Lodenafil carbonate
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0574 |
| Substance Name | PDE-5 inhibitors drugs |
| Substance Chinese Name | PDE-5抑制剂药物 |
| Molecular Name | Lodenafil carbonate |
| Molecular Chinese Name | Lodenafil碳酸盐 |
| 2D Structure | |
| CAS Number | 398507-55-6 |
| PubChem CID | 135431100 |
| Formula | C47H62N12O11S2 |
| IUPAC Name | Bis[2-[4-[4-ethoxy-3-(1-methyl-7-oxo-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-5-yl)phenyl]sulfonylpiperazin-1-yl]ethyl] carbonate |
| InChI Key | MVYUCRDXZXLFSB-UHFFFAOYSA-N |
| InChI | InChI=1S/C47H62N12O11S2/c1-7-11-35-39-41(54(5)52-35)45(60)50-43(48-39)33-29-31(13-15-37(33)67-9-3)71(63,64)58-21-17-56(18-22-58)25-27-69-47(62)70-28-26-57-19-23-59(24-20-57)72(65,66)32-14-16-38(68-10-4)34(30-32)44-49-40-36(12-8-2)53-55(6)42(40)46(61)51-44/h13-16,29-30H,7-12,17-28H2,1-6H3,(H,48,50,60)(H,49,51,61) |
| Canonical SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)CCOC(=O)OCCN5CCN(CC5)S(=O)(=O)C6=CC(=C(C=C6)OCC)C7=NC8=C(C(=O)N7)N(N=C8CCC)C)OCC)C |
| Isomeric SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)CCOC(=O)OCCN5CCN(CC5)S(=O)(=O)C6=CC(=C(C=C6)OCC)C7=NC8=C(C(=O)N7)N(N=C8CCC)C)OCC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Lodenafil carbonate
398507-55-6
UNII-29X84F932D
29X84F932D
Lodenafil carbonate [INN]
Helleva
CRIS-031
SCHEMBL5008159
SCHEMBL18074278
DTXSID70192906
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 1035.2 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 19 |
| Rotatable Bond Count | 22 |
| Complexity | 2020 |
| Monoisotopic Mass | 1034.41024322 |
| Exact Mass | 1034.41024322 |
| XLogP | 3 |
| Formal Charge | 0 |
| Heavy Atom Count | 72 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.6466 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5778 |
| P-glycoprotein Substrate | Substrate | 0.7164 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6536 |
| Inhibitor | 0.6624 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7223 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4671 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7321 |
| CYP450 2D6 Substrate | Substrate | 0.5080 |
| CYP450 3A4 Substrate | Substrate | 0.6813 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7704 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6609 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8971 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6922 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.7598 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6940 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8548 |
| Inhibitor | 0.7508 | |
| AMES Toxicity | Non AMES toxic | 0.5785 |
| Carcinogens | Non-carcinogens | 0.6323 |
| Fish Toxicity | High FHMT | 0.9742 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8727 |
| Honey Bee Toxicity | Low HBT | 0.7045 |
| Biodegradation | Not ready biodegradable | 0.8988 |
| Acute Oral Toxicity | III | 0.5191 |
| Carcinogenicity (Three-class) | Non-required | 0.5928 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.8849 | LogS |
| Caco-2 Permeability | 0.7292 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7167 | LD50, mol/kg |
| Fish Toxicity | 1.4355 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5249 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
