Wine
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0059 |
| Food Name | Wine |
| Chinese Name | 葡萄酒 |
| Picture |  |
| Food Group | 酒类 |
| Food Type | Processed food |
| Update Date | Jul 11, 2019 14:23 |
Illegal Additives
| CFAD ID | C0045 |
| Substance | Colorant |
| Molecule | Carmine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C22H20O13 |
| InChi Key | DGQLVPJVXFOQEV-JNVSTXMASA-N |
| Isomeric SMILES | CC1=C2C(=CC(=C1C(=O)O)O)C(=O)C3=C(C2=O)C(=C(C(=C3O)O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods |
| CFAD ID | C0046 |
| Substance | Colorant |
| Molecule | Tartrazine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C16H9N4Na3O9S2 |
| InChi Key | UJMBCXLDXJUMFB-UHFFFAOYSA-K |
| Isomeric SMILES | C1=CC(=CC=C1N=NC2C(=NN(C2=O)C3=CC=C(C=C3)S(=O)(=O)[O-])C(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+] |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods |
| CFAD ID | C0049 |
| Substance | Colorant |
| Molecule | Allura Red |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C18H14N2Na2O8S2 |
| InChi Key | CEZCCHQBSQPRMU-UHFFFAOYSA-L |
| Isomeric SMILES | CC1=CC(=C(C=C1S(=O)(=O)[O-])OC)N=NC2=C(C=CC3=C2C=CC(=C3)S(=O)(=O)[O-])O.[Na+].[Na+] |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods， GB/T 5009.141-2003 Determination of alluring red in foods |
| CFAD ID | C0051 |
| Substance | Colorant |
| Molecule | Sunset yellow |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C16H10N2Na2O7S2 |
| InChi Key | OIQPTROHQCGFEF-UHFFFAOYSA-L |
| Isomeric SMILES | C1=CC(=CC=C1N=NC2=C(C=CC3=C2C=CC(=C3)S(=O)(=O)[O-])O)S(=O)(=O)[O-].[Na+].[Na+] |
| Detection Method | GB/T 5009.35-2003 Determination of synthetic colorants in foods， |
Predicted Illegal Additives
| ID | P1049 |
| Name | Allura red AC |
| Structure | |
| Source | T3DB |
| Basis of prediction | Allura Red |
| PubChem Link | Link |
| ID | P1050 |
| Name | C.I. Pigment Yellow 104 |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sunset yellow |
| PubChem Link | Link |
| ID | P1051 |
| Name | Disodium 6-hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonate |
| Structure | |
| Source | T3DB |
| Basis of prediction | Sunset yellow |
| PubChem Link | Link |
| ID | P1052 |
| Name | 6-Hydroxy-5-[(4-sulfophenyl)azo]-2-naphthalenesulfonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sunset yellow |
| PubChem Link | Link |