Desmethylsidenafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0451 |
| Substance Name | Desmethylsidenafil |
| Substance Chinese Name | 去甲基西地那非 |
| Molecular Name | Desmethylsidenafil |
| Molecular Chinese Name | 去甲基西地那非 |
| 2D Structure | |
| CAS Number | 139755-82-1 |
| PubChem CID | 135455980 |
| Formula | C21H28N6O4S |
| IUPAC Name | 5-(2-ethoxy-5-piperazin-1-ylsulfonylphenyl)-1-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| InChI Key | UZTKBZXHEOVDRL-UHFFFAOYSA-N |
| InChI | InChI=1S/C21H28N6O4S/c1-4-6-16-18-19(26(3)25-16)21(28)24-20(23-18)15-13-14(7-8-17(15)31-5-2)32(29,30)27-11-9-22-10-12-27/h7-8,13,22H,4-6,9-12H2,1-3H3,(H,23,24,28) |
| Canonical SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCNCC4)OCC)C |
| Isomeric SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCNCC4)OCC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Reduce cost |
| Molecular Synonyms |
Desmethylsildenafil
N-Desmethyl Sildenafil
139755-82-1
UNII-L6WO34R9YG
CHEMBL910
L6WO34R9YG
Desmethyl sildenafil
N-Demethylsildenafil
N-Desmethylsildenafil
5-(2-ethoxy-5-(piperazin-1-ylsulfonyl)phenyl)-1-methyl-3-propyl-1H-pyrazolo[4,3-d]pyrimidin-7(6H)-one
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 460.6 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 7 |
| Complexity | 810 |
| Monoisotopic Mass | 460.18927458 |
| Exact Mass | 460.18927458 |
| XLogP | 1 |
| Formal Charge | 0 |
| Heavy Atom Count | 32 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.5787 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.6018 |
| P-glycoprotein Substrate | Substrate | 0.7827 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6122 |
| Inhibitor | 0.8780 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7661 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4707 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.5916 |
| CYP450 2D6 Substrate | Substrate | 0.5572 |
| CYP450 3A4 Substrate | Substrate | 0.6857 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8148 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5810 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8763 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7583 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.8707 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7742 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8582 |
| Inhibitor | 0.7257 | |
| AMES Toxicity | Non AMES toxic | 0.5742 |
| Carcinogens | Non-carcinogens | 0.5918 |
| Fish Toxicity | High FHMT | 0.9922 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8793 |
| Honey Bee Toxicity | Low HBT | 0.6785 |
| Biodegradation | Not ready biodegradable | 0.8140 |
| Acute Oral Toxicity | III | 0.5230 |
| Carcinogenicity (Three-class) | Non-required | 0.6055 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.7987 | LogS |
| Caco-2 Permeability | 0.8840 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6562 | LD50, mol/kg |
| Fish Toxicity | 1.4747 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5118 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0071 |
| Food Image | ![]() |
| Food Name | Liquor |
| Food Chinese Name | 酒类 |
| Food Type | Processed food |
| References | Phosphodiesterase-5 inhibitors in Chinese tonic liquors by liquid chromatography coupled with quadrupole time of flight mass spectrometry |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Sildenafil |
FRCD |
Link |
