Methasterone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0561 |
| Substance Name | Steroids |
| Substance Chinese Name | 类固醇 |
| Molecular Name | Methasterone |
| Molecular Chinese Name | 甲基屈他雄酮 |
| 2D Structure | |
| CAS Number | 3381-88-2 |
| PubChem CID | 237186 |
| Formula | C21H34O2 |
| IUPAC Name | (2R,5S,8R,9S,10S,13S,14S,17S)-17-hydroxy-2,10,13,17-tetramethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChI Key | QCWCXSMWLJFBNM-FOVYBZIDSA-N |
| InChI | InChI=1S/C21H34O2/c1-13-12-19(2)14(11-18(13)22)5-6-15-16(19)7-9-20(3)17(15)8-10-21(20,4)23/h13-17,23H,5-12H2,1-4H3/t13-,14+,15-,16+,17+,19+,20+,21+/m1/s1 |
| Canonical SMILES | CC1CC2(C(CCC3C2CCC4(C3CCC4(C)O)C)CC1=O)C |
| Isomeric SMILES | C[C@@H]1C[C@]2([C@@H](CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C)CC1=O)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Methasterone
Superdrol
3381-88-2
Methasteron
UNII-GH88DY98MR
NSC 40490
GH88DY98MR
2alpha,17alpha-Dimethyldihydrotestosterone
17beta-Hydroxy-2alpha,17-dimethyl-5alpha-androstan-3-one
17A-METHYL-DROSTANOLONE
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 318.5 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Complexity | 528 |
| Monoisotopic Mass | 318.25588034 |
| Exact Mass | 318.25588034 |
| XLogP | 4.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 23 |
| Defined Atom Stereocenter Count | 8 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9840 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8629 |
| P-glycoprotein Substrate | Substrate | 0.5627 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5153 |
| Non-inhibitor | 0.6722 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8105 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.6646 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7608 |
| CYP450 2D6 Substrate | Non-substrate | 0.9117 |
| CYP450 3A4 Substrate | Substrate | 0.7529 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.5000 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.6907 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9731 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8725 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8587 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.9634 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9399 |
| Non-inhibitor | 0.5786 | |
| AMES Toxicity | Non AMES toxic | 0.9326 |
| Carcinogens | Non-carcinogens | 0.8955 |
| Fish Toxicity | High FHMT | 0.9491 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9778 |
| Honey Bee Toxicity | High HBT | 0.7898 |
| Biodegradation | Not ready biodegradable | 0.9827 |
| Acute Oral Toxicity | III | 0.7163 |
| Carcinogenicity (Three-class) | Non-required | 0.5653 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.2602 | LogS |
| Caco-2 Permeability | 1.8789 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.2244 | LD50, mol/kg |
| Fish Toxicity | 1.2815 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.7654 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
Potential Illegal Additives
| ID | Structure | Name | Source | PubChem Link |
|---|---|---|---|---|
5-beta-DIHYDROTESTOSTERONE |
DrugBank, ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
Link |
||
Drostanolone |
DrugBank, T3DB |
Link |
||
Dihydrotestosterone |
DrugBank, ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
Link |
||
Mestanolone |
ToxCast & Tox21 Chemicals |
Link |
||
Oxymetholone |
ToxCast & Tox21 Chemicals |
Link |
