Pork, red meat and liver
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0070 |
| Food Name | Pork, red meat and liver |
| Chinese Name | 猪肉、牛羊肉及肝脏 |
| Picture |  |
| Food Group | 肉制品 |
| Food Type | Non-processed food |
| Update Date | Jul 11, 2019 15:34 |
Illegal Additives
| CFAD ID | C0112 |
| Substance | Beta stimulants |
| Molecule | Rac-salbutamol |
| Involved Links | Planting/breeding |
| Detection Method | GB-T22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0116 |
| Substance | Beta stimulants |
| Molecule | S-(+)-salbutamol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0122 |
| Substance | Beta stimulants |
| Molecule | R-(–)-salbutamol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0126 |
| Substance | Beta stimulants |
| Molecule | 5-hydroxy salbutamol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0128 |
| Substance | Beta stimulants |
| Molecule | Salbutamon |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C13H19NO3 |
| InChi Key | WHJAFZHZZCVHJI-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C=C1)O)CO |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0129 |
| Substance | Beta stimulants |
| Molecule | Salbutamol methyl ether |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0132 |
| Substance | Beta stimulants |
| Molecule | Colterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H19NO3 |
| InChi Key | PHSMOUBHYUFTDM-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0133 |
| Substance | Beta stimulants |
| Molecule | Isoproterenol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C11H17NO3 |
| InChi Key | JWZZKOKVBUJMES-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(C1=CC(=C(C=C1)O)O)O |
| Detection Method |
| CFAD ID | C0135 |
| Substance | Beta stimulants |
| Molecule | Norepinephrine |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C8H11NO3 |
| InChi Key | SFLSHLFXELFNJZ-QMMMGPOBSA-N |
| Isomeric SMILES | C1=CC(=C(C=C1[C@H](CN)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0137 |
| Substance | Beta stimulants |
| Molecule | Epinephrine |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C9H13NO3 |
| InChi Key | UCTWMZQNUQWSLP-VIFPVBQESA-N |
| Isomeric SMILES | CNC[C@@H](C1=CC(=C(C=C1)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0139 |
| Substance | Beta stimulants |
| Molecule | Terbutaline |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H19NO3 |
| InChi Key | XWTYSIMOBUGWOL-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0141 |
| Substance | Beta stimulants |
| Molecule | Orciprenaline |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C11H17NO3 |
| InChi Key | LMOINURANNBYCM-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(C1=CC(=CC(=C1)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0149 |
| Substance | Beta stimulants |
| Molecule | (3,5-dimethoxyphenyl)-2-(isopropylamino) ethanol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0151 |
| Substance | Beta stimulants |
| Molecule | Dbenzaldehyde |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0153 |
| Substance | Beta stimulants |
| Molecule | 5-[2-[(1,1-dimethylethyl)amino]-1-hydroxyethyl]-2-hydroxyben |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0155 |
| Substance | Beta stimulants |
| Molecule | 3-dehydroxy salbutmol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0156 |
| Substance | Beta stimulants |
| Molecule | Bt-butylnorsynephrine |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0157 |
| Substance | Beta stimulants |
| Molecule | Octopamine |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C8H11NO2 |
| InChi Key | QHGUCRYDKWKLMG-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC=C1C(CN)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0158 |
| Substance | Beta stimulants |
| Molecule | S-(+)-2-tert-butylamino-1-phenylethanol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0160 |
| Substance | Beta stimulants |
| Molecule | R-(–)-2-tert-butylamino-1-phenylethanol |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0161 |
| Substance | Beta stimulants |
| Molecule | Fenspiride |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C15H20N2O2 |
| InChi Key | FVNFBBAOMBJTST-UHFFFAOYSA-N |
| Isomeric SMILES | C1CN(CCC12CNC(=O)O2)CCC3=CC=CC=C3 |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0163 |
| Substance | Beta stimulants |
| Molecule | Reproterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C18H23N5O5 |
