Sulfosildenafil
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0586 |
| Substance Name | PDE-5 inhibitors or its analogs |
| Substance Chinese Name | PDE-5抑制剂或类似物 |
| Molecular Name | Sulfosildenafil |
| Molecular Chinese Name | 硫基西地那非 |
| 2D Structure | |
| CAS Number | 479073-79-5 |
| PubChem CID | 10228242 |
| Formula | C22H30N6O3S2 |
| IUPAC Name | 5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-4H-pyrazolo[4,3-d]pyrimidine-7-thione |
| InChI Key | LJUBVCQVNMLSTQ-UHFFFAOYSA-N |
| InChI | InChI=1S/C22H30N6O3S2/c1-5-7-17-19-20(27(4)25-17)22(32)24-21(23-19)16-14-15(8-9-18(16)31-6-2)33(29,30)28-12-10-26(3)11-13-28/h8-9,14H,5-7,10-13H2,1-4H3,(H,23,24,32) |
| Canonical SMILES | CCCC1=NN(C2=C1NC(=NC2=S)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)C)OCC)C |
| Isomeric SMILES | CCCC1=NN(C2=C1NC(=NC2=S)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)C)OCC)C |
| CFM-ID 3.0 | URL Link |
| Related links | Processing |
| Addition Purposes | Enhance health care function |
| Molecular Synonyms |
Thiosildenafil
479073-79-5
UNII-HRL3FWK7XV
HRL3FWK7XV
5-[2-ethoxy-5-(4-methylpiperazin-1-yl)sulfonylphenyl]-1-methyl-3-propyl-6H-pyrazolo[4,3-d]pyrimidine-7-thione
SCHEMBL6716511
CTK8E7608
DTXSID30197336
ZINC38403603
AKOS030254601
|
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 490.6 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 7 |
| Complexity | 840 |
| Monoisotopic Mass | 490.1820812 |
| Exact Mass | 490.1820812 |
| XLogP | 2.1 |
| Formal Charge | 0 |
| Heavy Atom Count | 33 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB+ | 0.8788 |
| Human Intestinal Absorption | HIA+ | 1.0000 |
| Caco-2 Permeability | Caco2+ | 0.5478 |
| P-glycoprotein Substrate | Substrate | 0.7377 |
| P-glycoprotein Inhibitor | Inhibitor | 0.6425 |
| Inhibitor | 0.6884 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.5199 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.4039 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.7888 |
| CYP450 2D6 Substrate | Substrate | 0.6144 |
| CYP450 3A4 Substrate | Substrate | 0.6870 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.7517 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5698 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.5709 |
| CYP450 2C19 Inhibitor | Non-inhibitor | 0.8086 |
| CYP450 3A4 Inhibitor | Inhibitor | 0.6380 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.5815 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.5446 |
| Inhibitor | 0.7798 | |
| AMES Toxicity | Non AMES toxic | 0.5670 |
| Carcinogens | Non-carcinogens | 0.7115 |
| Fish Toxicity | High FHMT | 0.9964 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.8900 |
| Honey Bee Toxicity | Low HBT | 0.6161 |
| Biodegradation | Not ready biodegradable | 0.8889 |
| Acute Oral Toxicity | III | 0.5630 |
| Carcinogenicity (Three-class) | Non-required | 0.5876 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.8590 | LogS |
| Caco-2 Permeability | 1.1581 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.6771 | LD50, mol/kg |
| Fish Toxicity | 1.4112 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5565 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0142 |
| Food Image | ![]() |
| Food Name | Plant food supplements |
| Food Chinese Name | 植物食品补充剂 |
| Food Type | Processed food |
| References | Adulteration of Dietary Supplements by the Illegal Addition of Synthetic Drugs: A Review |
