Orlistat
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0484 |
| Substance Name | Antiobesity drug |
| Substance Chinese Name | 减肥药 |
| Molecular Name | Orlistat |
| Molecular Chinese Name | 奥利司他 |
| 2D Structure | |
| CAS Number | 96829-58-2 |
| PubChem CID | 3034010 |
| Formula | C29H53NO5 |
| IUPAC Name | [(2S)-1-[(2S,3S)-3-hexyl-4-oxooxetan-2-yl]tridecan-2-yl] (2S)-2-formamido-4-methylpentanoate |
| InChI Key | AHLBNYSZXLDEJQ-FWEHEUNISA-N |
| InChI | InChI=1S/C29H53NO5/c1-5-7-9-11-12-13-14-15-16-18-24(34-29(33)26(30-22-31)20-23(3)4)21-27-25(28(32)35-27)19-17-10-8-6-2/h22-27H,5-21H2,1-4H3,(H,30,31)/t24-,25-,26-,27-/m0/s1 |
| Canonical SMILES | CCCCCCCCCCCC(CC1C(C(=O)O1)CCCCCC)OC(=O)C(CC(C)C)NC=O |
| Isomeric SMILES | CCCCCCCCCCC[C@@H](C[C@H]1[C@@H](C(=O)O1)CCCCCC)OC(=O)[C@H](CC(C)C)NC=O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Orlistat
96829-58-2
Tetrahydrolipstatin
Xenical
Alli
Orlipastat
Orlipastatum
Orlipastatum [INN-Latin]
THLP
(-)-Tetrahydrolipstatin
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 495.7 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 23 |
| Complexity | 579 |
| Monoisotopic Mass | 495.39237381 |
| Exact Mass | 495.39237381 |
| XLogP | 10 |
| Formal Charge | 0 |
| Heavy Atom Count | 35 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5923 |
| Human Intestinal Absorption | HIA+ | 0.9728 |
| Caco-2 Permeability | Caco2- | 0.5611 |
| P-glycoprotein Substrate | Substrate | 0.5411 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6242 |
| Inhibitor | 0.5301 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.9097 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5522 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8540 |
| CYP450 2D6 Substrate | Non-substrate | 0.8260 |
| CYP450 3A4 Substrate | Substrate | 0.5867 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8458 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8305 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8869 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7315 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8308 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9070 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9671 |
| Non-inhibitor | 0.9395 | |
| AMES Toxicity | Non AMES toxic | 0.7333 |
| Carcinogens | Non-carcinogens | 0.8628 |
| Fish Toxicity | High FHMT | 0.7375 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9931 |
| Honey Bee Toxicity | High HBT | 0.5259 |
| Biodegradation | Not ready biodegradable | 0.7808 |
| Acute Oral Toxicity | III | 0.6614 |
| Carcinogenicity (Three-class) | Non-required | 0.6317 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.1463 | LogS |
| Caco-2 Permeability | 0.4620 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3363 | LD50, mol/kg |
| Fish Toxicity | 1.0874 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4626 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
