Agaricus bisporus
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0083 |
| Food Name | Agaricus bisporus |
| Chinese Name | 双孢蘑菇 |
| Picture | ![]() |
| Food Group | 菌制品 |
| Food Type | Non-processed food |
| Update Date | Jul 12, 2019 10:03 |
Illegal Additives
| CFAD ID | C0218 |
| Substance | Fluorescent whitening substance |
| Molecule | VBL |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C36H34N12Na2O8S2 |
| InChi Key | HIMNALZNLAOESZ-YHPRVSEPSA-L |
| Isomeric SMILES | C1=CC=C(C=C1)N=C2NC(=NCCO)NC(=NC3=CC(=C(C=C3)/C=C/C4=C(C=C(C=C4)N=C5NC(=NCCO)NC(=NC6=CC=CC=C6)N5)S(=O)(=O)[O-])S(=O)(=O)[O-])N2.[Na+].[Na+] |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
| CFAD ID | C0219 |
| Substance | Fluorescent whitening substance |
| Molecule | Fluorescent Brightener 85 |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C36H34N12Na2O8S2 |
| InChi Key | HIMNALZNLAOESZ-YHPRVSEPSA-L |
| Isomeric SMILES | C1=CC=C(C=C1)NC2=NC(=NC(=N2)NCCO)NC3=CC(=C(C=C3)/C=C/C4=C(C=C(C=C4)NC5=NC(=NC(=N5)NC6=CC=CC=C6)NCCO)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
| CFAD ID | C0220 |
| Substance | Fluorescent whitening substance |
| Molecule | 7-Aminocoumarin |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C9H7NO2 |
| InChi Key | RRHXPUCIXLAHIY-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC2=C1C=CC(=O)O2)N |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
| CFAD ID | C0222 |
| Substance | Fluorescent whitening substance |
| Molecule | 3-phenyl-7-aminocoumarin |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C15H11NO2 |
| InChi Key | IJCLOOKYCQWSJA-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C(C=C3)N)OC2=O |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
| CFAD ID | C0223 |
| Substance | Fluorescent whitening substance |
| Molecule | 1, 3-diphenyl-2-pyrazoline |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C15H14N2 |
| InChi Key | ZWCZPVMIHLKVLD-UHFFFAOYSA-N |
| Isomeric SMILES | C1CN(N=C1C2=CC=CC=C2)C3=CC=CC=C3 |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
| CFAD ID | C0226 |
| Substance | Fluorescent whitening substance |
| Molecule | DCB |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C84H110O6 |
| InChi Key | NYLSTTOOESZEJH-NZTQFBENSA-N |
| Isomeric SMILES | CCCCCC[C@H](C)OC1=CC=C(C=C1)C2=CC=C(C=C2)OCCCCCCCCCCCCOC3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)OCCCCCCCCCCCCOC7=CC=C(C=C7)C8=CC=C(C=C8)O[C@@H](C)CCCCCC |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
| CFAD ID | C0227 |
| Substance | Fluorescent whitening substance |
| Molecule | Naphthalimide |
| Involved Links | Processing, Circulation |
| Structure | |
| Purpose of Addition | Improve color |
| Formula | C12H7NO2 |
| InChi Key | XJHABGPPCLHLLV-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC2=C3C(=C1)C(=O)NC(=O)C3=CC=C2 |
| Detection Method | Mushroom samples can be qualitatively detected by irradiation |
Predicted Illegal Additives
| ID | P1875 |
| Name | Phorwhite Rkh |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1876 |
| Name | Cellufluor |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1877 |
| Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, disodium salt |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1879 |
| Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[1,6-dihydro-6-oxo-4-(phenylamino)-1,3,5-triazin-2-yl]amino]-, sodium salt (1:2) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1880 |
| Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino]- |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1881 |
| Name | 4,4'-bis[[6-anilino-4-[(2-hydroxyethyl)methylamino]-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulfonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1882 |
| Name | 4,4'-bis[[4-[(2-hydroxyethyl)amino]-6-(m-sulfoanilino)-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulfonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1883 |
| Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxypropyl)amino]-6-[(4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-, tetrasodium salt |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1884 |
| Name | Tinopal 5Bm |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1885 |
| Name | 4,4'-bis[[4-anilino-6-[(2-carbamoylethyl)(2-hydroxyethyl)amino]-1,3,5,-triazin-2-yl]amino]stilbene-2,2'-disulfonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1886 |
| Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-(phenylamino)-1,3,5-triazin-2-yl]amino]-, potassium sodium salt |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1887 |
| Name | 4,4'-bis[[4-morpholino-6-(p-sulfoanilino)-1,3,5-triazin-2-yl]amino]stilbene-2,2'-disulfonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1888 |
| Name | Sodium;2-[[4-[4-[(E)-2-[4-[[4-[bis(carboxylatomethyl)amino]-6-(4-sulfonatoanilino)-1,3,5-triazin-2-yl]amino]-2-sulfonatophenyl]ethenyl]-3-sulfonatoanilino]-6-(4-sulfonatoanilino)-1,3,5-triazin-2-yl]-(carboxylatomethyl)amino]acetate |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1878 |
| Name | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-[[4-[bis(2-hydroxyethyl)amino]-6-[(4-sulfophenyl)amino]-1,3,5-triazin-2-yl]amino]-, tetrasodium salt |
| Structure | |
| Source | HPV EPA Chemicals, OECD HPV Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Fluorescent Brightener 85 |
| PubChem Link | Link |
| ID | P1889 |
| Name | Coumarin |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | 7-Aminocoumarin |
| PubChem Link | Link |
| ID | P1891 |
| Name | 7-AMINO-4-METHYL-CHROMEN-2-ONE |
| Structure | |
| Source | DrugBank |
| Basis of prediction | 7-Aminocoumarin |
| PubChem Link | Link |
| ID | P1890 |
| Name | 2H-1-BENZOPYRAN-2-ONE |
| Structure | |
| Source | ToxCast & Tox21 Chemicals, OpenFoodTox, DrugBank, HPV EPA Chemicals, ToxinDB, T3DB, IARC Carcinogens Group 3 |
| Basis of prediction | 7-Aminocoumarin |
| PubChem Link | Link |
| ID | P1892 |
| Name | 6-AMINO-BENZO[DE]ISOQUINOLINE-1,3-DIONE |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Naphthalimide |
| PubChem Link | Link |
