Saffron
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0135 |
| Food Name | Saffron |
| Chinese Name | 藏红花 |
| Picture |  |
| Food Group | 中药材 |
| Food Type | Non-processed food |
| Update Date | Jul 16, 2019 17:13 |
Illegal Additives
| CFAD ID | C0386 |
| Substance | Sweetcorn |
| Molecule | - |
| Involved Links | Processing |
| Detection Method | recombinase polymerase amplification |
| CFAD ID | C0388 |
| Substance | Nelumbo nucifera |
| Molecule | - |
| Involved Links | Processing |
| Detection Method | recombinase polymerase amplification |
| CFAD ID | C0383 |
| Substance | Safflower |
| Molecule | - |
| Involved Links | Processing |
| Detection Method | recombinase polymerase amplification |
| CFAD ID | C0381 |
| Substance | Carrot |
| Molecule | - |
| Involved Links | Processing |
| Detection Method | recombinase polymerase amplification |
| CFAD ID | C0380 |
| Substance | Marigold |
| Molecule | - |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost |
| Formula | C40H56O2 |
| InChi Key | KBPHJBAIARWVSC-RGZFRNHPSA-N |
| Isomeric SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@H]2C(=C[C@@H](CC2(C)C)O)C)/C)/C |
| Detection Method | recombinase polymerase amplification |
| CFAD ID | C0377 |
| Substance | Turmeric |
| Molecule | - |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Reduce cost |
| Formula | C21H20O6 |
| InChi Key | VFLDPWHFBUODDF-FCXRPNKRSA-N |
| Isomeric SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O |
| Detection Method | recombinase polymerase amplification |
Predicted Illegal Additives
| ID | P2325 |
| Name | Astaxanthin |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2326 |
| Name | Beta-carotene |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2327 |
| Name | Cryptoxanthin |
| Structure | |
| Source | CAC Veterinary Drug, OpenFoodTox |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2328 |
| Name | Zeaxanthin |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2329 |
| Name | ALPHA-CAROTENE |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2330 |
| Name | Beta-Carotene |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2331 |
| Name | BETA-CAROTENE |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2332 |
| Name | Vanillylidene acetone |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2333 |
| Name | Curcumin II |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2334 |
| Name | Dehydrozingerone |
| Structure | |
| Source | FRCD |
| Basis of prediction | - |
| PubChem Link | Link |
| ID | P2335 |
| Name | Bisdemethoxycurcumin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | - |
| PubChem Link | Link |