Raw aquatic products
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0088 |
| Food Name | Raw aquatic products |
| Chinese Name | 生食水产品 |
| Picture |  |
| Food Group | 生食水产品 |
| Food Type | Non-processed food |
| Update Date | Jul 12, 2019 10:13 |
Illegal Additives
| CFAD ID | C0224 |
| Substance | Antibiotics |
| Molecule | Sulfanilamide |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C6H8N2O2S |
| InChi Key | FDDDEECHVMSUSB-UHFFFAOYSA-N |
| Isomeric SMILES | C1=CC(=CC=C1N)S(=O)(=O)N |
| Detection Method | Gbt21316-2007 determination of sulfonamides residues in foods of animal origin by HPLC - mass spectrometry |
| CFAD ID | C0228 |
| Substance | Antibiotics |
| Molecule | Chloramphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12Cl2N2O5 |
| InChi Key | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
| Isomeric SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0229 |
| Substance | Antibiotics |
| Molecule | Tetracycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H24N2O8 |
| InChi Key | NWXMGUDVXFXRIG-WESIUVDSSA-N |
| Isomeric SMILES | C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O |
| Detection Method | GB 21317-2007 Methods for determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0230 |
| Substance | Antibiotics |
| Molecule | Beta-Lactams |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C23H27N3O2 |
| InChi Key | OVJOKPNYPCRFNQ-FQEVSTJZSA-N |
| Isomeric SMILES | C1CCN([C@@H](C1)CC(=O)N)C(=O)C2=CC=C(C=C2)CN3CCC4=CC=CC=C43 |
| Detection Method | SN/T 2127-2008 method for determination of beta-lactam drug residues in imported and exported foods of animal origin, microbiological inhibition method |
| CFAD ID | C0326 |
| Substance | Chloramphenicol |
| Molecule | Chloramphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12Cl2N2O5 |
| InChi Key | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
| Isomeric SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0327 |
| Substance | Chloramphenicol |
| Molecule | M-Chloramphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12Cl2N2O5 |
| InChi Key | FTMJFHVKAXPFIY-RKDXNWHRSA-N |
| Isomeric SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0328 |
| Substance | Chloramphenicol |
| Molecule | Florfenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H14Cl2FNO4S |
| InChi Key | AYIRNRDRBQJXIF-NXEZZACHSA-N |
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)C(Cl)Cl)O |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0329 |
| Substance | Chloramphenicol |
| Molecule | Thiamphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H15Cl2NO5S |
| InChi Key | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0330 |
| Substance | Tetracycline |
| Molecule | Minocycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C23H27N3O7 |
| InChi Key | FFTVPQUHLQBXQZ-KVUCHLLUSA-N |
| Isomeric SMILES | CN(C)[C@H]1[C@@H]2C[C@@H]3CC4=C(C=CC(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)N(C)C |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0331 |
| Substance | Tetracycline |
| Molecule | Oxytetracycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H24N2O9 |
| InChi Key | OWFJMIVZYSDULZ-PXOLEDIWSA-N |
| Isomeric SMILES | C[C@@]1([C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0332 |
| Substance | Tetracycline |
| Molecule | Tetracycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H24N2O8 |
| InChi Key | NWXMGUDVXFXRIG-WESIUVDSSA-N |
| Isomeric SMILES | C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0333 |
| Substance | Tetracycline |
| Molecule | Demeclocycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C21H21ClN2O8 |
| InChi Key | GUXHBMASAHGULD-SEYHBJAFSA-N |
| Isomeric SMILES | CN(C)[C@H]1[C@@H]2C[C@@H]3[C@@H](C4=C(C=CC(=C4C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O)Cl)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0334 |
| Substance | Tetracycline |
| Molecule | Chlortetracycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H23ClN2O8 |
| InChi Key | DHPRQBPJLMKORJ-XRNKAMNCSA-N |
| Isomeric SMILES | C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C(C=CC(=C41)Cl)O)O)O)O)C(=O)N)N(C)C)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0335 |
| Substance | Tetracycline |
| Molecule | Methacycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H22N2O8 |
| InChi Key | XIYOPDCBBDCGOE-IWVLMIASSA-N |
| Isomeric SMILES | CN(C)[C@H]1[C@@H]2[C@H]([C@@H]3C(=C)C4=C(C(=CC=C4)O)C(=C3C(=O)[C@@]2(C(=C(C1=O)C(=O)N)O)O)O)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0336 |
| Substance | Tetracycline |
| Molecule | Doxycycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H24N2O8 |
| InChi Key | SGKRLCUYIXIAHR-AKNGSSGZSA-N |
| Isomeric SMILES | C[C@@H]1[C@H]2[C@@H]([C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0337 |
| Substance | Tetracycline |
| Molecule | 4-Epioxytetracycline |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H24N2O9 |
| InChi Key | OWFJMIVZYSDULZ-XQTMGWBRSA-N |
| Isomeric SMILES | C[C@@]1([C@H]2[C@@H](C3[C@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O)O |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0338 |
| Substance | Tetracycline |
