Animal derived food
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0139 |
| Food Name | Animal derived food |
| Chinese Name | 动物源性食品 |
| Picture |  |
| Food Group | 动物制品 |
| Food Type | Processed food |
| Update Date | Jul 17, 2019 09:55 |
Illegal Additives
| CFAD ID | C0458 |
| Substance | Gossypol |
| Molecule | Gossypol |
| Involved Links | Planting/breeding, Processing |
| Detection Method | not available |
| CFAD ID | C0522 |
| Substance | Streptomycin |
| Molecule | Streptomycin |
| Involved Links | Planting/breeding, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C21H39N7O12 |
| InChi Key | UCSJYZPVAKXKNQ-HZYVHMACSA-N |
| Isomeric SMILES | C[C@H]1[C@@]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)N=C(N)N)O)N=C(N)N)O[C@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)NC)(C=O)O |
| Detection Method | not available |
| CFAD ID | C0523 |
| Substance | Tulathromycin |
| Molecule | Tulathromycin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C41H79N3O12 |
| InChi Key | GUARTUJKFNAVIK-QPTWMBCESA-N |
| Isomeric SMILES | CCCNC[C@@]1([C@@H](O[C@H](C[C@@]1(C)OC)O[C@H]2[C@@H]([C@H]([C@](C[C@H](CN[C@@H]([C@H]([C@]([C@H](OC(=O)[C@@H]2C)CC)(C)O)O)C)C)(C)O)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)C)C)O |
| Detection Method | not available |
| CFAD ID | C0524 |
| Substance | Gentamicin |
| Molecule | Gentamicin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C21H43N5O7 |
| InChi Key | CEAZRRDELHUEMR-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C1CCC(C(O1)OC2C(CC(C(C2O)OC3C(C(C(CO3)(C)O)NC)O)N)N)N)NC |
| Detection Method | not available |
Predicted Illegal Additives
| ID | P0142 |
| Name | Vibriomycin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Streptomycin |
| PubChem Link | Link |
| ID | P0143 |
| Name | Dihydrostreptomycin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Streptomycin |
| PubChem Link | Link |
| ID | P0144 |
| Name | Dihydrostreptomycin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Streptomycin |
| PubChem Link | Link |
| ID | P2632 |
| Name | UNII-CW25IKJ202 |
| Structure | |
| Source | FRCD |
| Basis of prediction | Streptomycin |
| PubChem Link | Link |
| ID | P2634 |
| Name | Dihydrostreptomycin sulfate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Streptomycin |
| PubChem Link | Link |
| ID | P2633 |
| Name | Streptomycin sulfate (2:3) |
| Structure | |
| Source | FRCD |
| Basis of prediction | Streptomycin |
| PubChem Link | Link |
| ID | P2635 |
| Name | Azithromycin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tulathromycin |
| PubChem Link | Link |
| ID | P2636 |
| Name | Azithromycin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tulathromycin |
| PubChem Link | Link |
| ID | P2637 |
| Name | Gamithromycin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tulathromycin |
| PubChem Link | Link |
| ID | P2638 |
| Name | GENTAMICIN C1A |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Gentamicin |
| PubChem Link | Link |
| ID | P2639 |
| Name | G418 |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Gentamicin |
| PubChem Link | Link |
| ID | P2640 |
| Name | Geneticin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Gentamicin |
| PubChem Link | Link |