Milk
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0080 |
| Food Name | Milk |
| Chinese Name | 牛奶 |
| Picture |  |
| Food Group | 乳与乳制品 |
| Food Type | Non-processed food |
| Update Date | Jul 11, 2019 16:50 |
Illegal Additives
| CFAD ID | C0212 |
| Substance | Zeranol |
| Molecule | Zeranol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H26O5 |
| InChi Key | DWTTZBARDOXEAM-GXTWGEPZSA-N |
| Isomeric SMILES | C[C@H]1CCC[C@@H](CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0347 |
| Substance | Zeranol |
| Molecule | Zearalenol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H24O5 |
| InChi Key | FPQFYIAXQDXNOR-XVNBXDOJSA-N |
| Isomeric SMILES | CC1CCCC(CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0348 |
| Substance | Zeranol |
| Molecule | Beta-zearalenol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H24O5 |
| InChi Key | FPQFYIAXQDXNOR-PMRAARRBSA-N |
| Isomeric SMILES | C[C@H]1CCC[C@H](CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0349 |
| Substance | Zeranol |
| Molecule | Zearalanone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H24O5 |
| InChi Key | APJDQUGPCJRQRJ-LBPRGKRZSA-N |
| Isomeric SMILES | C[C@H]1CCCC(=O)CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1 |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0350 |
| Substance | Zeranol |
| Molecule | Β-zearalanol |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H26O5 |
| InChi Key | DWTTZBARDOXEAM-JSGCOSHPSA-N |
| Isomeric SMILES | C[C@H]1CCC[C@H](CCCCCC2=C(C(=CC(=C2)O)O)C(=O)O1)O |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0351 |
| Substance | Zeranol |
| Molecule | Zearalenone |
| Involved Links | Planting/breeding |
| Structure | |
| Purpose of Addition | Growth-promoting |
| Formula | C18H22O5 |
| InChi Key | MBMQEIFVQACCCH-QBODLPLBSA-N |
| Isomeric SMILES | C[C@H]1CCCC(=O)CCC/C=C/C2=C(C(=CC(=C2)O)O)C(=O)O1 |
| Detection Method | GB/T 21982-2008 Determination of residues of corn gibberellin, beta-corn gibberellin, alpha-corn gibberellinol, beta-corn gibberellinol, corn gibberellinone and gibberellinone in animal food, liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0431 |
| Substance | Nitrate |
| Molecule | Nitrate |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Increase weight or volume |
| Formula | NO3- |
| InChi Key | NHNBFGGVMKEFGY-UHFFFAOYSA-N |
| Isomeric SMILES | [N+](=O)([O-])[O-] |
| Detection Method |
Predicted Illegal Additives
| ID | P2235 |
| Name | Zearalenone |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Zearalenol |
| PubChem Link | Link |
| ID | P2236 |
| Name | Cis-Zearalenone |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Zearalenol |
| PubChem Link | Link |
| ID | P2237 |
| Name | (S,E)-Zearalenone |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, CAC Veterinary Drug, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | Zearalenol |
| PubChem Link | Link |
| ID | P2239 |
| Name | Taleranol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2240 |
| Name | Alpha-Zearalanol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2241 |
| Name | Beta-Zearalanol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2238 |
| Name | Zeranol |
| Structure | |
| Source | OpenFoodTox, ToxCast & Tox21 Chemicals, National Health Commission of the People's Republic of China, ToxinDB, CAC Veterinary Drug, T3DB |
| Basis of prediction | Zearalanone |
| PubChem Link | Link |
| ID | P2243 |
| Name | Alpha-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2244 |
| Name | Beta-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2245 |
| Name | Cis-alpha-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2246 |
| Name | Alpha-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |
| ID | P2247 |
| Name | Beta-Zearalenol |
| Structure | |
| Source | ToxinDB, T3DB, OpenFoodTox |
| Basis of prediction | Zearalenone |
| PubChem Link | Link |