Phenolphthalein
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0532 |
| Substance Name | Laxative |
| Substance Chinese Name | 泻药 |
| Molecular Name | Phenolphthalein |
| Molecular Chinese Name | 酚酞 |
| 2D Structure | |
| CAS Number | 77-09-8 |
| PubChem CID | 4764 |
| Formula | C20H14O4 |
| IUPAC Name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
| InChI Key | KJFMBFZCATUALV-UHFFFAOYSA-N |
| InChI | InChI=1S/C20H14O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-12,21-22H |
| Canonical SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
| Isomeric SMILES | C1=CC=C2C(=C1)C(=O)OC2(C3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
77-09-8
Phthalimetten
Euchessina
Phthalin
Espotabs
Phenolax
Purgophen
Koprol
Phenolphthalein
Laxogen
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 318.3 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Complexity | 438 |
| Monoisotopic Mass | 318.08920893 |
| Exact Mass | 318.08920893 |
| XLogP | 3.6 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8100 |
| Human Intestinal Absorption | HIA+ | 0.9934 |
| Caco-2 Permeability | Caco2- | 0.6464 |
| P-glycoprotein Substrate | Non-substrate | 0.5296 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9622 |
| Non-inhibitor | 0.7602 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8906 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7970 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7388 |
| CYP450 2D6 Substrate | Non-substrate | 0.8969 |
| CYP450 3A4 Substrate | Non-substrate | 0.6225 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7780 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6684 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8938 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7654 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.5773 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5636 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9899 |
| Non-inhibitor | 0.8760 | |
| AMES Toxicity | Non AMES toxic | 0.9267 |
| Carcinogens | Non-carcinogens | 0.9093 |
| Fish Toxicity | High FHMT | 0.9713 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9330 |
| Honey Bee Toxicity | High HBT | 0.7538 |
| Biodegradation | Not ready biodegradable | 0.9381 |
| Acute Oral Toxicity | III | 0.7094 |
| Carcinogenicity (Three-class) | Warning | 0.5218 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.9627 | LogS |
| Caco-2 Permeability | 0.5744 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3649 | LD50, mol/kg |
| Fish Toxicity | 0.2395 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.9232 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Iodophthalein |
ToxCast & Tox21 Chemicals |
Link |
||
Tetrabromophenolphthalein |
FRCD |
Link |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| [A new method for safety monitoring of natural dietary supplements--quality profile]. | 19035183 |
| Spectroscopic and Spectrometric Methods Used for the Screening of Certain Herbal Food Supplements Suspected of Adulteration. | 28761827 |
| Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
