Pork
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0077 |
| Food Name | Pork |
| Chinese Name | 猪肉 |
| Picture |  |
| Food Group | 肉制品 |
| Food Type | Processed food |
| Update Date | Jul 11, 2019 16:41 |
Illegal Additives
| CFAD ID | C0200 |
| Substance | Nitrofurans |
| Molecule | Furazolidone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C8H7N3O5 |
| InChi Key | PLHJDBGFXBMTGZ-WEVVVXLNSA-N |
| Isomeric SMILES | C1COC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0202 |
| Substance | Nitrofurans |
| Molecule | Furaltadone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C13H16N4O6 |
| InChi Key | YVQVOQKFMFRVGR-VGOFMYFVSA-N |
| Isomeric SMILES | C1COCCN1CC2CN(C(=O)O2)/N=C/C3=CC=C(O3)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0205 |
| Substance | Nitrofurans |
| Molecule | Furacilin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C6H6N4O4 |
| InChi Key | IAIWVQXQOWNYOU-FPYGCLRLSA-N |
| Isomeric SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=N/NC(=O)N |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0209 |
| Substance | Nitrofurans |
| Molecule | Furadantin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C8H6N4O5 |
| InChi Key | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
| Isomeric SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0213 |
| Substance | Antibiotic residue |
| Molecule | Vancomycin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C66H75Cl2N9O24 |
| InChi Key | MYPYJXKWCTUITO-LYRMYLQWSA-N |
| Isomeric SMILES | C[C@H]1[C@H]([C@@](C[C@@H](O1)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC3=C4C=C5C=C3OC6=C(C=C(C=C6)[C@H]([C@H](C(=O)N[C@H](C(=O)N[C@H]5C(=O)N[C@@H]7C8=CC(=C(C=C8)O)C9=C(C=C(C=C9O)O)[C@H](NC(=O)[C@H]([C@@H](C1=CC(=C(O4)C=C1)Cl)O)NC7=O)C(=O)O)CC(=O)N)NC(=O)[C@@H](CC(C)C)NC)O)Cl)CO)O)O)(C)N)O |
| Detection Method |
| CFAD ID | C0214 |
| Substance | Sedative |
| Molecule | Chlorpromazine |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C17H19ClN2S |
| InChi Key | ZPEIMTDSQAKGNT-UHFFFAOYSA-N |
| Isomeric SMILES | CN(C)CCCN1C2=CC=CC=C2SC3=C1C=C(C=C3)Cl |
| Detection Method | GB/T 20763-2006 liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0286 |
| Substance | Sedative |
| Molecule | Acepromazine |
| Involved Links | Planting/breeding, Transportation |
| Detection Method | Reference was made to GB/T 20763-2006 for the determination of acetylpromazine, chlorpromazine, haloperidol, propionyl dimethylaminophenthiazine, tolumethiazine, azapirine and carbazolone residues in kidney and muscle tissues of pigs |
| CFAD ID | C0287 |
| Substance | Sedative |
| Molecule | Haloperidol |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C21H23ClFNO2 |
| InChi Key | LNEPOXFFQSENCJ-UHFFFAOYSA-N |
| Isomeric SMILES | C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(=O)C3=CC=C(C=C3)F |
| Detection Method | Reference was made to GB/T 20763-2006 for the determination of acetylpromazine, chlorpromazine, haloperidol, propionyl dimethylaminophenthiazine, tolumethiazine, azapirine and carbazolone residues in kidney and muscle tissues of pigs |
| CFAD ID | C0288 |
| Substance | Sedative |
| Molecule | Propionylpromazine |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C20H24N2OS |
| InChi Key | ZQTVCQIJTREKSP-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C |
| Detection Method | Reference was made to GB/T 20763-2006 for the determination of acetylpromazine, chlorpromazine, haloperidol, propionyl dimethylaminophenthiazine, tolumethiazine, azapirine and carbazolone residues in kidney and muscle tissues of pigs |
| CFAD ID | C0289 |
| Substance | Sedative |
| Molecule | Xylazine |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C12H16N2S |
| InChi Key | BPICBUSOMSTKRF-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(C(=CC=C1)C)NC2=NCCCS2 |
| Detection Method | Reference was made to GB/T 20763-2006 for the determination of acetylpromazine, chlorpromazine, haloperidol, propionyl dimethylaminophenthiazine, tolumethiazine, azapirine and carbazolone residues in kidney and muscle tissues of pigs |
| CFAD ID | C0290 |
| Substance | Sedative |
| Molecule | - |
| Involved Links | Planting/breeding, Transportation |
