Nortadalafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0450 |
| Substance Name | Nortadalafil |
| Substance Chinese Name | 诺他达拉非 |
| Molecular Name | Nortadalafil |
| Molecular Chinese Name | 诺他达拉非 |
| 2D Structure | |
| CAS Number | 171596-36-4 |
| PubChem CID | 9820973 |
| Formula | C21H17N3O4 |
| IUPAC Name | (2R,8R)-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| InChI Key | XHDLVMPUSXRZOS-FOIQADDNSA-N |
| InChI | InChI=1S/C21H17N3O4/c25-18-9-22-21(26)15-8-13-12-3-1-2-4-14(12)23-19(13)20(24(15)18)11-5-6-16-17(7-11)28-10-27-16/h1-7,15,20,23H,8-10H2,(H,22,26)/t15-,20-/m1/s1 |
| Canonical SMILES | C1C2C(=O)NCC(=O)N2C(C3=C1C4=CC=CC=C4N3)C5=CC6=C(C=C5)OCO6 |
| Isomeric SMILES | C1[C@@H]2C(=O)NCC(=O)N2[C@@H](C3=C1C4=CC=CC=C4N3)C5=CC6=C(C=C5)OCO6 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost |
| Molecular Synonyms |
Nortadalafil
171596-36-4
Demethyltadalafil
N-Desmethyl Tadalafil
UNII-5W59DMB3LD
5W59DMB3LD
CHEMBL342008
Desmethyltadalafil (Nortadalafil)
(+)-Nortadalafil
(2R,8R)-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.0^{3,8}.0^{11,16}]heptadeca-1(10),11,13,15-tetraene-4,7-dione
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 375.4 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Complexity | 672 |
| Monoisotopic Mass | 375.12190604 |
| Exact Mass | 375.12190604 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 28 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.7544 |
| Human Intestinal Absorption | HIA+ | 0.9784 |
| Caco-2 Permeability | Caco2- | 0.6825 |
| P-glycoprotein Substrate | Substrate | 0.5219 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8722 |
| Non-inhibitor | 0.9482 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7496 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4458 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.9102 |
| CYP450 2D6 Substrate | Non-substrate | 0.8174 |
| CYP450 3A4 Substrate | Substrate | 0.5421 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6889 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6088 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7462 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.5841 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6521 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7775 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9918 |
| Non-inhibitor | 0.7726 | |
| AMES Toxicity | Non AMES toxic | 0.5628 |
| Carcinogens | Non-carcinogens | 0.8889 |
| Fish Toxicity | High FHMT | 0.5690 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6366 |
| Honey Bee Toxicity | Low HBT | 0.8007 |
| Biodegradation | Not ready biodegradable | 0.9772 |
| Acute Oral Toxicity | III | 0.5508 |
| Carcinogenicity (Three-class) | Non-required | 0.6380 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8160 | LogS |
| Caco-2 Permeability | 0.5172 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4448 | LD50, mol/kg |
| Fish Toxicity | 1.5004 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1875 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0071 |
| Food Image | ![]() |
| Food Name | Liquor |
| Food Chinese Name | 酒类 |
| Food Type | Processed food |
| References | Phosphodiesterase-5 inhibitors in Chinese tonic liquors by liquid chromatography coupled with quadrupole time of flight mass spectrometry |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Tadalafil |
DrugBank, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
Link |
