Noracetildenafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0584 |
| Substance Name | PDE-5 inhibitors or its analogs |
| Substance Chinese Name | PDE-5抑制剂或类似物 |
| Molecular Name | Noracetildenafil |
| Molecular Chinese Name | 异红地那非 |
| 2D Structure | |
| CAS Number | 949091-38-7 |
| PubChem CID | 135565870 |
| Formula | C24H32N6O3 |
| IUPAC Name | 5-[2-ethoxy-5-[2-(4-methylpiperazin-1-yl)acetyl]phenyl]-1-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| InChI Key | BEAXWKCHSPVXQB-UHFFFAOYSA-N |
| InChI | InChI=1S/C24H32N6O3/c1-5-7-18-21-22(29(4)27-18)24(32)26-23(25-21)17-14-16(8-9-20(17)33-6-2)19(31)15-30-12-10-28(3)11-13-30/h8-9,14H,5-7,10-13,15H2,1-4H3,(H,25,26,32) |
| Canonical SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)CN4CCN(CC4)C)OCC)C |
| Isomeric SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)CN4CCN(CC4)C)OCC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Noracetildenafil
949091-38-7
UNII-H64W3NL3UV
H64W3NL3UV
Nor-acetildenafil-d8
5-[2-ETHOXY-5-[2-(4-METHYL-(PIPERAZIN-1-YL))ACETYL]PHENYL]-1,6-DIHYDRO-1-METHYL-3-PROPYL-7H-PYRAZOLO[4,3-D]PYRIMIDIN-7-ONE
Nor Acetildenafil
Demethylhongdenafil
5-(2-Ethoxy-5-(2-(4-methyl-1-piperazinyl)acetyl)phenyl)-1,6-dihydro-1-methyl-3-propyl-7H-pyrazolo(4,3-d)pyrimidin-7-one
5-[2-Ethoxy-5-[2-(4-methyl-1-piperazinyl)acetyl]phenyl]-1,6-dihydro-1-methyl-3-propyl-7H-pyrazolo[4,3-d]pyrimidin-7-one
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 452.5 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 8 |
| Complexity | 738 |
| Monoisotopic Mass | 452.25358892 |
| Exact Mass | 452.25358892 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 33 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9540 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.5244 |
| P-glycoprotein Substrate | Substrate | 0.8019 |
| P-glycoprotein Inhibitor | Inhibitor | 0.7761 |
| Inhibitor | 0.9004 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.5954 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8074 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8587 |
| CYP450 2D6 Substrate | Non-substrate | 0.7652 |
| CYP450 3A4 Substrate | Substrate | 0.7625 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8417 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6358 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.9043 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6584 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.5446 |
| CYP Inhibitory Promiscuity | Low CYP Inhibitory Promiscuity | 0.5571 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7147 |
| Inhibitor | 0.6054 | |
| AMES Toxicity | AMES toxic | 0.5582 |
| Carcinogens | Non-carcinogens | 0.7483 |
| Fish Toxicity | High FHMT | 0.9786 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9042 |
| Honey Bee Toxicity | Low HBT | 0.8301 |
| Biodegradation | Not ready biodegradable | 0.9827 |
| Acute Oral Toxicity | III | 0.6428 |
| Carcinogenicity (Three-class) | Non-required | 0.6220 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.5467 | LogS |
| Caco-2 Permeability | 1.1525 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7572 | LD50, mol/kg |
| Fish Toxicity | 1.2050 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5282 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
References
| Title | DOI/PubMed/ISSN |
|---|---|
| Application of a high resolution benchtop quadrupole-Orbitrap mass spectrometry for the rapid screening, confirmation and quantification of illegal adulterated phosphodiesterase-5 inhibitors in herbal medicines and dietary supplements. | 24377735 |
| Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