| InChi Key | WVLAAKXASPCBGT-UHFFFAOYSA-N |
| Isomeric SMILES | CN1C2=C(C(=O)N(C1=O)C)N(C=N2)CCCNCC(C3=CC(=CC(=C3)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0165 |
| Substance | Beta stimulants |
| Molecule | Bitolterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C28H31NO5 |
| InChi Key | FZGVEKPRDOIXJY-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=CC=C(C=C1)C(=O)OC2=C(C=C(C=C2)C(CNC(C)(C)C)O)OC(=O)C3=CC=C(C=C3)C |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0166 |
| Substance | Beta stimulants |
| Molecule | Bambuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C18H29N3O5 |
| InChi Key | ANZXOIAKUNOVQU-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=CC(=C1)OC(=O)N(C)C)OC(=O)N(C)C)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0167 |
| Substance | Beta stimulants |
| Molecule | Ractopamine |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C18H23NO3 |
| InChi Key | YJQZYXCXBBCEAQ-UHFFFAOYSA-N |
| Isomeric SMILES | CC(CCC1=CC=C(C=C1)O)NCC(C2=CC=C(C=C2)O)O |
| Detection Method |
| CFAD ID | C0168 |
| Substance | Beta stimulants |
| Molecule | Ritodrine |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C17H21NO3 |
| InChi Key | IOVGROKTTNBUGK-SJCJKPOMSA-N |
| Isomeric SMILES | C[C@@H]([C@@H](C1=CC=C(C=C1)O)O)NCCC2=CC=C(C=C2)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0170 |
| Substance | Beta stimulants |
| Molecule | Pirbuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H20N2O3 |
| InChi Key | VQDBNKDJNJQRDG-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=NC(=C(C=C1)O)CO)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0172 |
| Substance | Beta stimulants |
| Molecule | Zilpaterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C14H19N3O2 |
| InChi Key | ZSTCZWJCLIRCOJ-DGCLKSJQSA-N |
| Isomeric SMILES | CC(C)N[C@@H]1CCN2C3=C([C@H]1O)C=CC=C3NC2=O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0175 |
| Substance | Beta stimulants |
| Molecule | Carbuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C13H21N3O3 |
| InChi Key | KEMXXQOFIRIICG-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)O)NC(=O)N)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0176 |
| Substance | Beta stimulants |
| Molecule | Arformoterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C19H24N2O4 |
| InChi Key | BPZSYCZIITTYBL-YJYMSZOUSA-N |
| Isomeric SMILES | C[C@H](CC1=CC=C(C=C1)OC)NC[C@@H](C2=CC(=C(C=C2)O)NC=O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0178 |
| Substance | Beta stimulants |
| Molecule | Procaterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C16H22N2O3 |
| InChi Key | FKNXQNWAXFXVNW-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(C(C1=C2C=CC(=O)NC2=C(C=C1)O)O)NC(C)C |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0179 |
| Substance | Beta stimulants |
| Molecule | Olodaterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C21H26N2O5 |
| InChi Key | COUYJEVMBVSIHV-SFHVURJKSA-N |
| Isomeric SMILES | CC(C)(CC1=CC=C(C=C1)OC)NC[C@@H](C2=C3C(=CC(=C2)O)NC(=O)CO3)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0181 |
| Substance | Beta stimulants |
| Molecule | Indacaterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C24H28N2O3 |
| InChi Key | QZZUEBNBZAPZLX-QFIPXVFZSA-N |
| Isomeric SMILES | CCC1=C(C=C2CC(CC2=C1)NC[C@@H](C3=C4C=CC(=O)NC4=C(C=C3)O)O)CC |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0182 |
| Substance | Beta stimulants |
| Molecule | Vilanterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C24H33Cl2NO5 |
| InChi Key | DAFYYTQWSAWIGS-DEOSSOPVSA-N |
| Isomeric SMILES | C1=CC(=C(C(=C1)Cl)COCCOCCCCCCNC[C@@H](C2=CC(=C(C=C2)O)CO)O)Cl |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0183 |
| Substance | Beta stimulants |
| Molecule | Hexoprenaline |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C22H32N2O6 |
| InChi Key | OXLZNBCNGJWPRV-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=C(C=C1C(CNCCCCCCNCC(C2=CC(=C(C=C2)O)O)O)O)O)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0185 |
| Substance | Beta stimulants |
| Molecule | Salmeterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C25H37NO4 |
| InChi Key | GIIZNNXWQWCKIB-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C(C=C1)CCCCOCCCCCCNCC(C2=CC(=C(C=C2)O)CO)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0186 |
| Substance | Beta stimulants |
| Molecule | Hydroxymethyl clenbuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H18Cl2N2O2 |
