Desmethyl carbodenafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0585 |
| Substance Name | PDE-5 inhibitors or its analogs |
| Substance Chinese Name | PDE-5抑制剂或类似物 |
| Molecular Name | Desmethyl carbodenafil |
| Molecular Chinese Name | 去甲基卡巴那非 |
| 2D Structure | |
| CAS Number | 147676-79-7 |
| PubChem CID | 135430839 |
| Formula | C23H30N6O3 |
| IUPAC Name | 5-[2-ethoxy-5-(4-methylpiperazine-1-carbonyl)phenyl]-1-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidin-7-one |
| InChI Key | RIFGMSHSTNMHMS-UHFFFAOYSA-N |
| InChI | InChI=1S/C23H30N6O3/c1-5-7-17-19-20(28(4)26-17)22(30)25-21(24-19)16-14-15(8-9-18(16)32-6-2)23(31)29-12-10-27(3)11-13-29/h8-9,14H,5-7,10-13H2,1-4H3,(H,24,25,30) |
| Canonical SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)N4CCN(CC4)C)OCC)C |
| Isomeric SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)C(=O)N4CCN(CC4)C)OCC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
UNII-0JB0I959JI
0JB0I959JI
Desmethylcarbodenafil
Desmethyl Carbodenafil
SCHEMBL145682
RIFGMSHSTNMHMS-UHFFFAOYSA-N
147676-79-7
7H-Pyrazolo(4,3-d)pyrimidin-7-one, 5-(2-ethoxy-5-((4-methyl-1-piperazinyl)carbonyl)phenyl)-1,6-dihydro-1-methyl-3-propyl
5-[2-Ethoxy-5-(4-methylpiperazinylcarbonyl)phenyl]-1-methyl-3-n-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]-pyrimidin-7-one
5-[2-Ethoxy-5-(4-methylpiperazinylcarbonyl)phenyl]-1-methyl-3-n-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 438.5 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Complexity | 723 |
| Monoisotopic Mass | 438.23793885 |
| Exact Mass | 438.23793885 |
| XLogP | 1.8 |
| Formal Charge | 0 |
| Heavy Atom Count | 32 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.9490 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2- | 0.5174 |
| P-glycoprotein Substrate | Substrate | 0.8077 |
| P-glycoprotein Inhibitor | Inhibitor | 0.7485 |
| Inhibitor | 0.9339 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.5906 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.8069 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8509 |
| CYP450 2D6 Substrate | Non-substrate | 0.7290 |
| CYP450 3A4 Substrate | Substrate | 0.7329 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.8559 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.6907 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.8814 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.6720 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.5612 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5157 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.7484 |
| Inhibitor | 0.6560 | |
| AMES Toxicity | AMES toxic | 0.6011 |
| Carcinogens | Non-carcinogens | 0.7795 |
| Fish Toxicity | High FHMT | 0.9885 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8803 |
| Honey Bee Toxicity | Low HBT | 0.8199 |
| Biodegradation | Not ready biodegradable | 0.9754 |
| Acute Oral Toxicity | III | 0.6471 |
| Carcinogenicity (Three-class) | Non-required | 0.6340 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.5689 | LogS |
| Caco-2 Permeability | 1.1811 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.7536 | LD50, mol/kg |
| Fish Toxicity | 1.2136 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5403 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