| Molecule | Epitetracycline hydrochloride |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C22H25ClN2O8 |
| InChi Key | YCIHPQHVWDULOY-DXDJYCPMSA-N |
| Isomeric SMILES | C[C@@]1([C@H]2C[C@H]3[C@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.Cl |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0339 |
| Substance | Tetracycline |
| Molecule | Epichlotetracycline |
| Involved Links | Dining |
| Detection Method | GB 21317-2007 Determination of tetracycline residues in foods of animal origin, liquid chromatography-mass spectrometry/mass spectrometry and high performance liquid chromatography |
| CFAD ID | C0340 |
| Substance | Beta lactamides |
| Molecule | Benzyl penicillin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C16H18N2O4S |
| InChi Key | JGSARLDLIJGVTE-MBNYWOFBSA-N |
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C |
| Detection Method | SN/T 2127-2008 beta-lactamides in imported and exported foods of animal origin |
| CFAD ID | C0341 |
| Substance | Beta lactamides |
| Molecule | Ampicillin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C16H19N3O4S |
| InChi Key | AVKUERGKIZMTKX-NJBDSQKTSA-N |
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)C |
| Detection Method | SN/T 2127-2008 beta-lactamides in imported and exported foods of animal origin |
| CFAD ID | C0342 |
| Substance | Beta lactamides |
| Molecule | Amoxicillin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C16H19N3O5S |
| InChi Key | LSQZJLSUYDQPKJ-NJBDSQKTSA-N |
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)C(=O)O)C |
| Detection Method | SN/T 2127-2008 beta-lactamides in imported and exported foods of animal origin |
| CFAD ID | C0343 |
| Substance | Beta lactamides |
| Molecule | Cloxacillin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C19H18ClN3O5S |
| InChi Key | LQOLIRLGBULYKD-JKIFEVAISA-N |
| Isomeric SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)N[C@H]3[C@@H]4N(C3=O)[C@H](C(S4)(C)C)C(=O)O |
| Detection Method | SN/T 2127-2008 beta-lactamides in imported and exported foods of animal origin |
| CFAD ID | C0345 |
| Substance | Beta lactamides |
| Molecule | Benzacillin |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C48H56N6O8S2 |
| InChi Key | BVGLIYRKPOITBQ-ANPZCEIESA-N |
| Isomeric SMILES | CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.CC1([C@@H](N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O)C.C1=CC=C(C=C1)CNCCNCC2=CC=CC=C2 |
| Detection Method | SN/T 2127-2008 beta-lactamides in imported and exported foods of animal origin |
| CFAD ID | C0346 |
| Substance | Beta lactamides |
| Molecule | Ceftiofur |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C19H17N5O7S3 |
| InChi Key | ZBHXIWJRIFEVQY-IHMPYVIRSA-N |
| Isomeric SMILES | CO/N=C(/C1=CSC(=N1)N)\C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)CSC(=O)C4=CC=CO4)C(=O)O |
| Detection Method | SN/T 2127-2008 beta-lactamides in imported and exported foods of animal origin |
Predicted Illegal Additives
| ID | P1893 |
| Name | Benzenesulfonamide, 4-hydrazinyl-, hydrochloride (1:1) |
| Structure | |
| Source | HPV EPA Chemicals |
| Basis of prediction | Sulfanilamide |
| PubChem Link | Link |
| ID | P1894 |
| Name | 3-Mercuri-4-Aminobenzenesulfonamide |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Sulfanilamide |
| PubChem Link | Link |
| ID | P1895 |
| Name | Benzenesulfonamide |
| Structure | |
| Source | OECD HPV Chemicals |
| Basis of prediction | Sulfanilamide |
| PubChem Link | Link |
| ID | P0079 |
| Name | BROMAMPHENICOL |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chloramphenicol |
| PubChem Link | Link |
| ID | P1905 |
| Name | Alpha-N-Dichloroacetyl-P-Aminophenylserinol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chloramphenicol |
| PubChem Link | Link |
| ID | P1906 |
| Name | N-Acetyl-P-Nitrophenylserinol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chloramphenicol |
| PubChem Link | Link |
| ID | P0116 |
| Name | Thiamphenicol |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Florfenicol |
| PubChem Link | Link |
| ID | P0094 |
| Name | Florfenicol |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Thiamphenicol |
| PubChem Link | Link |
| ID | P2155 |
| Name | 4-Epitetracyclin |
| Structure | |
| Source | CAC Veterinary Drug, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Minocycline |
| PubChem Link | Link |
| ID | P2154 |
| Name | Tetracycline |
| Structure | |
| Source | CAC Veterinary Drug, National Health Commission of the People's Republic of China, ToxCast & Tox21 Chemicals |
| Basis of prediction | Minocycline |
| PubChem Link | Link |
| ID | P2156 |
| Name | Oxytetracycline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Oxytetracycline |
| PubChem Link | Link |
| ID | P2157 |
| Name | Oxytetracycline |
| Structure | |
| Source | T3DB |
| Basis of prediction | Oxytetracycline |
| PubChem Link | Link |
| ID | P0081 |
| Name | Tetracycline hydrochloride |
| Structure | |
| Source | HPV EPA Chemicals, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P0080 |
| Name | Hostacycline |
| Structure | |
| Source | HPV EPA Chemicals, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1908 |