| InChi Key | BWURCANZQUYPLR-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(CO)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0187 |
| Substance | Beta stimulants |
| Molecule | Clenhexerol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C14H22Cl2N2O |
| InChi Key | OIJJTCCRNKYZHW-UHFFFAOYSA-N |
| Isomeric SMILES | CCCCCCNCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0188 |
| Substance | Beta stimulants |
| Molecule | Clenpenterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C13H20Cl2N2O |
| InChi Key | QVBOTMGSBYXVJQ-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0190 |
| Substance | Beta stimulants |
| Molecule | Clenbuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H18Cl2N2O |
| InChi Key | STJMRWALKKWQGH-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0192 |
| Substance | Beta stimulants |
| Molecule | Clenproperol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C11H16Cl2N2O |
| InChi Key | JXUDZCJTCKCTQK-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0194 |
| Substance | Beta stimulants |
| Molecule | Bromoclenbuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H18BrClN2O |
| InChi Key | RBROAKIHDILEQG-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Br)N)Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0195 |
| Substance | Beta stimulants |
| Molecule | Brombuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H18Br2N2O |
| InChi Key | PLFUBWPEUSILSL-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Br)N)Br)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0196 |
| Substance | Beta stimulants |
| Molecule | Mapenterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C14H21Cl2F3N2O |
| InChi Key | LWJSGOMCMMDPEN-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O.Cl |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0197 |
| Substance | Beta stimulants |
| Molecule | Mabuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C13H18ClF3N2O |
| InChi Key | JSJCTEKTBOKRST-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)C(F)(F)F)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0198 |
| Substance | Beta stimulants |
| Molecule | Tulobuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H18ClNO |
| InChi Key | YREYLAVBNPACJM-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC=CC=C1Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0199 |
| Substance | Beta stimulants |
| Molecule | Clorprenaline |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C11H16ClNO |
| InChi Key | SSMSBSWKLKKXGG-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(C1=CC=CC=C1Cl)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0201 |
| Substance | Beta stimulants |
| Molecule | Cimbuterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C13H19N3O |
| InChi Key | YKKQAXQGZIBJFS-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)(C)NCC(C1=CC(=C(C=C1)N)C#N)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0203 |
| Substance | Beta stimulants |
| Molecule | Cimaterol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C12H17N3O |
| InChi Key | BUXRLJCGHZZYNE-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(C1=CC(=C(C=C1)N)C#N)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0204 |
| Substance | Beta stimulants |
| Molecule | Ben |
| Involved Links | Planting/breeding |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0206 |
| Substance | Beta stimulants |
| Molecule | Alprenolol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C15H23NO2 |
| InChi Key | PAZJSJFMUHDSTF-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(COC1=CC=CC=C1CC=C)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0207 |
| Substance | Beta stimulants |
| Molecule | Propranolol（Propanalol） |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C16H21NO2 |
| InChi Key | AQHHHDLHHXJYJD-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(COC1=CC=CC2=CC=CC=C21)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0208 |
| Substance | Beta stimulants |
| Molecule | Penbutolol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C18H29NO2 |
| InChi Key | KQXKVJAGOJTNJS-HNNXBMFYSA-N |
| Isomeric SMILES | CC(C)(C)NC[C@@H](COC1=CC=CC=C1C2CCCC2)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0210 |
| Substance | Beta stimulants |
| Molecule | Pindolol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C14H20N2O2 |
| InChi Key | JZQKKSLKJUAGIC-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(COC1=CC=CC2=C1C=CN2)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0211 |
