Methyclothiazide
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0548 |
| Substance Name | Diuretics |
| Substance Chinese Name | 利尿剂 |
| Molecular Name | Methyclothiazide |
| Molecular Chinese Name | 甲氯噻嗪 |
| 2D Structure | |
| CAS Number | 135-07-9 |
| PubChem CID | 4121 |
| Formula | C9H11Cl2N3O4S2 |
| IUPAC Name | 6-chloro-3-(chloromethyl)-2-methyl-1,1-dioxo-3,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChI Key | CESYKOGBSMNBPD-UHFFFAOYSA-N |
| InChI | InChI=1S/C9H11Cl2N3O4S2/c1-14-9(4-10)13-6-2-5(11)7(19(12,15)16)3-8(6)20(14,17)18/h2-3,9,13H,4H2,1H3,(H2,12,15,16) |
| Canonical SMILES | CN1C(NC2=CC(=C(C=C2S1(=O)=O)S(=O)(=O)N)Cl)CCl |
| Isomeric SMILES | CN1C(NC2=CC(=C(C=C2S1(=O)=O)S(=O)(=O)N)Cl)CCl |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Methyclothiazide
Enduron
Aquatensen
Methyclothiazid
Duretic
Methycyclothiazide
Enduronum
Naturon
135-07-9
Methychlothiazide
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 360.2 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 2 |
| Complexity | 571 |
| Monoisotopic Mass | 358.9568036 |
| Exact Mass | 358.9568036 |
| XLogP | 1.4 |
| Formal Charge | 0 |
| Heavy Atom Count | 20 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.6866 |
| Human Intestinal Absorption | HIA+ | 0.9834 |
| Caco-2 Permeability | Caco2- | 0.6992 |
| P-glycoprotein Substrate | Substrate | 0.5317 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.8518 |
| Non-inhibitor | 0.8888 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8177 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.6115 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6310 |
| CYP450 2D6 Substrate | Non-substrate | 0.8261 |
| CYP450 3A4 Substrate | Non-substrate | 0.5320 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6883 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6493 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8580 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8080 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.5094 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.7345 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9384 |
| Non-inhibitor | 0.9318 | |
| AMES Toxicity | Non AMES toxic | 0.8905 |
| Carcinogens | Non-carcinogens | 0.8200 |
| Fish Toxicity | High FHMT | 0.8422 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8689 |
| Honey Bee Toxicity | Low HBT | 0.8038 |
| Biodegradation | Not ready biodegradable | 0.9971 |
| Acute Oral Toxicity | III | 0.8037 |
| Carcinogenicity (Three-class) | Non-required | 0.6289 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.4651 | LogS |
| Caco-2 Permeability | 0.1758 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.9853 | LD50, mol/kg |
| Fish Toxicity | 1.6368 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5362 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Hydrochlorothiazide |
DrugBank, IARC Carcinogens Group 2B, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
Link |
