Spicy Hot Pot
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0087 |
| Food Name | Spicy Hot Pot |
| Chinese Name | 麻辣烫类食品 |
| Picture |  |
| Food Group | 麻辣烫 |
| Food Type | Processed food |
| Update Date | Jul 12, 2019 10:09 |
Illegal Additives
| CFAD ID | C0221 |
| Substance | Quinolones |
| Molecule | Quinolones |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C67H42N2O |
| InChi Key | AOZUKDUONYORES-UHFFFAOYSA-N |
| Isomeric SMILES | CC1(C2=CC=CC=C2C3=C1C=C4C(=C3)C5=C(N4C6=CC=CC(=C6)C7=C8C=CC=C9C8=C(C=C7)C1=CC=CC=C19)C=CC(=C5)C1=CC2=C(C=C1)OC1=C2C=C2C3=CC=CC=C3N(C2=C1)C1=CC=CC=C1)C |
| Detection Method | Method for determination of 14 quinolones residues in food of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0274 |
| Substance | Quinolones |
| Molecule | Ofloxacin |
| Involved Links | Processing, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C18H20FN3O4 |
| InChi Key | GSDSWSVVBLHKDQ-UHFFFAOYSA-N |
| Isomeric SMILES | CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)O |
| Detection Method | GB 21312-2007 Determination of 14 quinolones residues in foods of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0275 |
| Substance | Quinolones |
| Molecule | Perfloxacin |
| Involved Links | Processing, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C17H20FN3O3 |
| InChi Key | FHFYDNQZQSQIAI-UHFFFAOYSA-N |
| Isomeric SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O |
| Detection Method | GB 21312-2007 Determination of 14 quinolones residues in foods of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0276 |
| Substance | Quinolones |
| Molecule | Nalidixic acid |
| Involved Links | Dining |
| Detection Method | GB 21312-2007 Method for determination of 14 quinolones residues in food of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0277 |
| Substance | Quinolones |
| Molecule | Enoxacin |
| Involved Links | Processing, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C18H20FN3O4 |
| InChi Key | GSDSWSVVBLHKDQ-UHFFFAOYSA-N |
| Isomeric SMILES | CC1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CCN(CC4)C)F)C(=O)O |
| Detection Method | GB 21312-2007 Determination of 14 quinolones residues in foods of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0279 |
| Substance | Quinolones |
| Molecule | Piromidic acid |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C14H16N4O3 |
| InChi Key | RCIMBBZXSXFZBV-UHFFFAOYSA-N |
| Isomeric SMILES | CCN1C=C(C(=O)C2=CN=C(N=C21)N3CCCC3)C(=O)O |
| Detection Method | GB 21312-2007 Method for determination of 14 quinolones residues in food of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0280 |
| Substance | Quinolones |
| Molecule | Ciprofloxacin |
| Involved Links | Processing, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C17H18FN3O3 |
| InChi Key | MYSWGUAQZAJSOK-UHFFFAOYSA-N |
| Isomeric SMILES | C1CC1N2C=C(C(=O)C3=CC(=C(C=C32)N4CCNCC4)F)C(=O)O |
| Detection Method | GB 21312-2007 Determination of 14 quinolones residues in foods of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0281 |
| Substance | Quinolones |
| Molecule | Cinoxacin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H10N2O5 |
| InChi Key | VDUWPHTZYNWKRN-UHFFFAOYSA-N |
| Isomeric SMILES | CCN1C2=CC3=C(C=C2C(=O)C(=N1)C(=O)O)OCO3 |
| Detection Method | GB 21312-2007 Method for determination of 14 quinolones residues in food of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0282 |
| Substance | Quinolones |
| Molecule | Gatifloxacin |
| Involved Links | Processing, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C19H22FN3O4 |
| InChi Key | XUBOMFCQGDBHNK-UHFFFAOYSA-N |
| Isomeric SMILES | CC1CN(CCN1)C2=C(C=C3C(=C2OC)N(C=C(C3=O)C(=O)O)C4CC4)F |
| Detection Method | GB 21312-2007 Determination of 14 quinolones residues in foods of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0283 |
| Substance | Quinolones |
| Molecule | Miloxacin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H9NO6 |
| InChi Key | ABQYZRZVRIPTPI-UHFFFAOYSA-N |
| Isomeric SMILES | CON1C=C(C(=O)C2=CC3=C(C=C21)OCO3)C(=O)O |
