Clopamide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0542 |
| Substance Name | Diuretics |
| Substance Chinese Name | 利尿剂 |
| Molecular Name | Clopamide |
| Molecular Chinese Name | 氯帕胺 |
| 2D Structure | |
| CAS Number | 636-54-4 |
| PubChem CID | 12492 |
| Formula | C14H20ClN3O3S |
| IUPAC Name | 4-chloro-N-[(2R,6S)-2,6-dimethylpiperidin-1-yl]-3-sulfamoylbenzamide |
| InChI Key | LBXHRAWDUMTPSE-AOOOYVTPSA-N |
| InChI | InChI=1S/C14H20ClN3O3S/c1-9-4-3-5-10(2)18(9)17-14(19)11-6-7-12(15)13(8-11)22(16,20)21/h6-10H,3-5H2,1-2H3,(H,17,19)(H2,16,20,21)/t9-,10+ |
| Canonical SMILES | CC1CCCC(N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C |
| Isomeric SMILES | C[C@@H]1CCC[C@@H](N1NC(=O)C2=CC(=C(C=C2)Cl)S(=O)(=O)N)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Clopamide
Brinaldix
Aquex
Clopamidum
Adurix
Chlosudimeprimyl
Clopamida [INN-Spanish]
UNII-17S83WON0I
636-54-4
Clopamidum [INN-Latin]
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 345.8 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Complexity | 498 |
| Monoisotopic Mass | 345.0913904 |
| Exact Mass | 345.0913904 |
| XLogP | 2.3 |
| Formal Charge | 0 |
| Heavy Atom Count | 22 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8845 |
| Human Intestinal Absorption | HIA+ | 0.9850 |
| Caco-2 Permeability | Caco2- | 0.6070 |
| P-glycoprotein Substrate | Non-substrate | 0.6091 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8306 |
| Non-inhibitor | 0.9305 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8290 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5528 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.5910 |
| CYP450 2D6 Substrate | Non-substrate | 0.8062 |
| CYP450 3A4 Substrate | Substrate | 0.5066 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9046 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9071 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9232 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8309 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.6906 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9802 |
| Non-inhibitor | 0.8099 | |
| AMES Toxicity | Non AMES toxic | 0.6874 |
| Carcinogens | Non-carcinogens | 0.8479 |
| Fish Toxicity | High FHMT | 0.9688 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9040 |
| Honey Bee Toxicity | Low HBT | 0.8638 |
| Biodegradation | Not ready biodegradable | 0.8656 |
| Acute Oral Toxicity | III | 0.6018 |
| Carcinogenicity (Three-class) | Non-required | 0.5712 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.5848 | LogS |
| Caco-2 Permeability | 0.8643 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.2282 | LD50, mol/kg |
| Fish Toxicity | 1.5673 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.4279 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| Development of a liquid chromatography tandem mass spectrometry method for simultaneous determination of eight adulterants in slimming functional foods. | 21899853 |
| Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
