Aminotadalafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0579 |
| Substance Name | PDE-5 inhibitors or its analogs |
| Substance Chinese Name | PDE-5抑制剂或类似物 |
| Molecular Name | Aminotadalafil |
| Molecular Chinese Name | 氨基他达那非 |
| 2D Structure | |
| CAS Number | 385769-84-6 |
| PubChem CID | 10178467 |
| Formula | C21H18N4O4 |
| IUPAC Name | (2R,8R)-6-amino-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| InChI Key | VUKJGAVIWMPOOJ-FOIQADDNSA-N |
| InChI | InChI=1S/C21H18N4O4/c22-24-9-18(26)25-15(21(24)27)8-13-12-3-1-2-4-14(12)23-19(13)20(25)11-5-6-16-17(7-11)29-10-28-16/h1-7,15,20,23H,8-10,22H2/t15-,20-/m1/s1 |
| Canonical SMILES | C1C2C(=O)N(CC(=O)N2C(C3=C1C4=CC=CC=C4N3)C5=CC6=C(C=C5)OCO6)N |
| Isomeric SMILES | C1[C@@H]2C(=O)N(CC(=O)N2[C@@H](C3=C1C4=CC=CC=C4N3)C5=CC6=C(C=C5)OCO6)N |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Aminotadalafil
UNII-FY501QO030
385769-84-6
FY501QO030
Amino-tadalafil
RR-ATDF
CHEMBL1774619
SCHEMBL19975686
DTXSID50191896
(2R,8R)-6-amino-2-(1,3-benzodioxol-5-yl)-3,6,17-triazatetracyclo[8.7.0.0^{3,8}.0^{11,16}]heptadeca-1(10),11,13,15-tetraene-4,7-dione
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 390.4 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Complexity | 704 |
| Monoisotopic Mass | 390.13280508 |
| Exact Mass | 390.13280508 |
| XLogP | 1.5 |
| Formal Charge | 0 |
| Heavy Atom Count | 29 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.6183 |
| Human Intestinal Absorption | HIA+ | 0.9837 |
| Caco-2 Permeability | Caco2- | 0.6721 |
| P-glycoprotein Substrate | Non-substrate | 0.5699 |
| P-glycoprotein Inhibitor | Non-inhibitor | 0.7645 |
| Non-inhibitor | 0.9435 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.8371 |
| Distribution | ||
| Subcellular localization | Nucleus | 0.4164 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.9287 |
| CYP450 2D6 Substrate | Non-substrate | 0.8402 |
| CYP450 3A4 Substrate | Substrate | 0.6264 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8598 |
| CYP450 2C9 Inhibitor | Non-inhibitor | 0.7091 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7912 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6710 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.5300 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.6649 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.9853 |
| Non-inhibitor | 0.6507 | |
| AMES Toxicity | Non AMES toxic | 0.5000 |
| Carcinogens | Non-carcinogens | 0.8270 |
| Fish Toxicity | High FHMT | 0.9849 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.7999 |
| Honey Bee Toxicity | Low HBT | 0.8427 |
| Biodegradation | Not ready biodegradable | 0.9622 |
| Acute Oral Toxicity | III | 0.6312 |
| Carcinogenicity (Three-class) | Non-required | 0.5793 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -2.8824 | LogS |
| Caco-2 Permeability | 0.4523 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.3100 | LD50, mol/kg |
| Fish Toxicity | 1.4205 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.2984 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
