Poultry meat
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0078 |
| Food Name | Poultry meat |
| Chinese Name | 禽肉 |
| Picture |  |
| Food Group | 肉制品 |
| Food Type | Processed food |
| Update Date | Jul 11, 2019 16:42 |
Illegal Additives
| CFAD ID | C0200 |
| Substance | Nitrofurans |
| Molecule | Furazolidone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C8H7N3O5 |
| InChi Key | PLHJDBGFXBMTGZ-WEVVVXLNSA-N |
| Isomeric SMILES | C1COC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0202 |
| Substance | Nitrofurans |
| Molecule | Furaltadone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C13H16N4O6 |
| InChi Key | YVQVOQKFMFRVGR-VGOFMYFVSA-N |
| Isomeric SMILES | C1COCCN1CC2CN(C(=O)O2)/N=C/C3=CC=C(O3)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0205 |
| Substance | Nitrofurans |
| Molecule | Furacilin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C6H6N4O4 |
| InChi Key | IAIWVQXQOWNYOU-FPYGCLRLSA-N |
| Isomeric SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=N/NC(=O)N |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0209 |
| Substance | Nitrofurans |
| Molecule | Furadantin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C8H6N4O5 |
| InChi Key | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
| Isomeric SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0365 |
| Substance | Mutton |
| Molecule | Chicken or duck meat |
| Involved Links | Processing |
| Detection Method | a visual lateral flow dipstick (LFD) method in combination with recombinase polymerase amplification (RPA) |
Predicted Illegal Additives
| ID | P0070 |
| Name | Furaltadone hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Furaltadone |
| PubChem Link | Link |
| ID | P1822 |
| Name | Nihydrazone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Furacilin |
| PubChem Link | Link |
| ID | P1825 |
| Name | 1-[(5-Nitrofurfurylidene)amino]-2-imidazolidinone |
| Structure | |
| Source | IARC Carcinogens Group 2B |
| Basis of prediction | Furadantin |
| PubChem Link | Link |
| ID | P1826 |
| Name | Nifurtoinol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Furadantin |
| PubChem Link | Link |