Sennosides
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0533 |
| Substance Name | Laxative |
| Substance Chinese Name | 泻药 |
| Molecular Name | Sennosides |
| Molecular Chinese Name | 番泻苷 |
| 2D Structure | |
| CAS Number | 517-43-1 |
| PubChem CID | 656822 |
| Formula | C42H38O20 |
| IUPAC Name | 9-[2-carboxy-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracen-9-yl]-4-hydroxy-10-oxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-9H-anthracene-2-carboxylic acid |
| InChI Key | IPQVTOJGNYVQEO-JLDSCGAUSA-N |
| InChI | InChI=1S/C42H38O20/c43-11-23-31(47)35(51)37(53)41(61-23)59-21-5-1-3-15-25(17-7-13(39(55)56)9-19(45)27(17)33(49)29(15)21)26-16-4-2-6-22(60-42-38(54)36(52)32(48)24(12-44)62-42)30(16)34(50)28-18(26)8-14(40(57)58)10-20(28)46/h1-10,23-26,31-32,35-38,41-48,51-54H,11-12H2,(H,55,56)(H,57,58)/t23-,24-,25?,26?,31-,32-,35+,36+,37-,38-,41-,42-/m1/s1 |
| Canonical SMILES | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)OC7C(C(C(C(O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O |
| Isomeric SMILES | C1=CC2=C(C(=C1)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C(=O)C4=C(C2C5C6=C(C(=CC=C6)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)C(=O)C8=C5C=C(C=C8O)C(=O)O)C=C(C=C4O)C(=O)O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Sennoside
Sennoside G
Sennosides
Pursennid (TN)
Sennosides (USP)
Senna-lax
517-43-1
66575-30-2
AC1LCVKW
Sennoside (JAN)
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 862.7 |
| Hydrogen Bond Donor Count | 12 |
| Hydrogen Bond Acceptor Count | 20 |
| Rotatable Bond Count | 9 |
| Complexity | 1550 |
| Monoisotopic Mass | 862.19564362 |
| Exact Mass | 862.19564362 |
| XLogP | 1.2 |
| Formal Charge | 0 |
| Heavy Atom Count | 62 |
| Defined Atom Stereocenter Count | 10 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.7438 |
| Human Intestinal Absorption | HIA+ | 0.5493 |
| Caco-2 Permeability | Caco2- | 0.9338 |
| P-glycoprotein Substrate | Substrate | 0.6428 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8679 |
| Non-inhibitor | 0.7395 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8846 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5329 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8246 |
| CYP450 2D6 Substrate | Non-substrate | 0.8828 |
| CYP450 3A4 Substrate | Non-substrate | 0.6277 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9320 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9171 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9596 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9032 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.9365 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8607 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9692 |
| Non-inhibitor | 0.6484 | |
| AMES Toxicity | AMES toxic | 0.6996 |
| Carcinogens | Non-carcinogens | 0.9494 |
| Fish Toxicity | High FHMT | 0.9386 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9309 |
| Honey Bee Toxicity | High HBT | 0.5781 |
| Biodegradation | Not ready biodegradable | 0.7461 |
| Acute Oral Toxicity | IV | 0.5235 |
| Carcinogenicity (Three-class) | Non-required | 0.6966 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.3863 | LogS |
| Caco-2 Permeability | -1.1017 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.1271 | LD50, mol/kg |
| Fish Toxicity | 1.0753 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.3230 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