| Detection Method | GB 21312-2007 Liquid chromatography-mass spectrometry/mass spectrometry method for determination of 14 quinolones residues in food of animal origin |
| CFAD ID | C0284 |
| Substance | Quinolones |
| Molecule | Moxifloxacin |
| Involved Links | Processing, Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C21H24FN3O4 |
| InChi Key | FABPRXSRWADJSP-MEDUHNTESA-N |
| Isomeric SMILES | COC1=C2C(=CC(=C1N3C[C@@H]4CCCN[C@@H]4C3)F)C(=O)C(=CN2C5CC5)C(=O)O |
| Detection Method | GB 21312-2007 Determination of 14 quinolones residues in foods of animal origin by liquid chromatography-mass spectrometry/mass spectrometry |
| CFAD ID | C0285 |
| Substance | Quinolones |
| Molecule | Norfloxacin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C16H18FN3O3 |
| InChi Key | OGJPXUAPXNRGGI-UHFFFAOYSA-N |
| Isomeric SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCNCC3)F)C(=O)O |
| Detection Method | GB 21312-2007 动物源性食品中14种喹诺酮药物残留检测方法，液相色谱-质谱/质谱法Liquid chromatography-mass spectrometry/mass spectrometry method for determination of 14 quinolones residues in food of animal origin |
Predicted Illegal Additives
| ID | P0085 |
| Name | Pefloxacin mesylate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2069 |
| Name | 99mTc-ciprofloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2070 |
| Name | Lomefloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2071 |
| Name | Ciprofloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2072 |
| Name | Norfloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2073 |
| Name | Ciprofloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2074 |
| Name | Lomefloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2075 |
| Name | Fleroxacin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2076 |
| Name | Enrofloxacin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2077 |
| Name | Lomefloxacin hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2078 |
| Name | Fleroxacin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2079 |
| Name | Ciprofloxacin hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Perfloxacin |
| PubChem Link | Link |
| ID | P2080 |
| Name | Moxifloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Enoxacin |
| PubChem Link | Link |
| ID | P2081 |
| Name | Gatifloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Enoxacin |
| PubChem Link | Link |
| ID | P2082 |
| Name | Moxifloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Enoxacin |
| PubChem Link | Link |
| ID | P2083 |
| Name | Moxifloxacin hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Enoxacin |
| PubChem Link | Link |
| ID | P2084 |
| Name | Balofloxacin |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Enoxacin |
| PubChem Link | Link |
| ID | P2085 |
| Name | Pefloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2086 |
| Name | Danofloxacin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2087 |
| Name | Grepafloxacin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2088 |
| Name | Sparfloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2089 |
| Name | Sparfloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2090 |
| Name | Orbifloxacin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2091 |
| Name | Grepafloxacin hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ciprofloxacin |
| PubChem Link | Link |
| ID | P2093 |
| Name | Ofloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Gatifloxacin |
| PubChem Link | Link |
| ID | P2094 |
| Name | Levofloxacin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Gatifloxacin |
| PubChem Link | Link |
| ID | P2092 |
| Name | Dextrofloxacine |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, T3DB, ToxCast & Tox21 Chemicals |
| Basis of prediction | Gatifloxacin |
| PubChem Link | Link |
| ID | P0088 |
| Name | 3-Quinolinecarboxylic acid, 1-cyclopropyl-6,8-difluoro-1,4-dihydro-7-[(4aS,7aS)-octahydro-6H-pyrrolo[3,4-b]pyridin-6-yl]-4-oxo- |
| Structure | |
| Source | FRCD |
| Basis of prediction | Moxifloxacin |
| PubChem Link | Link |