Glibenclamide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0395 |
| Substance Name | Glibenclamide |
| Substance Chinese Name | 格列本脲 |
| Molecular Name | Glibenclamide |
| Molecular Chinese Name | 格列本脲 |
| 2D Structure | |
| CAS Number | 10238-21-8 |
| PubChem CID | 3488 |
| Formula | C23H28ClN3O5S |
| IUPAC Name | 5-chloro-N-[2-[4-(cyclohexylcarbamoylsulfamoyl)phenyl]ethyl]-2-methoxybenzamide |
| InChI Key | ZNNLBTZKUZBEKO-UHFFFAOYSA-N |
| InChI | InChI=1S/C23H28ClN3O5S/c1-32-21-12-9-17(24)15-20(21)22(28)25-14-13-16-7-10-19(11-8-16)33(30,31)27-23(29)26-18-5-3-2-4-6-18/h7-12,15,18H,2-6,13-14H2,1H3,(H,25,28)(H2,26,27,29) |
| Canonical SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 |
| Isomeric SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost, Enhance health care function |
| Molecular Synonyms |
Glibenclamide
Glyburide
Glybenclamide
Micronase
Diabeta
Glynase
Daonil
Maninil
10238-21-8
Euglucon
|
| Data Uploader | Dachuan Zhang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 494 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 8 |
| Complexity | 746 |
| Monoisotopic Mass | 493.1438199 |
| Exact Mass | 493.1438199 |
| XLogP | 4.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 33 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.6707 |
| Human Intestinal Absorption | HIA+ | 0.9701 |
| Caco-2 Permeability | Caco2- | 0.6479 |
| P-glycoprotein Substrate | Non-substrate | 0.5109 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7119 |
| Non-inhibitor | 0.8185 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7982 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6691 |
| Metabolism | ||
| CYP450 2C9 Substrate | Substrate | 0.6488 |
| CYP450 2D6 Substrate | Non-substrate | 0.9116 |
| CYP450 3A4 Substrate | Substrate | 0.5329 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.8948 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8932 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9026 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.7959 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.8627 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7551 |
| Non-inhibitor | 0.8024 | |
| AMES Toxicity | Non AMES toxic | 0.6996 |
| Carcinogens | Non-carcinogens | 0.7539 |
| Fish Toxicity | High FHMT | 0.9969 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9714 |
| Honey Bee Toxicity | Low HBT | 0.7399 |
| Biodegradation | Not ready biodegradable | 0.8245 |
| Acute Oral Toxicity | IV | 0.6192 |
| Carcinogenicity (Three-class) | Non-required | 0.6405 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -5.0275 | LogS |
| Caco-2 Permeability | 0.2878 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.4243 | LD50, mol/kg |
| Fish Toxicity | 1.4112 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5482 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0108 |
| Food Image | ![]() |
| Food Name | Chinese herbal medicine |
| Food Chinese Name | 中药材 |
| Food Type | Processed food |
| References | Analysis of synthetic anti-diabetic drugs in adulterated traditional Chinese medicines by high-performance capillary electrophoresis |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| Determination of synthetic drugs used to adulterate botanical dietary supplements using QTRAP LC-MS/MS. | 19680934 |
| [A new method for safety monitoring of natural dietary supplements--quality profile]. | 19035183 |
| Analysis of synthetic anti-diabetic drugs in adulterated traditional Chinese medicines by high-performance capillary electrophoresis |
