Topiramate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0478 |
| Substance Name | Anorexics |
| Substance Chinese Name | 抑制食欲药物 |
| Molecular Name | Topiramate |
| Molecular Chinese Name | 托吡酯 |
| 2D Structure | |
| CAS Number | 97240-79-4 |
| PubChem CID | 5284627 |
| Formula | C12H21NO8S |
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]methyl sulfamate |
| InChI Key | KJADKKWYZYXHBB-XBWDGYHZSA-N |
| InChI | InChI=1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7-,8-,9+,12+/m1/s1 |
| Canonical SMILES | CC1(OC2COC3(C(C2O1)OC(O3)(C)C)COS(=O)(=O)N)C |
| Isomeric SMILES | CC1(O[C@@H]2CO[C@@]3([C@H]([C@@H]2O1)OC(O3)(C)C)COS(=O)(=O)N)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Topiramate
97240-79-4
Topamax
Epitomax
Tipiramate
Topiramatum
McN-4853
Tipiramato
Topiramato
Topamax Sprinkle
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 339.36 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 3 |
| Complexity | 556 |
| Monoisotopic Mass | 339.09878781 |
| Exact Mass | 339.09878781 |
| XLogP | -0.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 22 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9382 |
| Human Intestinal Absorption | HIA+ | 0.9955 |
| Caco-2 Permeability | Caco2- | 0.6055 |
| P-glycoprotein Substrate | Non-substrate | 0.7905 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.5311 |
| Non-inhibitor | 0.9479 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9131 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4793 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.9479 |
| CYP450 2D6 Substrate | Non-substrate | 0.9116 |
| CYP450 3A4 Substrate | Non-substrate | 0.5420 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6623 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7259 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8674 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6539 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8469 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7952 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8882 |
| Non-inhibitor | 0.8734 | |
| AMES Toxicity | AMES toxic | 0.5180 |
| Carcinogens | Non-carcinogens | 0.5578 |
| Fish Toxicity | High FHMT | 0.5224 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.6879 |
| Honey Bee Toxicity | High HBT | 0.6969 |
| Biodegradation | Not ready biodegradable | 0.9803 |
| Acute Oral Toxicity | III | 0.5739 |
| Carcinogenicity (Three-class) | Non-required | 0.5640 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.0468 | LogS |
| Caco-2 Permeability | 0.3861 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5682 | LD50, mol/kg |
| Fish Toxicity | 1.6948 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.1547 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
