Spironolactone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0540 |
| Substance Name | Diuretics |
| Substance Chinese Name | 利尿剂 |
| Molecular Name | Spironolactone |
| Molecular Chinese Name | 安体舒通 |
| 2D Structure | |
| CAS Number | 52-01-7 |
| PubChem CID | 5833 |
| Formula | C24H32O4S |
| IUPAC Name | S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| InChI Key | LXMSZDCAJNLERA-ZHYRCANASA-N |
| InChI | InChI=1S/C24H32O4S/c1-14(25)29-19-13-15-12-16(26)4-8-22(15,2)17-5-9-23(3)18(21(17)19)6-10-24(23)11-7-20(27)28-24/h12,17-19,21H,4-11,13H2,1-3H3/t17-,18-,19+,21+,22-,23-,24+/m0/s1 |
| Canonical SMILES | CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C |
| Isomeric SMILES | CC(=O)S[C@@H]1CC2=CC(=O)CC[C@@]2([C@@H]3[C@@H]1[C@@H]4CC[C@]5([C@]4(CC3)C)CCC(=O)O5)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Spironolactone
52-01-7
Spirolactone
Verospiron
Euteberol
Spiroctan
Spirolang
Verospirone
Acelat
Aldactone
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 416.6 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Complexity | 818 |
| Monoisotopic Mass | 416.20213068 |
| Exact Mass | 416.20213068 |
| XLogP | 2.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 7 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9320 |
| Human Intestinal Absorption | HIA+ | 0.9912 |
| Caco-2 Permeability | Caco2+ | 0.5432 |
| P-glycoprotein Substrate | Substrate | 0.5691 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6807 |
| Inhibitor | 0.8388 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7270 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6212 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7897 |
| CYP450 2D6 Substrate | Non-substrate | 0.9116 |
| CYP450 3A4 Substrate | Substrate | 0.6638 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9045 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9276 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8681 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9427 |
| Non-inhibitor | 0.7002 | |
| AMES Toxicity | Non AMES toxic | 0.9158 |
| Carcinogens | Non-carcinogens | 0.9288 |
| Fish Toxicity | High FHMT | 0.9976 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9591 |
| Honey Bee Toxicity | High HBT | 0.8801 |
| Biodegradation | Not ready biodegradable | 0.9696 |
| Acute Oral Toxicity | III | 0.6953 |
| Carcinogenicity (Three-class) | Non-required | 0.5847 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.2170 | LogS |
| Caco-2 Permeability | 1.1336 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.0150 | LD50, mol/kg |
| Fish Toxicity | 0.1851 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.8492 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
3-oxopregn-4-ene-21,17a-carbolactone |
FRCD |
Link |
