Fruit juice
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0109 |
| Food Name | Fruit juice |
| Chinese Name | 果汁 |
| Picture |  |
| Food Group | 饮料 |
| Food Type | Processed food |
| Update Date | Jul 16, 2019 11:07 |
Illegal Additives
| CFAD ID | C0390 |
| Substance | Water |
| Molecule | Water |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Increase weight or volume, Reduce cost |
| Formula | H2O |
| InChi Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Isomeric SMILES | O |
| Detection Method | near infrared spectroscopy |
| CFAD ID | C0391 |
| Substance | Fruit residue extract |
| Molecule | Fruit residue extract |
| Involved Links | Processing |
| Detection Method | near infrared spectroscopy |
| CFAD ID | C0440 |
| Substance | Abscisic acid |
| Molecule | Abscisic acid |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost |
| Formula | C15H20O4 |
| InChi Key | JLIDBLDQVAYHNE-LXGGSRJLSA-N |
| Isomeric SMILES | CC1=CC(=O)CC(C1(/C=C/C(=C\C(=O)O)/C)O)(C)C |
| Detection Method | HPLC-PDA;Fingerprint |
| CFAD ID | C0441 |
| Substance | Isorhamnetin-3-O-rutinoside |
| Molecule | Isorhamnetin-3-O-rutinoside |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost |
| Formula | C28H32O16 |
| InChi Key | UIDGLYUNOUKLBM-GEBJFKNCSA-N |
| Isomeric SMILES | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC(=C(C=C5)O)OC)O)O)O)O)O)O |
| Detection Method | HPLC-PDA；Fingerprint |
| CFAD ID | C0442 |
| Substance | 4-O-p-coumarylquinic acid |
| Molecule | 4-O-p-coumarylquinic acid |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost |
| Formula | C16H18O8 |
| InChi Key | XWRHBGVVCOSNKO-OPGYGNEESA-N |
| Isomeric SMILES | C1[C@H](C([C@@H](CC1(C(=O)O)O)O)OC(=O)/C=C/C2=CC=C(C=C2)O)O |
| Detection Method | HPLC-PDA;Fingerprint |
Predicted Illegal Additives
| ID | P2459 |
| Name | Vomifoliol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Abscisic acid |
| PubChem Link | Link |
| ID | P2460 |
| Name | Ac1L98Yq |
| Structure | |
| Source | FRCD |
| Basis of prediction | Abscisic acid |
| PubChem Link | Link |
| ID | P0112 |
| Name | Rutin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P0113 |
| Name | RUTIN |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2450 |
| Name | Astragalin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2451 |
| Name | Quercitrin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2454 |
| Name | Myricitrin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2455 |
| Name | Troxerutin |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2457 |
| Name | Quercitrin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2458 |
| Name | Monoxerutin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2452 |
| Name | Hyperoside |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2453 |
| Name | Isoquercitrin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2456 |
| Name | Hyperin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Isorhamnetin-3-O-rutinoside |
| PubChem Link | Link |
| ID | P2445 |
| Name | Neochlorogenic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | 4-O-p-coumarylquinic acid |
| PubChem Link | Link |
| ID | P2446 |
| Name | NSC-407296 |
| Structure | |
| Source | FRCD |
| Basis of prediction | 4-O-p-coumarylquinic acid |
| PubChem Link | Link |
| ID | P2447 |
| Name | 1,4-Dicaffeylquinic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | 4-O-p-coumarylquinic acid |
| PubChem Link | Link |
| ID | P2448 |
| Name | CHLOROGENIC ACID |
| Structure | |
| Source | FRCD |
| Basis of prediction | 4-O-p-coumarylquinic acid |
| PubChem Link | Link |
| ID | P2449 |
| Name | Chlorogenic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | 4-O-p-coumarylquinic acid |
| PubChem Link | Link |