Paroxetine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0551 |
| Substance Name | Antidepressant |
| Substance Chinese Name | 抗抑郁剂 |
| Molecular Name | Paroxetine |
| Molecular Chinese Name | 帕罗西汀 |
| 2D Structure | |
| CAS Number | 61869-08-7 |
| PubChem CID | 43815 |
| Formula | C19H20FNO3 |
| IUPAC Name | (3S,4R)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)piperidine |
| InChI Key | AHOUBRCZNHFOSL-YOEHRIQHSA-N |
| InChI | InChI=1S/C19H20FNO3/c20-15-3-1-13(2-4-15)17-7-8-21-10-14(17)11-22-16-5-6-18-19(9-16)24-12-23-18/h1-6,9,14,17,21H,7-8,10-12H2/t14-,17-/m0/s1 |
| Canonical SMILES | C1CNCC(C1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4 |
| Isomeric SMILES | C1CNC[C@H]([C@@H]1C2=CC=C(C=C2)F)COC3=CC4=C(C=C3)OCO4 |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Paroxetine
61869-08-7
Paxil
Seroxat
Paxetil
Frosinor
Paroxetina
Paroxetinum
Casbol
Paxil CR
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 329.4 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Complexity | 402 |
| Monoisotopic Mass | 329.14272167 |
| Exact Mass | 329.14272167 |
| XLogP | 3.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 24 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9869 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5195 |
| P-glycoprotein Substrate | Substrate | 0.6555 |
| P-glycoprotein Inhibitor | Inhibitor | 0.8564 |
| Inhibitor | 0.6771 | |
| Renal Organic Cation Transporter | Inhibitor | 0.5222 |
| Distribution | ||
| Subcellular localization | Lysosome | 0.4829 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.9265 |
| CYP450 2D6 Substrate | Substrate | 0.8918 |
| CYP450 3A4 Substrate | Non-substrate | 0.6004 |
| CYP450 1A2 Inhibitor | Inhibitor | 0.9107 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.8948 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9231 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.9025 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.8298 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.8649 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Strong inhibitor | 0.5554 |
| Non-inhibitor | 0.5879 | |
| AMES Toxicity | Non AMES toxic | 0.6722 |
| Carcinogens | Non-carcinogens | 0.9046 |
| Fish Toxicity | High FHMT | 0.9889 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9803 |
| Honey Bee Toxicity | Low HBT | 0.5988 |
| Biodegradation | Not ready biodegradable | 0.9950 |
| Acute Oral Toxicity | III | 0.5586 |
| Carcinogenicity (Three-class) | Non-required | 0.6188 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.3848 | LogS |
| Caco-2 Permeability | 1.1413 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.8239 | LD50, mol/kg |
| Fish Toxicity | 1.2485 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6249 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
(3S-trans)-5-[[4-(4-Fluorophenyl-3-piperidinyl]methoxy]-2-methoxyphenol (Paroxetin Metabolit) |
FRCD |
Link |
