4-O-p-coumarylquinic acid
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0442 |
| Substance Name | 4-O-p-coumarylquinic acid |
| Substance Chinese Name | 4- o -对香豆酰奎宁酸 |
| Molecular Name | 4-O-p-coumarylquinic acid |
| Molecular Chinese Name | 4- o -对香豆酰奎宁酸 |
| 2D Structure | |
| CAS Number | 93451-44-6 |
| PubChem CID | 5281766 |
| Formula | C16H18O8 |
| IUPAC Name | (3R,5R)-1,3,5-trihydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| InChI Key | XWRHBGVVCOSNKO-OPGYGNEESA-N |
| InChI | InChI=1S/C16H18O8/c17-10-4-1-9(2-5-10)3-6-13(20)24-14-11(18)7-16(23,15(21)22)8-12(14)19/h1-6,11-12,14,17-19,23H,7-8H2,(H,21,22)/b6-3+/t11-,12-,14?,16?/m1/s1 |
| Canonical SMILES | C1C(C(C(CC1(C(=O)O)O)O)OC(=O)C=CC2=CC=C(C=C2)O)O |
| Isomeric SMILES | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)OC(=O)/C=C/C2=CC=C(C=C2)O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost |
| Molecular Synonyms |
4-p-Coumaroylquinic acid
UNII-K4772MBI5O
K4772MBI5O
93451-44-6
4-p-Cqa
AC1NQZ1B
4-o-Coumaroylquinic acid
C10441
CHEBI:1945
4-Coumaroylquinic acid
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 338.31 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 5 |
| Complexity | 482 |
| Monoisotopic Mass | 338.10016754 |
| Exact Mass | 338.10016754 |
| XLogP | -0.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5777 |
| Human Intestinal Absorption | HIA+ | 0.7876 |
| Caco-2 Permeability | Caco2- | 0.7865 |
| P-glycoprotein Substrate | Substrate | 0.6184 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8608 |
| Non-inhibitor | 0.9252 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9143 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7282 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8032 |
| CYP450 2D6 Substrate | Non-substrate | 0.9010 |
| CYP450 3A4 Substrate | Non-substrate | 0.5347 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9417 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9285 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9505 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9200 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8904 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9725 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9812 |
| Non-inhibitor | 0.8723 | |
| AMES Toxicity | Non AMES toxic | 0.9305 |
| Carcinogens | Non-carcinogens | 0.9266 |
| Fish Toxicity | High FHMT | 0.9970 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9947 |
| Honey Bee Toxicity | High HBT | 0.7221 |
| Biodegradation | Not ready biodegradable | 0.8661 |
| Acute Oral Toxicity | III | 0.7858 |
| Carcinogenicity (Three-class) | Non-required | 0.5943 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.4761 | LogS |
| Caco-2 Permeability | -0.6387 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5758 | LD50, mol/kg |
| Fish Toxicity | 0.6887 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 1.1142 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0109 |
| Food Image | ![]() |
| Food Name | Fruit juice |
| Food Chinese Name | 果汁 |
| Food Type | Processed food |
| References | Structural identification of compounds for use in the detection of juice-to-juice debasing between apple and pear juices |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Neochlorogenic acid |
FRCD |
Link |
||
NSC-407296 |
FRCD |
Link |
||
1,4-Dicaffeylquinic acid |
FRCD |
Link |
||
CHLOROGENIC ACID |
FRCD |
Link |
||
Chlorogenic acid |
FRCD |
Link |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| Structural identification of compounds for use in the detection of juice-to-juice debasing between apple and pear juices. | 28958538 |
| Structural identification of compounds for use in the detection of juice-to-juice debasing between apple and pear juices |