| Detection Method | Reference was made to GB/T 20763-2006 for the determination of acetylpromazine, chlorpromazine, haloperidol, propionyl dimethylaminophenthiazine, tolumethiazine, azapirine and carbazolone residues in kidney and muscle tissues of pigs |
| CFAD ID | C0291 |
| Substance | Sedative |
| Molecule | Carazolol |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C18H22N2O2 |
| InChi Key | BQXQGZPYHWWCEB-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(COC1=CC=CC2=C1C3=CC=CC=C3N2)O |
| Detection Method | Reference was made to GB/T 20763-2006 for the determination of acetylpromazine, chlorpromazine, haloperidol, propionyl dimethylaminophenthiazine, tolumethiazine, azapirine and carbazolone residues in kidney and muscle tissues of pigs |
| CFAD ID | C0352 |
| Substance | Sedative |
| Molecule | Acepromazine |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C19H22N2OS |
| InChi Key | NOSIYYJFMPDDSA-UHFFFAOYSA-N |
| Isomeric SMILES | CC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C |
| Detection Method | GB/T 20763-2006 liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0353 |
| Substance | Sedative |
| Molecule | Haloperidol |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C21H23ClFNO2 |
| InChi Key | LNEPOXFFQSENCJ-UHFFFAOYSA-N |
| Isomeric SMILES | C1CN(CCC1(C2=CC=C(C=C2)Cl)O)CCCC(=O)C3=CC=C(C=C3)F |
| Detection Method | GB/T 20763-2006 liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0354 |
| Substance | Sedative |
| Molecule | Propionylpromazine |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C20H24N2OS |
| InChi Key | ZQTVCQIJTREKSP-UHFFFAOYSA-N |
| Isomeric SMILES | CCC(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2CCCN(C)C |
| Detection Method | GB/T 20763-2006 Liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0355 |
| Substance | Sedative |
| Molecule | Xylazine |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C12H16N2S |
| InChi Key | BPICBUSOMSTKRF-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(C(=CC=C1)C)NC2=NCCCS2 |
| Detection Method | GB/T 20763-2006 Liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0356 |
| Substance | Sedative |
| Molecule | Azaperone |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C19H22FN3O |
| InChi Key | XTKDAFGWCDAMPY-UHFFFAOYSA-N |
| Isomeric SMILES | C1CN(CCN1CCCC(=O)C2=CC=C(C=C2)F)C3=CC=CC=N3 |
| Detection Method | GB/T 20763-2006 Liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0357 |
| Substance | Sedative |
| Molecule | Azaperol |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C19H24FN3O |
| InChi Key | LVXYAFNPMXCRJI-UHFFFAOYSA-N |
| Isomeric SMILES | C1CN(CCN1CCCC(C2=CC=C(C=C2)F)O)C3=CC=CC=N3 |
| Detection Method | GB/T 20763-2006 Liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0358 |
| Substance | Sedative |
| Molecule | Carazolol |
| Involved Links | Planting/breeding, Transportation |
| Structure | |
| Purpose of Addition | Calm, hypnosis, reduce energy consumption |
| Formula | C18H22N2O2 |
| InChi Key | BQXQGZPYHWWCEB-UHFFFAOYSA-N |
| Isomeric SMILES | CC(C)NCC(COC1=CC=CC2=C1C3=CC=CC=C3N2)O |
| Detection Method | GB/T 20763-2006 Liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0406 |
| Substance | Pork meat |
| Molecule | - |
| Involved Links | Processing |
| Detection Method | 多重PCR |
Predicted Illegal Additives
| ID | P0070 |
| Name | Furaltadone hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Furaltadone |
| PubChem Link | Link |
| ID | P1822 |
| Name | Nihydrazone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Furacilin |
| PubChem Link | Link |
| ID | P1825 |
| Name | 1-[(5-Nitrofurfurylidene)amino]-2-imidazolidinone |
| Structure | |
| Source | IARC Carcinogens Group 2B |
| Basis of prediction | Furadantin |
| PubChem Link | Link |
| ID | P1826 |
| Name | Nifurtoinol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Furadantin |
| PubChem Link | Link |
| ID | P0074 |
| Name | Balhimycin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P0073 |
| Name | 4-Epi-Vancosaminyl Derivative of Vancomycin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P0075 |
| Name | Nuvocid |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P0071 |
