Chinese herbal medicine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0108 |
| Food Name | Chinese herbal medicine |
| Chinese Name | 中药材 |
| Picture |  |
| Food Group | |
| Food Type | Processed food |
| Update Date | Jul 16, 2019 10:55 |
Illegal Additives
| CFAD ID | C0384 |
| Substance | Coptisine |
| Molecule | Coptisine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C19H14NO4+ |
| InChi Key | XYHOBCMEDLZUMP-UHFFFAOYSA-N |
| Isomeric SMILES | C1C[N+]2=C(C=C3C=CC4=C(C3=C2)OCO4)C5=CC6=C(C=C51)OCO6 |
| Detection Method | capillary electrophoresis-electrospray ion trap mass spectrometry |
| CFAD ID | C0386 |
| Substance | Sweetcorn |
| Molecule | - |
| Involved Links | Processing |
| Detection Method | recombinase polymerase amplification |
| CFAD ID | C0387 |
| Substance | Berberine |
| Molecule | Berberine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C20H18NO4+ |
| InChi Key | YBHILYKTIRIUTE-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC |
| Detection Method | capillary electrophoresis-electrospray ion trap mass spectrometry |
| CFAD ID | C0389 |
| Substance | Palmatine |
| Molecule | Palmatine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C21H22NO4+ |
| InChi Key | QUCQEUCGKKTEBI-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC(=C(C=C4CC3)OC)OC)OC |
| Detection Method | capillary electrophoresis-electrospray ion trap mass spectrometry |
| CFAD ID | C0392 |
| Substance | Acetohexamide |
| Molecule | Acetohexamide |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C15H20N2O4S |
| InChi Key | VGZSUPCWNCWDAN-UHFFFAOYSA-N |
| Isomeric SMILES | CC(=O)C1=CC=C(C=C1)S(=O)(=O)NC(=O)NC2CCCCC2 |
| Detection Method | high-performance capillary electrophoresis (HPCE) |
| CFAD ID | C0378 |
| Substance | Testosterone |
| Molecule | Testosterone |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C20H30O2 |
| InChi Key | GCKMFJBGXUYNAG-HLXURNFRSA-N |
| Isomeric SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C |
| Detection Method | high performance liquid chromatography |
| CFAD ID | C0375 |
| Substance | Methyltestosterone |
| Molecule | Methyltestosterone |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C20H30O2 |
| InChi Key | GCKMFJBGXUYNAG-HLXURNFRSA-N |
| Isomeric SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@]4(C)O)C |
| Detection Method | high performance liquid chromatography |
| CFAD ID | C0374 |
| Substance | Fluoxymesterone |
| Molecule | Fluoxymesterone |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Enhance health care function |
| Formula | C20H29FO3 |
| InChi Key | YLRFCQOZQXIBAB-RBZZARIASA-N |
| Isomeric SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@]2([C@H](C[C@]4([C@H]3CC[C@]4(C)O)C)O)F |
| Detection Method | high performance liquid chromatography |
| CFAD ID | C0393 |
| Substance | Chlorpropamide |
| Molecule | Chlorpropamide |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C10H13ClN2O3S |
| InChi Key | RKWGIWYCVPQPMF-UHFFFAOYSA-N |
| Isomeric SMILES | CCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)Cl |
| Detection Method | high-performance capillary electrophoresis (HPCE) |
| CFAD ID | C0395 |
| Substance | Glibenclamide |
| Molecule | Glibenclamide |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C23H28ClN3O5S |
| InChi Key | ZNNLBTZKUZBEKO-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=C(C=C(C=C1)Cl)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)NC(=O)NC3CCCCC3 |
| Detection Method | high-performance capillary electrophoresis (HPCE) |
| CFAD ID | C0397 |
| Substance | Tolbutamide |
| Molecule | Tolbutamide |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C12H18N2O3S |
| InChi Key | JLRGJRBPOGGCBT-UHFFFAOYSA-N |
| Isomeric SMILES | CCCCNC(=O)NS(=O)(=O)C1=CC=C(C=C1)C |
| Detection Method | high-performance capillary electrophoresis (HPCE) |
| CFAD ID | C0400 |
| Substance | Sildenafil |
| Molecule | Sildenafil |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost, Enhance health care function |
| Formula | C22H30N6O4S |
| InChi Key | BNRNXUUZRGQAQC-UHFFFAOYSA-N |
| Isomeric SMILES | CCCC1=NN(C2=C1N=C(NC2=O)C3=C(C=CC(=C3)S(=O)(=O)N4CCN(CC4)C)OCC)C |
| Detection Method | LC/MS/MS |
| CFAD ID | C0402 |
| Substance | Famotidine |
| Molecule | Famotidine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost |
| Formula | C8H15N7O2S3 |
| InChi Key | XUFQPHANEAPEMJ-UHFFFAOYSA-N |
| Isomeric SMILES | C1=C(N=C(S1)N=C(N)N)CSCC/C(=N/S(=O)(=O)N)/N |
| Detection Method |
Predicted Illegal Additives
| ID | P2272 |
| Name | Berberine |
| Structure | |
| Source | DrugBank, ToxinDB |
| Basis of prediction | Coptisine |
| PubChem Link | Link |
| ID | P2273 |
| Name | Berberine |
| Structure | |
| Source | DrugBank, ToxinDB |
| Basis of prediction | Coptisine |
| PubChem Link | Link |
| ID | P0103 |
| Name | Glycyclamide |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Acetohexamide |
| PubChem Link | Link |
| ID | P2284 |
| Name | Testosterone |
| Structure | |
