Udenafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0572 |
| Substance Name | PDE-5 inhibitors drugs |
| Substance Chinese Name | PDE-5抑制剂药物 |
| Molecular Name | Udenafil |
| Molecular Chinese Name | 乌地那非 |
| 2D Structure | |
| CAS Number | 268203-93-6 |
| PubChem CID | 135413547 |
| Formula | C25H36N6O4S |
| IUPAC Name | 3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-5-yl)-N-[2-(1-methylpyrrolidin-2-yl)ethyl]-4-propoxybenzenesulfonamide |
| InChI Key | IYFNEFQTYQPVOC-UHFFFAOYSA-N |
| InChI | InChI=1S/C25H36N6O4S/c1-5-8-20-22-23(31(4)29-20)25(32)28-24(27-22)19-16-18(10-11-21(19)35-15-6-2)36(33,34)26-13-12-17-9-7-14-30(17)3/h10-11,16-17,26H,5-9,12-15H2,1-4H3,(H,27,28,32) |
| Canonical SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)NCCC4CCCN4C)OCCC)C |
| Isomeric SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)NCCC4CCCN4C)OCCC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Udenafil
Zydena
268203-93-6
DA-8159
Udenafil-d7
DA 8159
Udenafil [USAN:INN]
AC1OCFJA
DA8159
3-(1-methyl-7-oxo-3-propyl-6,7-dihydro-1H-pyrazolo[4,3-d]pyrimidin-5-yl)-N-(2-(1-methylpyrrolidin-2-yl)ethyl)-4-propoxybenzenesulfonamide
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 516.7 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 11 |
| Complexity | 894 |
| Monoisotopic Mass | 516.25187484 |
| Exact Mass | 516.25187484 |
| XLogP | 3 |
| Formal Charge | 0 |
| Heavy Atom Count | 36 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.5209 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.8316 |
| P-glycoprotein Substrate | Substrate | 0.8032 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6147 |
| Inhibitor | 0.7848 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7679 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4330 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.6451 |
| CYP450 2D6 Substrate | Substrate | 0.5741 |
| CYP450 3A4 Substrate | Substrate | 0.7131 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8199 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6168 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8926 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8297 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.8998 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6559 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8225 |
| Inhibitor | 0.7828 | |
| AMES Toxicity | Non AMES toxic | 0.5717 |
| Carcinogens | Non-carcinogens | 0.5184 |
| Fish Toxicity | High FHMT | 0.9884 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9154 |
| Honey Bee Toxicity | Low HBT | 0.6907 |
| Biodegradation | Not ready biodegradable | 0.9072 |
| Acute Oral Toxicity | III | 0.5206 |
| Carcinogenicity (Three-class) | Non-required | 0.5970 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.8137 | LogS |
| Caco-2 Permeability | 0.5647 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6496 | LD50, mol/kg |
| Fish Toxicity | 1.4460 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5248 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