| Name | Demeclocycline |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1909 |
| Name | Oxytetracycline |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1910 |
| Name | Doxycycline |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1911 |
| Name | Methacycline |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1912 |
| Name | Tigecycline |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1913 |
| Name | 4-epioxytetracyline |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1914 |
| Name | Oxytetracycline |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1915 |
| Name | Chlortetracycline |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1916 |
| Name | Bisolvomycin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1917 |
| Name | Minocycline |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1918 |
| Name | Chlortetracycline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1919 |
| Name | Doxycycline (anhydrous) |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1920 |
| Name | Rolitetracycline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1921 |
| Name | 4-Epoxytetracycline |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1923 |
| Name | 4-Epichlortetracyclin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1924 |
| Name | Meclocycline sulfosalicylate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1926 |
| Name | Minocycline, 9-amino |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1927 |
| Name | Demeclocycline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1928 |
| Name | Chlortetracyclin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1929 |
| Name | Minocycline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1930 |
| Name | Sancycline |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1931 |
| Name | Methacycline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1932 |
| Name | Doxycycline hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1933 |
| Name | Meclocycline |
| Structure | |
| Source | FRCD |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1934 |
| Name | Lymecycline |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1907 |
| Name | Minocycline |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1922 |
| Name | Rolitetracycline |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P1925 |
| Name | Oxytetracycline hydrochloride |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Tetracycline |
| PubChem Link | Link |
| ID | P2158 |
| Name | Clomocycline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chlortetracycline |
| PubChem Link | Link |
| ID | P2159 |
| Name | Doxycycline |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Doxycycline |
| PubChem Link | Link |
| ID | P0095 |
| Name | Penicillin G potassium |
| Structure | |
| Source | HPV EPA Chemicals, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2160 |
| Name | Carbenicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2161 |
| Name | Pivampicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2162 |
| Name | N-[(2S,4S,6R)-2-(dihydroxymethyl)-4-hydroxy-3,3-dimethyl-7-oxo-4lambda~4~-thia-1-azabicyclo[3.2.0]hept-6-yl]-2-phenylacetamide |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2163 |
| Name | (2s,5r,6r)-6-{[(6r)-6-(Glycylamino)-7-Oxido-7-Oxoheptanoyl]Amino}-3,3-Dimethyl-7-Oxo-4-Thia-1-Azabicyclo[3.2.0]Heptane-2-Carboxylate |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2164 |
| Name | Amoxicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2165 |
| Name | Azidocillin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2166 |
| Name | Cyclacillin |
| Structure | |
| Source | DrugBank, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2167 |
| Name | Isopenicillin N |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2168 |
| Name | Penicillin V |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2169 |
| Name | Ampicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals, IARC Carcinogens Group 3 |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2170 |
| Name | Amoxicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2171 |
| Name | CHEBI:59004 |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2172 |
| Name | Procaine penicillin G |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2173 |
| Name | Phenoxymethylpenicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2174 |
| Name | Amoxicillin Trihydrate |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2175 |
| Name | Procaine penicillin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2176 |
| Name | Carbenicillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2177 |
| Name | Penethecillin |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2178 |
| Name | Penicillin VK |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2179 |
| Name | 6-Aminopenicillanic acid |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2180 |
| Name | Ephicillin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2181 |
| Name | Ampicillin trihydrate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2184 |
| Name | Zinc64539870 |
| Structure | |
| Source | FRCD |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2182 |