| Substance | Beta stimulants |
| Molecule | Propafenone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Increase lean meat percentage |
| Formula | C21H27NO3 |
| InChi Key | JWHAUXFOSRPERK-UHFFFAOYSA-N |
| Isomeric SMILES | CCCNCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O |
| Detection Method | Gb-t22286-2008 determination of residues of various beta-agonists in foods of animal origin by liquid chromatography tandem mass spectrometry |
| CFAD ID | C0212 |
| Substance | Zeranol |
| Molecule | Zeranol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H26O5 |
| InChi Key | DWTTZBARDOXEAM-GXTWGEPZSA-N |
| Isomeric SMILES | C[C@H]1CCC[C@@H](CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0347 |
| Substance | Zeranol |
| Molecule | Zearalenol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H24O5 |
| InChi Key | FPQFYIAXQDXNOR-XVNBXDOJSA-N |
| Isomeric SMILES | CC1CCCC(CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0348 |
| Substance | Zeranol |
| Molecule | Beta-zearalenol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H24O5 |
| InChi Key | FPQFYIAXQDXNOR-PMRAARRBSA-N |
| Isomeric SMILES | C[C@H]1CCC[C@H](CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0349 |
| Substance | Zeranol |
| Molecule | Zearalanone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H24O5 |
| InChi Key | APJDQUGPCJRQRJ-LBPRGKRZSA-N |
| Isomeric SMILES | C[C@H]1CCCC(=O)CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1 |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0350 |
| Substance | Zeranol |
| Molecule | Β-zearalanol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H26O5 |
| InChi Key | DWTTZBARDOXEAM-JSGCOSHPSA-N |
| Isomeric SMILES | C[C@H]1CCC[C@H](CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0351 |
| Substance | Zeranol |
| Molecule | Zearalenone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H22O5 |
| InChi Key | MBMQEIFVQACCCH-QBODLPLBSA-N |
| Isomeric SMILES | C[C@H]1CCCC(=O)CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1 |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
Predicted Illegal Additives
| ID | P1549 |
| Name | Salbutamol |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Salbutamon |
| PubChem Link | Link |
| ID | P1550 |
| Name | Terbutaline |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, OpenFoodTox |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1551 |
| Name | Hexoprenaline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1552 |
| Name | Orciprenaline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1553 |
| Name | Isoprenaline |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1554 |
| Name | Arbutamine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1555 |
| Name | Norepinephrine |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1556 |
| Name | Epinephrine |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1557 |
| Name | Isoproterenol |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1558 |
| Name | Epinephrine |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1559 |
| Name | Terbutaline Sulfate |
| Structure | |
| Source | National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1560 |
| Name | Gelatin |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1561 |
| Name | Isoproterenol hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1562 |
| Name | Hexoprenaline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1563 |
| Name | Hexoprenaline sulfate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1564 |
| Name | Dioxethedrin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1565 |
| Name | Orciprenaline sulfate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1566 |
| Name | Terbutaline hemisulfate |
| Structure | |
| Source | National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Colterol |
| PubChem Link | Link |
| ID | P1567 |
| Name | Isoetarine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Isoproterenol |
| PubChem Link | Link |
| ID | P1568 |
| Name | Etilefrine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Isoproterenol |
| PubChem Link | Link |
| ID | P1569 |
| Name | Etilefrine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Isoproterenol |
| PubChem Link | Link |
| ID | P1570 |
| Name | Isoetharine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Isoproterenol |
| PubChem Link | Link |
| ID | P1571 |
