CCC23C4C1CC5=C2C(=C(C=C5)OC)OC3C(C=C4)O |
| Isomeric SMILES | CN1CC[C@]23[C@@H]4[C@H]1CC5=C2C(=C(C=C5)OC)O[C@H]3[C@H](C=C4)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Improve taste |
| Molecular Synonyms |
Codeine
Methylmorphine
Codeine anhydrous
Codicept
L-Codeine
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 06, 2019 10:57 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 299.4 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Complexity | 509 |
| Monoisotopic Mass | 299.15214354 |
| Exact Mass | 299.15214354 |
| XLogP | 1.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 22 |
| Defined Atom Stereocenter Count | 5 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9979 |
| Human Intestinal Absorption | HIA+ | 0.9966 |
| Caco-2 Permeability | Caco2+ | 0.8867 |
| P-glycoprotein Substrate | Substrate | 0.8631 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5435 |
| Non-inhibitor | 0.8724 | |
| Renal Organic Cation Transporter | Inhibitor | 0.6380 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4895 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7698 |
| CYP450 2D6 Substrate | Substrate | 0.9274 |
| CYP450 3A4 Substrate | Substrate | 0.7796 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6494 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8866 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.6978 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8256 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8899 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7470 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8556 |
| Non-inhibitor | 0.8615 | |
| AMES Toxicity | Non AMES toxic | 0.9133 |
| Carcinogens | Non-carcinogens | 0.9567 |
| Fish Toxicity | High FHMT | 0.8941 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8916 |
| Honey Bee Toxicity | Low HBT | 0.5107 |
| Biodegradation | Not ready biodegradable | 0.9935 |
| Acute Oral Toxicity | II | 0.7450 |
| Carcinogenicity (Three-class) | Non-required | 0.7141 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.0336 | LogS |
| Caco-2 Permeability | 1.5243 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.8450 | LD50, mol/kg |
| Fish Toxicity | 0.7325 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.8107 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0037 |
| Food Image | ![]() |
| Food Name | Hot pot |
| Food Chinese Name | 火锅 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (first batch) |
| FADB-China ID | F0038 |
| Food Image | ![]() |
| Food Name | Hotpot condiment |
| Food Chinese Name | 火锅底料 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (first batch) |
| FADB-China ID | F0039 |
| Food Image | ![]() |
| Food Name | Snack |
| Food Chinese Name | 小吃 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (first batch) |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Morphine |
DrugBank, , T3DB, OpenFoodTox |
Link |