| Name | Desvancosaminyl Vancomycin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P0072 |
| Name | Oritavancin |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P1833 |
| Name | Deglucobalhimycin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P1834 |
| Name | Telavancin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P1835 |
| Name | Telavancin |
| Structure | |
| Source | National Health Commission of the People's Republic of China |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P1836 |
| Name | Teicoplanin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P1832 |
| Name | Dalbavancin |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China |
| Basis of prediction | Vancomycin |
| PubChem Link | Link |
| ID | P0076 |
| Name | Chlorofenethazine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P0077 |
| Name | Chlorproethazine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1837 |
| Name | Perphenazine |
| Structure | |
| Source | DrugBank, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1839 |
| Name | Prochlorperazine |
| Structure | |
| Source | DrugBank, , T3DB |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1840 |
| Name | Prochlorperazine dimaleate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1841 |
| Name | Promazine hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1842 |
| Name | Thiopropazate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1843 |
| Name | Alimemazine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1844 |
| Name | Trimeprazine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1845 |
| Name | Chloracizine |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1846 |
| Name | Chlorpromazine, sulphoxide |
| Structure | |
| Source | FRCD |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P1838 |
| Name | Promazine |
| Structure | |
| Source | DrugBank, HPV EPA Chemicals, T3DB |
| Basis of prediction | Chlorpromazine |
| PubChem Link | Link |
| ID | P2106 |
| Name | Pindolol |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Carazolol |
| PubChem Link | Link |
| ID | P2107 |
| Name | Carvedilol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Carazolol |
| PubChem Link | Link |
| ID | P2108 |
| Name | 9H-Carbazole, 4-(2-oxiranylmethoxy)- |
| Structure | |
| Source | FRCD |
| Basis of prediction | Carazolol |
| PubChem Link | Link |
| ID | P0098 |
| Name | Propionylpromazine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Acepromazine |
| PubChem Link | Link |
| ID | P0089 |
| Name | Bromperidol |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Haloperidol |
| PubChem Link | Link |
| ID | P0090 |
| Name | Moperone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Haloperidol |
| PubChem Link | Link |
| ID | P0091 |
| Name | Acepromazine |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P0092 |
| Name | Acetylpromazine |
| Structure | |
| Source | DrugBank, National Health Commission of the People's Republic of China |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2096 |
| Name | Aceprometazine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2097 |
| Name | Acetophenazine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2098 |
| Name | Propiomazine |
| Structure | |
| Source | DrugBank, T3DB |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2099 |
| Name | Carphenazine |
| Structure | |
| Source | DrugBank, T3DB |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2100 |
| Name | Piperacetazine |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2101 |
| Name | Acetophenazine dimaleate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2102 |
| Name | Ethymemazine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2103 |
| Name | Acetopromazine maleate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2104 |
| Name | Butaperazine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2105 |
| Name | Carphenazine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Propionylpromazine |
| PubChem Link | Link |
| ID | P2242 |
| Name | Azaperone |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Azaperol |
| PubChem Link | Link |