Allocryptopine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0444 |
| Substance Name | Honey |
| Substance Chinese Name | 蜂蜜 |
| Molecular Name | Allocryptopine |
| Molecular Chinese Name | 异丙基嘌呤 |
| 2D Structure | |
| CAS Number | 24240-04-8 |
| PubChem CID | 98570 |
| Formula | C21H23NO5 |
| IUPAC Name | 7,8-dimethoxy-11-methyl-17,19-dioxa-11-azatetracyclo[12.7.0.04,9.016,20]henicosa-1(21),4(9),5,7,14,16(20)-hexaen-2-one |
| InChI Key | HYBRYAPKQCZIAE-UHFFFAOYSA-N |
| InChI | InChI=1S/C21H23NO5/c1-22-7-6-14-9-19-20(27-12-26-19)10-15(14)17(23)8-13-4-5-18(24-2)21(25-3)16(13)11-22/h4-5,9-10H,6-8,11-12H2,1-3H3 |
| Canonical SMILES | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C(=C(C=C4)OC)OC)OCO3 |
| Isomeric SMILES | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C(=C(C=C4)OC)OC)OCO3 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | None |
| Molecular Synonyms |
Allocryptopine
24240-04-8
Allocrytopine
Alpha-Allocryptopine
485-91-6
Alpha-Fagarine
Fagarine I
UNII-EK27J8ROYB
Thalictrimine
Beta-Homochelidonine
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 369.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Complexity | 529 |
| Monoisotopic Mass | 369.15762284 |
| Exact Mass | 369.15762284 |
| XLogP | 2.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 27 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9762 |
| Human Intestinal Absorption | HIA+ | 0.9842 |
| Caco-2 Permeability | Caco2+ | 0.7691 |
| P-glycoprotein Substrate | Substrate | 0.7203 |
| P-glycoprotein Inhibitor | Inhibitor | 0.7940 |
| Non-inhibitor | 0.5587 | |
| Renal Organic Cation Transporter | Inhibitor | 0.5861 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.5210 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8690 |
| CYP450 2D6 Substrate | Substrate | 0.5167 |
| CYP450 3A4 Substrate | Substrate | 0.7717 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8788 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9308 |
| CYP450 2D6 Inhibitor | Inhibitor | 0.8798 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.8272 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.6522 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7281 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.6301 |
| Non-inhibitor | 0.6994 | |
| AMES Toxicity | AMES toxic | 0.5910 |
| Carcinogens | Non-carcinogens | 0.8920 |
| Fish Toxicity | High FHMT | 0.9795 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9484 |
| Honey Bee Toxicity | Low HBT | 0.5519 |
| Biodegradation | Not ready biodegradable | 0.6385 |
| Acute Oral Toxicity | III | 0.6425 |
| Carcinogenicity (Three-class) | Non-required | 0.5425 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.2925 | LogS |
| Caco-2 Permeability | 1.4209 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.8131 | LD50, mol/kg |
| Fish Toxicity | 0.8509 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6102 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0090 |
| Food Image | ![]() |
| Food Name | Honey |
| Food Chinese Name | 蜂蜜 |
| Food Type | Processed food |
| References | Use of isoquinoline alkaloids as markers for identification of honey and pollen from Macleaya cordata (Willd.) R. Br |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Protopine |
ToxinDB, T3DB |
Link |
