Animal fishery products
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0079 |
| Food Name | Animal fishery products |
| Chinese Name | 动物性水产品 |
| Picture |  |
| Food Group | 水产品,肉制品 |
| Food Type | Processed food |
| Update Date | Jul 16, 2019 17:09 |
Illegal Additives
| CFAD ID | C0200 |
| Substance | Nitrofurans |
| Molecule | Furazolidone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C8H7N3O5 |
| InChi Key | PLHJDBGFXBMTGZ-WEVVVXLNSA-N |
| Isomeric SMILES | C1COC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0202 |
| Substance | Nitrofurans |
| Molecule | Furaltadone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C13H16N4O6 |
| InChi Key | YVQVOQKFMFRVGR-VGOFMYFVSA-N |
| Isomeric SMILES | C1COCCN1CC2CN(C(=O)O2)/N=C/C3=CC=C(O3)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0205 |
| Substance | Nitrofurans |
| Molecule | Furacilin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C6H6N4O4 |
| InChi Key | IAIWVQXQOWNYOU-FPYGCLRLSA-N |
| Isomeric SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=N/NC(=O)N |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0209 |
| Substance | Nitrofurans |
| Molecule | Furadantin |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Anti-infective |
| Formula | C8H6N4O5 |
| InChi Key | NXFQHRVNIOXGAQ-YCRREMRBSA-N |
| Isomeric SMILES | C1C(=O)NC(=O)N1/N=C/C2=CC=C(O2)[N+](=O)[O-] |
| Detection Method | GB/T 21311-2007 Determination of nitrofuran metabolites residues in foods of animal origin by high performance liquid chromatography-tandem mass spectrometry |
| CFAD ID | C0310 |
| Substance | Sulfonamides |
| Molecule | Sulfamethizole |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C9H10N4O2S2 |
| InChi Key | VACCAVUAMIDAGB-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=NN=C(S1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0311 |
| Substance | Sulfonamides |
| Molecule | Sulfadiacetate |
| Involved Links | Dining |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0312 |
| Substance | Sulfonamides |
| Molecule | Sulfadiazine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C10H10N4O2S |
| InChi Key | SEEPANYCNGTZFQ-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0313 |
| Substance | Sulfonamides |
| Molecule | Sulfapyridine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H11N3O2S |
| InChi Key | GECHUMIMRBOMGK-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0314 |
| Substance | Sulfonamides |
| Molecule | Sulfisoxazole |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H13N3O3S |
| InChi Key | NHUHCSRWZMLRLA-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0315 |
| Substance | Sulfonamides |
| Molecule | Sulfamerazine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12N4O2S |
| InChi Key | QPPBRPIAZZHUNT-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=NC(=NC=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0316 |
| Substance | Sulfonamides |
| Molecule | Sulfachloropyridazine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C10H9ClN4O2S |
| InChi Key | XOXHILFPRYWFOD-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NN=C(C=C2)Cl |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0317 |
| Substance | Sulfonamides |
| Molecule | Sulfamonomethoxine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12N4O3S |
| InChi Key | WMPXPUYPYQKQCX-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=NC=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0318 |
| Substance | Sulfonamides |
| Molecule | Sulfadimoxine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H14N4O4S |
| InChi Key | PJSFRIWCGOHTNF-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=C(N=CN=C1OC)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0319 |
| Substance | Sulfonamides |
| Molecule | Sulfisoxazole |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H13N3O3S |
| InChi Key | NHUHCSRWZMLRLA-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=C(ON=C1C)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0320 |
| Substance | Sulfonamides |
| Molecule | Sulfathiazole |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C9H9N3O2S2 |
| InChi Key | JNMRHUJNCSQMMB-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=CS2 |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0321 |
| Substance | Sulfonamides |
| Molecule | Sulfamethoxypyridazine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12N4O3S |
| InChi Key | VLYWMPOKSSWJAL-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=NN=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0322 |
| Substance | Sulfonamides |
| Molecule | Sulfadimethoxypyrimidine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H14N4O4S |
