Protopine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0443 |
| Substance Name | Honey |
| Substance Chinese Name | 蜂蜜 |
| Molecular Name | Protopine |
| Molecular Chinese Name | 原嘌呤 |
| 2D Structure | |
| CAS Number | 130-86-9 |
| PubChem CID | 4970 |
| Formula | C20H19NO5 |
| IUPAC Name | 15-methyl-7,9,19,21-tetraoxa-15-azapentacyclo[15.7.0.04,12.06,10.018,22]tetracosa-1(17),4,6(10),11,18(22),23-hexaen-3-one |
| InChI Key | GPTFURBXHJWNHR-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H19NO5/c1-21-5-4-13-7-18-19(25-10-24-18)8-14(13)16(22)6-12-2-3-17-20(15(12)9-21)26-11-23-17/h2-3,7-8H,4-6,9-11H2,1H3 |
| Canonical SMILES | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| Isomeric SMILES | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | None |
| Molecular Synonyms |
Protopine
130-86-9
Corydinine
Biflorine
Macleyine
Hypercorine
Protopin
UNII-UIW569HT35
HSDB 3527
Fumarine
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 353.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Complexity | 542 |
| Monoisotopic Mass | 353.12632272 |
| Exact Mass | 353.12632272 |
| XLogP | 2.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 26 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9810 |
| Human Intestinal Absorption | HIA+ | 0.9937 |
| Caco-2 Permeability | Caco2+ | 0.7897 |
| P-glycoprotein Substrate | Substrate | 0.7069 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.6999 |
| Non-inhibitor | 0.9594 | |
| Renal Organic Cation Transporter | Inhibitor | 0.6428 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.5341 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8378 |
| CYP450 2D6 Substrate | Substrate | 0.5212 |
| CYP450 3A4 Substrate | Substrate | 0.6502 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9107 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9081 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8931 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.8993 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.7379 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8129 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.6267 |
| Non-inhibitor | 0.8853 | |
| AMES Toxicity | AMES toxic | 0.7050 |
| Carcinogens | Non-carcinogens | 0.9428 |
| Fish Toxicity | High FHMT | 0.9735 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9329 |
| Honey Bee Toxicity | Low HBT | 0.6332 |
| Biodegradation | Ready biodegradable | 0.5468 |
| Acute Oral Toxicity | III | 0.7503 |
| Carcinogenicity (Three-class) | Non-required | 0.5416 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8880 | LogS |
| Caco-2 Permeability | 1.4339 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3873 | LD50, mol/kg |
| Fish Toxicity | 1.0291 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4287 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0090 |
| Food Image | ![]() |
| Food Name | Honey |
| Food Chinese Name | 蜂蜜 |
| Food Type | Processed food |
| References | Use of isoquinoline alkaloids as markers for identification of honey and pollen from Macleaya cordata (Willd.) R. Br |
