Honey
(right click,save link as to download,it is a temp file,please download as soon as possible, you can also use CTRL+S to save the whole html page)
Basic Info
| FADB-China ID | F0090 |
| Food Name | Honey |
| Chinese Name | 蜂蜜 |
| Picture |  |
| Food Group | 调味品 |
| Food Type | Processed food |
| Update Date | Jul 12, 2019 10:22 |
Illegal Additives
| CFAD ID | C0228 |
| Substance | Antibiotics |
| Molecule | Chloramphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12Cl2N2O5 |
| InChi Key | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
| Isomeric SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0326 |
| Substance | Chloramphenicol |
| Molecule | Chloramphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12Cl2N2O5 |
| InChi Key | WIIZWVCIJKGZOK-RKDXNWHRSA-N |
| Isomeric SMILES | C1=CC(=CC=C1[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O)[N+](=O)[O-] |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0327 |
| Substance | Chloramphenicol |
| Molecule | M-Chloramphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C11H12Cl2N2O5 |
| InChi Key | FTMJFHVKAXPFIY-RKDXNWHRSA-N |
| Isomeric SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0328 |
| Substance | Chloramphenicol |
| Molecule | Florfenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H14Cl2FNO4S |
| InChi Key | AYIRNRDRBQJXIF-NXEZZACHSA-N |
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)C(Cl)Cl)O |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0329 |
| Substance | Chloramphenicol |
| Molecule | Thiamphenicol |
| Involved Links | Dining |
| Structure | |
| Purpose of Addition | Sterilization, Antiseptic |
| Formula | C12H15Cl2NO5S |
| InChi Key | OTVAEFIXJLOWRX-NXEZZACHSA-N |
| Isomeric SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CO)NC(=O)C(Cl)Cl)O |
| Detection Method | GB/T 22338-2008 Determination of chloramphenicol residues in foods of animal origin |
| CFAD ID | C0368 |
| Substance | Invert syrups |
| Molecule | Invert sugar |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Increase weight or volume, Improve taste |
| Formula | C12H24O12 |
| InChi Key | PJVXUVWGSCCGHT-UHFFFAOYSA-N |
| Isomeric SMILES | C(C(C(C(C(C=O)O)O)O)O)O.C(C(C(C(C(=O)CO)O)O)O)O |
| Detection Method | anion-exchange liquid chromatography with pulsed amperometric detection |
| CFAD ID | C0370 |
| Substance | High-fructose corn syrup |
| Molecule | Fructose |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | Increase weight or volume, Improve taste |
| Formula | C6H12O6 |
| InChi Key | BJHIKXHVCXFQLS-UYFOZJQFSA-N |
| Isomeric SMILES | C([C@H]([C@H]([C@@H](C(=O)CO)O)O)O)O |
| Detection Method | anion-exchange liquid chromatography with pulsed amperometric detection |
| CFAD ID | C0382 |
| Substance | Honey |
| Molecule | Inverted sugar |
| Involved Links | Processing |
| Detection Method | near infrared spectroscopy |
| CFAD ID | C0385 |
| Substance | Honey |
| Molecule | High fructose corn syrup |
| Involved Links | Processing |
| Detection Method | near infrared spectroscopy |
| CFAD ID | C0443 |
| Substance | Honey |
| Molecule | Protopine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | None |
| Formula | C20H19NO5 |
| InChi Key | GPTFURBXHJWNHR-UHFFFAOYSA-N |
| Isomeric SMILES | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C5=C(C=C4)OCO5)OCO3 |
| Detection Method | ultra-high performance liquid chromatography-quadrupole time-of-flight mass spectrometry (UHPLC-MS/MS) |
| CFAD ID | C0444 |
| Substance | Honey |
| Molecule | Allocryptopine |
| Involved Links | Processing |
| Structure | |
| Purpose of Addition | None |
| Formula | C21H23NO5 |
| InChi Key | HYBRYAPKQCZIAE-UHFFFAOYSA-N |
| Isomeric SMILES | CN1CCC2=CC3=C(C=C2C(=O)CC4=C(C1)C(=C(C=C4)OC)OC)OCO3 |
| Detection Method | ultra-high performance liquid chromatography-quadrupole time-of-flight mass spectrometry (UHPLC-MS/MS) |
Predicted Illegal Additives
| ID | P0079 |
| Name | BROMAMPHENICOL |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chloramphenicol |
| PubChem Link | Link |
| ID | P1905 |
| Name | Alpha-N-Dichloroacetyl-P-Aminophenylserinol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chloramphenicol |
| PubChem Link | Link |
| ID | P1906 |
| Name | N-Acetyl-P-Nitrophenylserinol |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Chloramphenicol |
| PubChem Link | Link |
| ID | P0116 |
| Name | Thiamphenicol |
| Structure | |
| Source | DrugBank, CAC Veterinary Drug, ToxCast & Tox21 Chemicals |
| Basis of prediction | Florfenicol |
| PubChem Link | Link |
| ID | P0094 |
| Name | Florfenicol |
| Structure | |
| Source | CAC Veterinary Drug |
| Basis of prediction | Thiamphenicol |
| PubChem Link | Link |
| ID | P2275 |
| Name | Tagatose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2276 |
| Name | D-(-)-Fructose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2277 |
| Name | Sorbinose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2278 |
| Name | D(-)-Tagatose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2279 |
| Name | Erythrohexulose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2280 |
| Name | LEVULOSE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2281 |
| Name | D-Tagatose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2282 |
| Name | SORBOSE |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2283 |
| Name | D-Fructose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2274 |
| Name | D-tagatose |
| Structure | |
| Source | FRCD |
| Basis of prediction | Invert sugar |
| PubChem Link | Link |
| ID | P2268 |
| Name | (3h)glucose |
| Structure | |
| Source | T3DB |
| Basis of prediction | Fructose |
| PubChem Link | Link |
| ID | P2269 |
| Name | INVERT SUGAR |
| Structure | |
| Source | T3DB |
| Basis of prediction | Fructose |
| PubChem Link | Link |
| ID | P2270 |
| Name | 3-O-Methylfructose in Linear Form |
| Structure | |
| Source | DrugBank |
| Basis of prediction | Fructose |
| PubChem Link | Link |
| ID | P2271 |
| Name | L-xylo-hex-2-ulosonic acid |
| Structure | |
| Source | FRCD |
| Basis of prediction | Fructose |
| PubChem Link | Link |
| ID | P2444 |
| Name | Protopine |
| Structure | |
| Source | ToxinDB, T3DB |
| Basis of prediction | Allocryptopine |
| PubChem Link | Link |