| Name | Carbenicillin disodium |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2183 |
| Name | Benzathine penicillin G |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Benzyl penicillin |
| PubChem Link | Link |
| ID | P2185 |
| Name | Bacampicillin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2186 |
| Name | Piperacillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2187 |
| Name | Azlocillin |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2188 |
| Name | Benzylpenicillin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2189 |
| Name | Piperacillin |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2190 |
| Name | Aspoxicillin |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2191 |
| Name | Penicillin G |
| Structure | |
| Source | FRCD |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2192 |
| Name | Piperacillin sodium salt |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2193 |
| Name | Azlocillin sodium |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P2194 |
| Name | Bacampicillin hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ampicillin |
| PubChem Link | Link |
| ID | P0096 |
| Name | Cloxacillin sodium |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Cloxacillin |
| PubChem Link | Link |
| ID | P2195 |
| Name | Dicloxacillin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cloxacillin |
| PubChem Link | Link |
| ID | P2196 |
| Name | Flucloxacillin |
| Structure | |
| Source | DrugBank, ToxinDB |
| Basis of prediction | Cloxacillin |
| PubChem Link | Link |
| ID | P2197 |
| Name | Oxacillin |
| Structure | |
| Source | FRCD |
| Basis of prediction | Cloxacillin |
| PubChem Link | Link |
| ID | P2198 |
| Name | Oxacillin sodium salt |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Cloxacillin |
| PubChem Link | Link |
| ID | P2199 |
| Name | Dicloxacillin sodium salt monohydrate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Cloxacillin |
| PubChem Link | Link |
| ID | P0097 |
| Name | Ceftiofur sodium |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2201 |
| Name | Cefixime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2202 |
| Name | Cefdinir |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2203 |
| Name | Ceftizoxime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2204 |
| Name | Cefditoren |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2206 |
| Name | Cefmenoxime |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2207 |
| Name | Cefepime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2208 |
| Name | Cefpodoxime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2209 |
| Name | Cefotaxime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2210 |
| Name | Ceftazidime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2211 |
| Name | Ceftizoxime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2213 |
| Name | Cefotaxime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2214 |
| Name | CEFIXIME |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2215 |
| Name | Ceftriaxone |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2216 |
| Name | CEFPODOXIME |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2217 |
| Name | Cefyl |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2218 |
| Name | Cefpodoxime proxetil |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2219 |
| Name | Cefepime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2220 |
| Name | Desfuroylceftiofur |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2221 |
| Name | Cefetamet |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2223 |
| Name | Ceftizoxime sodium |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2224 |
| Name | Cefmenoxime hydrochloride |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2225 |
| Name | Cefpodoxime proxetil |
| Structure | |
| Source | CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2226 |
| Name | Ceftazidime pentahydrate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2227 |
| Name | Cefditorin pivoxil |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2228 |
| Name | Cefepime chloride hydrochloride hydrate |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2229 |
| Name | Cefodizime sodium |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2230 |
| Name | Cefpodoxime |
| Structure | |
| Source | FRCD |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2231 |
| Name | Cefetamet pivoxil |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2232 |
| Name | (6R,7R)-7-{[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-3-({[5-(carboxymethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl}methyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2233 |
| Name | Cefteram |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2234 |
| Name | Cefetamet pivoxil HCl |
| Structure | |
| Source | ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2205 |
| Name | Ceftriaxone |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2212 |
| Name | Ceftazidime |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |
| ID | P2222 |
| Name | Cefdinir |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Ceftiofur |
| PubChem Link | Link |