Abscisic acid
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0440 |
| Substance Name | Abscisic acid |
| Substance Chinese Name | 脱落酸 |
| Molecular Name | Abscisic acid |
| Molecular Chinese Name | 脱落酸 |
| 2D Structure | |
| CAS Number | 14375-45-2 |
| PubChem CID | 5375199 |
| Formula | C15H20O4 |
| IUPAC Name | (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| InChI Key | JLIDBLDQVAYHNE-LXGGSRJLSA-N |
| InChI | InChI=1S/C15H20O4/c1-10(7-13(17)18)5-6-15(19)11(2)8-12(16)9-14(15,3)4/h5-8,19H,9H2,1-4H3,(H,17,18)/b6-5+,10-7- |
| Canonical SMILES | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
| Isomeric SMILES | CC1=CC(=O)CC(C1(/C=C/C(=C\C(=O)O)/C)O)(C)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost |
| Molecular Synonyms |
ABSCISIC ACID
14375-45-2
(+/-)-Abscisic acid
Abscisinsaeure
Acido abscisico
Acide abscissique
(+)-Abscisic acid
2-cis-abscisic acid
(RS)-Abscisic acid
Abszisinsaeure
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 264.32 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Complexity | 494 |
| Monoisotopic Mass | 264.13615912 |
| Exact Mass | 264.13615912 |
| XLogP | 1.6 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 2 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5562 |
| Human Intestinal Absorption | HIA+ | 0.9647 |
| Caco-2 Permeability | Caco2+ | 0.6017 |
| P-glycoprotein Substrate | Substrate | 0.5000 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6400 |
| Non-inhibitor | 0.9497 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9306 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8663 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8679 |
| CYP450 2D6 Substrate | Non-substrate | 0.8987 |
| CYP450 3A4 Substrate | Substrate | 0.6298 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9535 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9441 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9377 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9097 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9557 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9832 |
| Non-inhibitor | 0.9593 | |
| AMES Toxicity | Non AMES toxic | 0.8598 |
| Carcinogens | Non-carcinogens | 0.8479 |
| Fish Toxicity | High FHMT | 0.6957 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.5092 |
| Honey Bee Toxicity | High HBT | 0.8285 |
| Biodegradation | Not ready biodegradable | 0.6133 |
| Acute Oral Toxicity | III | 0.6395 |
| Carcinogenicity (Three-class) | Non-required | 0.5812 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -1.9461 | LogS |
| Caco-2 Permeability | 0.9547 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5680 | LD50, mol/kg |
| Fish Toxicity | 1.7258 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1677 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0109 |
| Food Image | ![]() |
| Food Name | Fruit juice |
| Food Chinese Name | 果汁 |
| Food Type | Processed food |
| References | Structural identification of compounds for use in the detection of juice-to-juice debasing between apple and pear juices |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Vomifoliol |
FRCD |
Link |
||
Ac1L98Yq |
FRCD |
Link |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| Structural identification of compounds for use in the detection of juice-to-juice debasing between apple and pear juices. | 28958538 |
| Structural identification of compounds for use in the detection of juice-to-juice debasing between apple and pear juices |
