Zilpaterol
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0559 |
| Substance Name | Anabolic agents |
| Substance Chinese Name | 合成代谢剂 |
| Molecular Name | Zilpaterol |
| Molecular Chinese Name | 齐帕特罗 |
| 2D Structure | |
| CAS Number | 117827-79-9 |
| PubChem CID | 3086576 |
| Formula | C14H19N3O2 |
| IUPAC Name | (9R,10R)-9-hydroxy-10-(propan-2-ylamino)-1,3-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-trien-2-one |
| InChI Key | ZSTCZWJCLIRCOJ-DGCLKSJQSA-N |
| InChI | InChI=1S/C14H19N3O2/c1-8(2)15-11-6-7-17-12-9(13(11)18)4-3-5-10(12)16-14(17)19/h3-5,8,11,13,15,18H,6-7H2,1-2H3,(H,16,19)/t11-,13-/m1/s1 |
| Canonical SMILES | CC(C)NC1CCN2C3=C(C1O)C=CC=C3NC2=O |
| Isomeric SMILES | CC(C)N[C@@H]1CCN2C3=C([C@H]1O)C=CC=C3NC2=O |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Zilpaterol
117827-79-9
119520-05-7
Zilpaterol [INN]
(-)-Zilpaterol
Imidazo(4,5,1-jk)(1)benzazepin-2(1H)-one, 4,5,6,7-tetrahydro-7-hydroxy-6-((1-methylethyl)amino)-, (6R,7R)-rel-
Imidazo[4,5,1-jk][1]benzazepin-2(1H)-one, 4,5,6,7-tetrahydro-7-hydroxy-6-[(1-methylethyl)amino]-, (6R,7R)-rel-
RU 42173
AC1MJ6FN
SCHEMBL97546
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 261.32 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Complexity | 361 |
| Monoisotopic Mass | 261.14772687 |
| Exact Mass | 261.14772687 |
| XLogP | 0.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 19 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.7371 |
| Human Intestinal Absorption | HIA+ | 0.9908 |
| Caco-2 Permeability | Caco2- | 0.5875 |
| P-glycoprotein Substrate | Substrate | 0.6592 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.9174 |
| Non-inhibitor | 0.7915 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8000 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6689 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7017 |
| CYP450 2D6 Substrate | Non-substrate | 0.7504 |
| CYP450 3A4 Substrate | Substrate | 0.6544 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.6299 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.8178 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7896 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.7991 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8402 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5803 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9172 |
| Inhibitor | 0.5261 | |
| AMES Toxicity | Non AMES toxic | 0.6641 |
| Carcinogens | Non-carcinogens | 0.9226 |
| Fish Toxicity | High FHMT | 0.7940 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8909 |
| Honey Bee Toxicity | Low HBT | 0.7557 |
| Biodegradation | Not ready biodegradable | 0.9847 |
| Acute Oral Toxicity | III | 0.6253 |
| Carcinogenicity (Three-class) | Non-required | 0.6705 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.7406 | LogS |
| Caco-2 Permeability | 0.9627 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.4509 | LD50, mol/kg |
| Fish Toxicity | 1.6480 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2830 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
Zilpaterol Hydrochloride |
CAC Veterinary Drug, National Health Commission of the People's Republic of China |
Link |
