Boldenone
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0568 |
| Substance Name | Anabolic steroids |
| Substance Chinese Name | 合成类固醇 |
| Molecular Name | Boldenone |
| Molecular Chinese Name | 去氢睾酮 |
| 2D Structure | |
| CAS Number | 846-48-0 |
| PubChem CID | 13308 |
| Formula | C19H26O2 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-hydroxy-10,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| InChI Key | RSIHSRDYCUFFLA-DYKIIFRCSA-N |
| InChI | InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,11,14-17,21H,3-6,8,10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| Canonical SMILES | CC12CCC3C(C1CCC2O)CCC4=CC(=O)C=CC34C |
| Isomeric SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2O)CCC4=CC(=O)C=C[C@]34C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Boldenone
Dehydrotestosterone
846-48-0
1,2-Dehydrotestosterone
1-Dehydrotestosterone
1,2-Didehydrotestosterone
17beta-Boldenone
Delta1-Testosterone
Boldenona
Boldenonum
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 286.4 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Complexity | 546 |
| Monoisotopic Mass | 286.19328008 |
| Exact Mass | 286.19328008 |
| XLogP | 3.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 21 |
| Defined Atom Stereocenter Count | 6 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9730 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.8984 |
| P-glycoprotein Substrate | Substrate | 0.6498 |
| P-glycoprotein Inhibitor | Inhibitor | 0.5489 |
| Non-inhibitor | 0.8923 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7324 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.7307 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8167 |
| CYP450 2D6 Substrate | Non-substrate | 0.9116 |
| CYP450 3A4 Substrate | Substrate | 0.7739 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9005 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.9500 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9452 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6668 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.8812 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.8683 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8938 |
| Non-inhibitor | 0.7163 | |
| AMES Toxicity | Non AMES toxic | 0.9382 |
| Carcinogens | Non-carcinogens | 0.9483 |
| Fish Toxicity | High FHMT | 0.9843 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9455 |
| Honey Bee Toxicity | High HBT | 0.8401 |
| Biodegradation | Not ready biodegradable | 0.9174 |
| Acute Oral Toxicity | III | 0.5718 |
| Carcinogenicity (Three-class) | Warning | 0.4896 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -4.0828 | LogS |
| Caco-2 Permeability | 1.9335 | LogPapp, cm/s |
| Rat Acute Toxicity | 1.6259 | LD50, mol/kg |
| Fish Toxicity | 0.5970 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.6246 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