| InChi Key | RMSFTZDTJHYIFE-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=CC(=NC(=N1)NS(=O)(=O)C2=CC=C(C=C2)N)OC |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0323 |
| Substance | Sulfonamides |
| Molecule | Sulfameter |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12N4O3S |
| InChi Key | GPTONYMQFTZPKC-UHFFFAOYSA-N |
| Isomeric SMILES | COC1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0324 |
| Substance | Sulfonamides |
| Molecule | Sulfamethazine |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H14N4O2S |
| InChi Key | ASWVTGNCAZCNNR-UHFFFAOYSA-N |
| Isomeric SMILES | CC1=CC(=NC(=N1)NS(=O)(=O)C2=CC=C(C=C2)N)C |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0325 |
| Substance | Sulfonamides |
| Molecule | Sulfaphenazole |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C15H14N4O2S |
| InChi Key | QWCJHSGMANYXCW-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C(C=C1)N2C(=CC=N2)NS(=O)(=O)C3=CC=C(C=C3)N |
| Detection Method | GBT21316-2007 Determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
Predicted Illegal Additives
| ID | P0070 |
| Name | Furaltadone hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Furaltadone |
| PubChem Link | Link |
| ID | P1822 |
| Name | Nihydrazone |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Furacilin |
| PubChem Link | Link |
| ID | P1825 |
| Name | 1-[(5-Nitrofurfurylidene)amino]-2-imidazolidinone |
| Structure | |
| Source | IARC Carcinogens Group 2B |
| Basis of prediction | Furadantin |
| PubChem Link | Link |
| ID | P1826 |
| Name | Nifurtoinol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Furadantin |
| PubChem Link | Link |
| ID | P2134 |
| Name | Sulfaethidole |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfamethizole |
| PubChem Link | Link |
| ID | P2138 |
| Name | N4-Acetylsulfadiazin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfadiazine |
| PubChem Link | Link |
| ID | P2135 |
| Name | Sulfameter |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfadiazine |
| PubChem Link | Link |
| ID | P2136 |
| Name | Sulfamethazine |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Sulfadiazine |
| PubChem Link | Link |
| ID | P2137 |
| Name | Sulfadimidine |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Sulfadiazine |
| PubChem Link | Link |
| ID | P2139 |
| Name | N-Acetylsulfapyridin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfapyridine |
| PubChem Link | Link |
| ID | P2141 |
| Name | Sulfamethoxypyridazine |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfachloropyridazine |
| PubChem Link | Link |
| ID | P2142 |
| Name | Sulfadimethoxine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfamonomethoxine |
| PubChem Link | Link |
| ID | P2143 |
| Name | Sulfamethomidine |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfamonomethoxine |
| PubChem Link | Link |
| ID | P2144 |
| Name | Sulfadoxine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfamonomethoxine |
| PubChem Link | Link |
| ID | P2145 |
| Name | Sulfamonomethoxine |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfadimoxine |
| PubChem Link | Link |
| ID | P2140 |
| Name | Sulfisoxazole acetal |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfisoxazole |
| PubChem Link | Link |
| ID | P2146 |
| Name | N4-Acetyl-Sulfathiazol |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfathiazole |
| PubChem Link | Link |
| ID | P2147 |
| Name | Sulfathiazole sodium |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfathiazole |
| PubChem Link | Link |
| ID | P0093 |
| Name | Sulfaethoxypyridazine |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Sulfamethoxypyridazine |
| PubChem Link | Link |
| ID | P2148 |
| Name | Sulfachlorpyridazine |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfamethoxypyridazine |
| PubChem Link | Link |
| ID | P2149 |
| Name | Sulfachloropyridazine |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Sulfamethoxypyridazine |
| PubChem Link | Link |
| ID | P2150 |
| Name | N4-Acetyl-Sulfadimethoxin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfadimethoxypyrimidine |
| PubChem Link | Link |
| ID | P2151 |
| Name | Glycodiazine |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Sulfameter |
| PubChem Link | Link |
| ID | P2152 |
| Name | Sulfapyrazole |
| Structure | |
| Source | FRCD |
| Basis of prediction | Sulfaphenazole |
| PubChem Link | Link |
| ID | P2153 |
| Name | 4-METHYL-N-METHYL-N-(2-PHENYL-2H-PYRAZOL-3-YL)BENZENESULFONAMIDE |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Sulfaphenazole |
| PubChem Link | Link |