| Source | DrugBank, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2285 |
| Name | Epinandrolone |
| Structure | |
| Source | ToxinDB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2286 |
| Name | Calusterone |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2287 |
| Name | (10ALPHA,13ALPHA,14BETA,17ALPHA)-17-HYDROXYANDROST-4-EN-3-ONE |
| Structure | |
| Source | DrugBank, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2288 |
| Name | Allylestrenol |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2289 |
| Name | 7a-methyl-19-nortestosterone |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2290 |
| Name | Ethylestrenol |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2292 |
| Name | Levonorgestrel |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2293 |
| Name | Bolasterone |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2294 |
| Name | Nandrolone |
| Structure | |
| Source | ToxinDB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2296 |
| Name | 17-Hydroxyprogesterone |
| Structure | |
| Source | ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2297 |
| Name | Metenolone |
| Structure | |
| Source | FRCD |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2298 |
| Name | Ethisterone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2299 |
| Name | Mibolerone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2300 |
| Name | Oxendolone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2301 |
| Name | Dl-Norgestrel |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2302 |
| Name | Epitestosterone |
| Structure | |
| Source | DrugBank, ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2303 |
| Name | Nandrolone |
| Structure | |
| Source | ToxinDB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2304 |
| Name | 20alpha-Dihydroprogesterone |
| Structure | |
| Source | FRCD |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2305 |
| Name | (17α)-17-hydroxy-3-oxoandrost-4-ene-17-carbonitrile |
| Structure | |
| Source | FRCD |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2306 |
| Name | Progesterone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, IARC Carcinogens Group 2B, DrugBank, CAC Veterinary Drug, ToxinDB, T3DB |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2307 |
| Name | Delta1-dihydrotestosterone |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2308 |
| Name | Fluoxymesterone |
| Structure | |
| Source | DrugBank, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2309 |
| Name | 4-Androstenedione |
| Structure | |
| Source | DrugBank, ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2310 |
| Name | 4-Hydroxy-19-nortestosterone |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2311 |
| Name | Clostebol |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2312 |
| Name | 4-Androstenediol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2313 |
| Name | Androstenedione |
| Structure | |
| Source | DrugBank, ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2314 |
| Name | 17β-hydroxy-17-(3-hydroxy-1-propynyl)androst-4-ene-3-one |
| Structure | |
| Source | FRCD |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2315 |
| Name | Etienic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2316 |
| Name | Gestonorone |
| Structure | |
| Source | FRCD |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2317 |
| Name | 17a-hydroxy-2-(hydroxymethylene)pregn-4-en-20-yn-3-one |
| Structure | |
| Source | FRCD |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2318 |
| Name | Lynestrenol |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2319 |
| Name | Dimethisteron |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2291 |
| Name | Norethindrone |
| Structure | |
| Source | DrugBank, IARC Carcinogens Group 2B, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2295 |
| Name | Norethisterone |
| Structure | |
| Source | DrugBank, IARC Carcinogens Group 2B, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Methyltestosterone |
| PubChem Link | Link |
| ID | P2320 |
| Name | Fludrocortisone |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Fluoxymesterone |
| PubChem Link | Link |
| ID | P2321 |
| Name | Flugestone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Fluoxymesterone |
| PubChem Link | Link |
| ID | P2323 |
| Name | (11alpha,14beta)-11,17,21-trihydroxypregn-4-ene-3,20-dione |
| Structure | |
| Source | DrugBank, ToxinDB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Fluoxymesterone |
| PubChem Link | Link |
| ID | P2324 |
| Name | Methyltestosterone |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Fluoxymesterone |
| PubChem Link | Link |
| ID | P2322 |
| Name | Hydrocortisone |
| Structure | |
| Source | DrugBank, ToxinDB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Fluoxymesterone |
| PubChem Link | Link |
| ID | P2408 |
| Name | Carbutamide |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tolbutamide |
| PubChem Link | Link |