| Name | Etilferine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Isoproterenol |
| PubChem Link | Link |
| ID | P1574 |
| Name | Levonordefrin |
| Structure | |
| Source | DrugBank, , ToxCast & Tox21 Chemicals |
| Basis of prediction | Norepinephrine |
| PubChem Link | Link |
| ID | P1575 |
| Name | Methylnoradrenaline |
| Structure | |
| Source | DrugBank, , ToxCast & Tox21 Chemicals |
| Basis of prediction | Norepinephrine |
| PubChem Link | Link |
| ID | P1576 |
| Name | Dopamine |
| Structure | |
| Source | DrugBank, ToxinDB, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Norepinephrine |
| PubChem Link | Link |
| ID | P1578 |
| Name | Octopamine |
| Structure | |
| Source | National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Norepinephrine |
| PubChem Link | Link |
| ID | P1579 |
| Name | Norfenefrine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Norepinephrine |
| PubChem Link | Link |
| ID | P1577 |
| Name | Octopamine |
| Structure | |
| Source | National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Norepinephrine |
| PubChem Link | Link |
| ID | P2465 |
| Name | Adrenone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Epinephrine |
| PubChem Link | Link |
| ID | P2466 |
| Name | Oxilofrin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Epinephrine |
| PubChem Link | Link |
| ID | P1581 |
| Name | Phenylephrine |
| Structure | |
| Source | DrugBank, , National Health Commission of the People's Republic of China |
| Basis of prediction | Terbutaline |
| PubChem Link | Link |
| ID | P1582 |
| Name | Phenylephrine HCl |
| Structure | |
| Source | HPV EPA Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Terbutaline |
| PubChem Link | Link |
| ID | P1583 |
| Name | Etilefrine hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Terbutaline |
| PubChem Link | Link |
| ID | P1580 |
| Name | Phenylephrine |
| Structure | |
| Source | DrugBank, , National Health Commission of the People's Republic of China |
| Basis of prediction | Terbutaline |
| PubChem Link | Link |
| ID | P1584 |
| Name | Fenoterol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Orciprenaline |
| PubChem Link | Link |
| ID | P1585 |
| Name | Fenoterol hydrobromide |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Orciprenaline |
| PubChem Link | Link |
| ID | P0057 |
| Name | Octopamine hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P1765 |
| Name | Synephrine |
| Structure | |
| Source | National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P1766 |
| Name | 4-Hydroxy-alpha-methylbenzyl alcohol |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P1767 |
| Name | P-Synephrine |
| Structure | |
| Source | National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P1768 |
| Name | 2-(4-Hydroxyphenyl)ethylamine |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P1769 |
| Name | Tyramine |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P1770 |
| Name | Phenylethanolamine |
| Structure | |
| Source | National Health Commission of the People's Republic of China, DEA Chemicals |
| Basis of prediction | Octopamine |
| PubChem Link | Link |
| ID | P0058 |
| Name | Fenspiride hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Fenspiride |
| PubChem Link | Link |
| ID | P1774 |
| Name | Theodrenaline |
| Structure | |
| Source | FRCD |
| Basis of prediction | Reproterol |
| PubChem Link | Link |
| ID | P0059 |
| Name | BITOLTEROL MESYLATE |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Bitolterol |
| PubChem Link | Link |
| ID | P0060 |
| Name | Bambuterol hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Bambuterol |
| PubChem Link | Link |
| ID | P0062 |
| Name | Ractopamine Hydrochloride |
| Structure | |
| Source | CAC Veterinary Drug, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ractopamine |
| PubChem Link | Link |
| ID | P1784 |
| Name | Dobutamine |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ractopamine |
| PubChem Link | Link |
| ID | P1785 |
| Name | 1,2-Benzenediol, 4-[2-[[3-(4-hydroxyphenyl)-1-methylpropyl]amino]ethyl]-, hydrochloride |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Ractopamine |
| PubChem Link | Link |
| ID | P0061 |
| Name | Ractopamine hydrochloride |
| Structure | |
| Source | CAC Veterinary Drug, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ractopamine |
| PubChem Link | Link |
| ID | P0118 |
| Name | Ritodrine hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ritodrine |
