Papaverine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0041 |
| Substance Name | Pericarpium Papaveris |
| Substance Chinese Name | 罂粟壳 |
| Molecular Name | Papaverine |
| Molecular Chinese Name | 罂粟碱 |
| 2D Structure | |
| CAS Number | 58-74-2 |
| PubChem CID | 4680 |
| Formula | C20H21NO4 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
| InChI Key | XQYZDYMELSJDRZ-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H21NO4/c1-22-17-6-5-13(10-18(17)23-2)9-16-15-12-20(25-4)19(24-3)11-14(15)7-8-21-16/h5-8,10-12H,9H2,1-4H3 |
| Canonical SMILES | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| Isomeric SMILES | COC1=C(C=C(C=C1)CC2=NC=CC3=CC(=C(C=C32)OC)OC)OC |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Improve taste |
| Molecular Synonyms |
Papaverine
Papaverin
Papanerine
Robaxapap
Papanerin
Pavabid
Papaverina
Cerespan
58-74-2
1-(3,4-Dimethoxybenzyl)-6,7-dimethoxyisoquinoline
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Aug 06, 2019 10:58 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 339.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Complexity | 407 |
| Monoisotopic Mass | 339.14705816 |
| Exact Mass | 339.14705816 |
| XLogP | 3.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 25 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9633 |
| Human Intestinal Absorption | HIA+ | 0.9911 |
| Caco-2 Permeability | Caco2+ | 0.8866 |
| P-glycoprotein Substrate | Non-substrate | 0.5389 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6485 |
| Non-inhibitor | 0.8005 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7229 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4515 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7960 |
| CYP450 2D6 Substrate | Substrate | 0.8918 |
| CYP450 3A4 Substrate | Substrate | 0.6263 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9107 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8448 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.7780 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.7959 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.8558 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9329 |
| Non-inhibitor | 0.7274 | |
| AMES Toxicity | Non AMES toxic | 0.6890 |
| Carcinogens | Non-carcinogens | 0.9503 |
| Fish Toxicity | Low FHMT | 0.5516 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7004 |
| Honey Bee Toxicity | High HBT | 0.6778 |
| Biodegradation | Not ready biodegradable | 0.9262 |
| Acute Oral Toxicity | II | 0.7448 |
| Carcinogenicity (Three-class) | Non-required | 0.6207 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3257 | LogS |
| Caco-2 Permeability | 1.4224 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.9877 | LD50, mol/kg |
| Fish Toxicity | 1.0140 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4343 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0037 |
| Food Image | ![]() |
| Food Name | Hot pot |
| Food Chinese Name | 火锅 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (first batch) |
| FADB-China ID | F0038 |
| Food Image | ![]() |
| Food Name | Hotpot condiment |
| Food Chinese Name | 火锅底料 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (first batch) |
| FADB-China ID | F0039 |
| Food Image | ![]() |
| Food Name | Snack |
| Food Chinese Name | 小吃 |
| Food Type | Processed food |
| References | List of non-edible substances that may be illegally added in food (first batch) |


