Lysozyme hydrochloride
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | C0096 |
| Substance Name | Preservative |
| Substance Chinese Name | 防腐剂 |
| Molecular Name | Lysozyme hydrochloride |
| Molecular Chinese Name | 盐酸溶菌酶 |
| 2D Structure | |
| CAS Number | None |
| PubChem CID | 49989526 |
| Formula | C40H47FN6O5 |
| IUPAC Name | 1-[1-[2-[5-(cyclohexylcarbamoyl)-2-methylanilino]-2-oxoethyl]piperidine-4-carbonyl]-N-[3-[(2-fluorobenzoyl)amino]phenyl]pyrrolidine-2-carboxamide |
| InChI Key | CVVYMXAPTWLCAP-UHFFFAOYSA-N |
| InChI | InChI=1S/C40H47FN6O5/c1-26-16-17-28(37(49)42-29-9-3-2-4-10-29)23-34(26)45-36(48)25-46-21-18-27(19-22-46)40(52)47-20-8-15-35(47)39(51)44-31-12-7-11-30(24-31)43-38(50)32-13-5-6-14-33(32)41/h5-7,11-14,16-17,23-24,27,29,35H,2-4,8-10,15,18-22,25H2,1H3,(H,42,49)(H,43,50)(H,44,51)(H,45,48) |
| Canonical SMILES | CC1=C(C=C(C=C1)C(=O)NC2CCCCC2)NC(=O)CN3CCC(CC3)C(=O)N4CCCC4C(=O)NC5=CC=CC(=C5)NC(=O)C6=CC=CC=C6F |
| Isomeric SMILES | CC1=C(C=C(C=C1)C(=O)NC2CCCCC2)NC(=O)CN3CCC(CC3)C(=O)N4CCCC4C(=O)NC5=CC=CC(=C5)NC(=O)C6=CC=CC=C6F |
| CFM-ID 3.0 | URL Link |
| Related links | Transportation, Processing, Circulation |
| Addition Purposes | Antiseptic |
| Data Uploader | Shuyu Ouyang |
| Update Date | Jul 25, 2019 20:46 |
Properties
| Property Name | Property Value |
|---|---|
| Molecular Weight | 710.8 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 10 |
| Complexity | 1250 |
| Monoisotopic Mass | 710.3591968 |
| Exact Mass | 710.3591968 |
| XLogP | 4.9 |
| Formal Charge | 0 |
| Heavy Atom Count | 52 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Isotope Atom Count | 0 |
| Covalently-Bonded Unit Count | 1 |
ADMET
| Model | Result | Probability |
|---|---|---|
| Absorption | ||
| Blood-Brain Barrier | BBB- | 0.6555 |
| Human Intestinal Absorption | HIA+ | 0.8041 |
| Caco-2 Permeability | Caco2- | 0.7275 |
| P-glycoprotein Substrate | Substrate | 0.8327 |
| P-glycoprotein Inhibitor | Inhibitor | 0.9383 |
| Non-inhibitor | 0.7484 | |
| Renal Organic Cation Transporter | Non-inhibitor | 0.7022 |
| Distribution | ||
| Subcellular localization | Mitochondria | 0.5927 |
| Metabolism | ||
| CYP450 2C9 Substrate | Non-substrate | 0.8264 |
| CYP450 2D6 Substrate | Non-substrate | 0.8258 |
| CYP450 3A4 Substrate | Substrate | 0.6478 |
| CYP450 1A2 Inhibitor | Non-inhibitor | 0.9398 |
| CYP450 2C9 Inhibitor | Inhibitor | 0.5123 |
| CYP450 2D6 Inhibitor | Non-inhibitor | 0.7743 |
| CYP450 2C19 Inhibitor | Inhibitor | 0.6539 |
| CYP450 3A4 Inhibitor | Non-inhibitor | 0.6639 |
| CYP Inhibitory Promiscuity | High CYP Inhibitory Promiscuity | 0.7433 |
| Excretion | ||
| Toxicity | ||
| Human Ether-a-go-go-Related Gene Inhibition | Weak inhibitor | 0.8659 |
| Inhibitor | 0.8773 | |
| AMES Toxicity | Non AMES toxic | 0.8035 |
| Carcinogens | Non-carcinogens | 0.8930 |
| Fish Toxicity | High FHMT | 0.8170 |
| Tetrahymena Pyriformis Toxicity | High TPT | 0.9840 |
| Honey Bee Toxicity | Low HBT | 0.9431 |
| Biodegradation | Not ready biodegradable | 1.0000 |
| Acute Oral Toxicity | III | 0.6412 |
| Carcinogenicity (Three-class) | Non-required | 0.6275 |
ADMET -- Regression
| Model | Value | Unit |
|---|---|---|
| Aqueous solubility | -3.2371 | LogS |
| Caco-2 Permeability | 0.5039 | LogPapp, cm/s |
| Rat Acute Toxicity | 2.5086 | LD50, mol/kg |
| Fish Toxicity | 1.4633 | pLC50, mg/L |
| Tetrahymena Pyriformis Toxicity | 0.5770 | pIGC50, ug/L |
Related Foods
| FADB-China ID | F0058 |
| Food Image | ![]() |
| Food Name | Pickles |
| Food Chinese Name | 渍菜(泡菜等) |
| Food Type | Processed food |
| References | List of food additives that may be easily abused in food (first batch) |
| FADB-China ID | F0060 |
| Food Image | ![]() |
| Food Name | Fruit jelly |
| Food Chinese Name | 水果冻 |
| Food Type | Non-processed food |
| References | List of food additives that may be easily abused in food (first batch) |
| FADB-China ID | F0061 |
| Food Image | ![]() |
| Food Name | Peptone |
| Food Chinese Name | 蛋白冻 |
| Food Type | Processed food |
| References | List of food additives that may be easily abused in food (first batch) |
| FADB-China ID | F0062 |
| Food Image | ![]() |
| Food Name | Pastry |
| Food Chinese Name | 面点 |
| Food Type | Processed food |
| References | List of food additives that may be easily abused in food (first batch) |
| FADB-China ID | F0063 |
| Food Image | ![]() |
| Food Name | Mooncake |
| Food Chinese Name | 月饼 |
| Food Type | Processed food |
| References | List of food additives that may be easily abused in food (first batch) |
.jpg)