| PubChem Link | Link |
| ID | P2467 |
| Name | 1-(4-Hydroxyphenyl)-2-methyl-2-methylaminoethanol hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ritodrine |
| PubChem Link | Link |
| ID | P0064 |
| Name | Pirbuterol hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Pirbuterol |
| PubChem Link | Link |
| ID | P0065 |
| Name | Arformoterol Tartrate |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Arformoterol |
| PubChem Link | Link |
| ID | P1786 |
| Name | Dopexamine |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Hexoprenaline |
| PubChem Link | Link |
| ID | P1787 |
| Name | Clenbuterol |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, National Health Commission of the People's Republic of China, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Clenhexerol |
| PubChem Link | Link |
| ID | P1788 |
| Name | Clenbuterol Hydrochloride |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Clenhexerol |
| PubChem Link | Link |
| ID | P1789 |
| Name | Clenproperol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Clenhexerol |
| PubChem Link | Link |
| ID | P1790 |
| Name | Brombuterol |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Bromoclenbuterol |
| PubChem Link | Link |
| ID | P0117 |
| Name | Mabuterol |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Mapenterol |
| PubChem Link | Link |
| ID | P0068 |
| Name | Tulobuterol hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tulobuterol |
| PubChem Link | Link |
| ID | P1816 |
| Name | Clorprenaline |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Tulobuterol |
| PubChem Link | Link |
| ID | P1817 |
| Name | Clorprenaline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tulobuterol |
| PubChem Link | Link |
| ID | P1818 |
| Name | Clorprenaline |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Tulobuterol |
| PubChem Link | Link |
| ID | P1819 |
| Name | Tulobuterol |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Clorprenaline |
| PubChem Link | Link |
| ID | P1820 |
| Name | Cimaterol |
| Structure | |
| Source | National Health Commission of the People's Republic of China, OpenFoodTox, ToxCast & Tox21 Chemicals |
| Basis of prediction | Cimbuterol |
| PubChem Link | Link |
| ID | P1821 |
| Name | Cimbuterol |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Cimaterol |
| PubChem Link | Link |
| ID | P0069 |
| Name | Propranolol hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Propranolol（Propanalol） |
| PubChem Link | Link |
| ID | P1823 |
| Name | Pranolium chloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Propranolol（Propanalol） |
| PubChem Link | Link |
| ID | P1824 |
| Name | Penbutolol sulfate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Penbutolol |
| PubChem Link | Link |
| ID | P1827 |
| Name | (2S)-1-(9H-Carbazol-4-yloxy)-3-(isopropylamino)propan-2-ol |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Pindolol |
| PubChem Link | Link |
| ID | P1828 |
| Name | Carazolol |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Pindolol |
| PubChem Link | Link |
| ID | P1829 |
| Name | Carazolol |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Pindolol |
| PubChem Link | Link |
| ID | P1830 |
| Name | Mepindolol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Pindolol |
| PubChem Link | Link |
| ID | P2235 |
| Name | Zearalenone |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Zearalenol |
| PubChem Link | Link |
| ID | P2236 |
| Name | Cis-Zearalenone |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Zearalenol |
| PubChem Link | Link |
| ID | P2237 |
| Name | (S,E)-Zearalenone |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Zearalenol |
| PubChem Link | Link |
| ID | P2239 |
| Name | Taleranol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2240 |
| Name | Alpha-Zearalanol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2241 |
| Name | Beta-Zearalanol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2238 |
| Name | Zeranol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2243 |
| Name | Alpha-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2244 |
| Name | Beta-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2245 |
| Name | Cis-alpha-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2246 |
| Name | Alpha-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2247 |
| Name | Beta-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |