Aged rice
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0015 |
| Food Name | Aged rice |
| Chinese Name | 陈化大米 |
| Picture |  |
| Food Group | 粮食 |
| Food Type | Non-processed food |
| Update Date | Jul 11, 2019 10:45 |
Illegal Additives
| CFAD ID | C0022 |
| Substance | Industrial mineral oil |
| Molecule | - |
| Involved Links | Processing, Circulation |
| Detection Method |
| CFAD ID | C0042 |
| Substance | Sodium pyrosulfite |
| Molecule | Sodium pyrosulfite |
| Involved Links | Circulation, Dining |
| Structure | |
| Purpose of Addition | Improve color, Preservation, Antiseptic |
| Formula | Na2O5S2 |
| InChi Key | HRZFUMHJMZEROT-UHFFFAOYSA-L |
| Isomeric SMILES | [O-]S(=O)S(=O)(=O)[O-].[Na+].[Na+] |
| Detection Method | GB/T 5009.34-2003 Determination of sulphite in foods |
Predicted Illegal Additives
| ID | P0013 |
| Name | Metabisulfite |
| Structure | |
| Source | T3DB |
| Basis of prediction | Sodium pyrosulfite |
| PubChem Link | Link |
| ID | P1019 |
| Name | Potassium metabisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium pyrosulfite |
| PubChem Link | Link |
| ID | P1020 |
| Name | Potassium Metabisulfite |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium pyrosulfite |
| PubChem Link | Link |
| ID | P1021 |
| Name | POTASSIUM METABISULFITE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sodium pyrosulfite |
| PubChem Link | Link |