Tolbutamide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0397 |
| Substance Name | Tolbutamide |
| Substance Chinese Name | 甲苯磺丁脲 |
| Molecular Name | Tolbutamide |
| Molecular Chinese Name | 甲苯磺丁脲 |
| 2D Structure | |
| CAS Number | 64-77-7 |
| PubChem CID | 5505 |
| Formula | C12H18N2O3S |
| IUPAC Name | 1-butyl-3-(4-methylphenyl)sulfonylurea |
| InChI Key | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
| InChI | InChI=1S/C12H18N2O3S/c1-3-4-9-13-12(15)14-18(16,17)11-7-5-10(2)6-8-11/h5-8H,3-4,9H2,1-2H3,(H2,13,14,15) |
| Canonical SMILES | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)C |
| Isomeric SMILES | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost, Enhance health care function |
| Molecular Synonyms |
Tolbutamide
64-77-7
Orinase
Artosin
Tolbutamid
Aglicid
Arkozal
Diabetol
Dolipol
1-Butyl-3-tosylurea
|
| Data Uploader | Dachuan Zhang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 270.35 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Complexity | 354 |
| Monoisotopic Mass | 270.10381362 |
| Exact Mass | 270.10381362 |
| XLogP | 2.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 18 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9321 |
| Human Intestinal Absorption | HIA+ | 0.9959 |
| Caco-2 Permeability | Caco2- | 0.6453 |
| P-glycoprotein Substrate | Non-substrate | 0.5333 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9349 |
| Non-inhibitor | 0.9131 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8852 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5241 |
| Metabolism | ||
| CYP450 2C9 Substrate | Substrate | 0.5304 |
| CYP450 2D6 Substrate | Non-substrate | 0.9116 |
| CYP450 3A4 Substrate | Non-substrate | 0.7558 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9443 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9504 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9613 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8810 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9561 |
| Non-inhibitor | 0.9511 | |
| AMES Toxicity | Non AMES toxic | 0.9133 |
| Carcinogens | Non-carcinogens | 0.7810 |
| Fish Toxicity | High FHMT | 0.9122 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9268 |
| Honey Bee Toxicity | Low HBT | 0.6580 |
| Biodegradation | Not ready biodegradable | 0.8811 |
| Acute Oral Toxicity | III | 0.7713 |
| Carcinogenicity (Three-class) | Non-required | 0.7012 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3275 | LogS |
| Caco-2 Permeability | 0.5012 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.0629 | LD50, mol/kg |
| Fish Toxicity | 1.7760 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2844 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0108 |
| Food Image | ![]() |
| Food Name | Chinese herbal medicine |
| Food Chinese Name | 中药材 |
| Food Type | Processed food |
| References | Analysis of synthetic anti-diabetic drugs in adulterated traditional Chinese medicines by high-performance capillary electrophoresis |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Carbutamide |
ToxCast & Tox21 Chemicals |
Link |
